10713 lines
361 KiB
JavaScript
10713 lines
361 KiB
JavaScript
(function (root, factory) {
|
|
if (typeof define === 'function' && define.amd) {
|
|
// AMD. Register as an anonymous module.
|
|
define(function () {
|
|
return (root.cv = factory());
|
|
});
|
|
} else if (typeof module === 'object' && module.exports) {
|
|
// Node. Does not work with strict CommonJS, but
|
|
// only CommonJS-like environments that support module.exports,
|
|
// like Node.
|
|
module.exports = factory();
|
|
} else {
|
|
// Browser globals
|
|
root.cv = factory();
|
|
}
|
|
}(this, function () {
|
|
var cv = function(cv) {
|
|
cv = cv || {};
|
|
var Module = cv;
|
|
|
|
var Module;
|
|
if (typeof Module === "undefined") Module = {};
|
|
if (!Module.expectedDataFileDownloads) {
|
|
Module.expectedDataFileDownloads = 0;
|
|
Module.finishedDataFileDownloads = 0
|
|
}
|
|
Module.expectedDataFileDownloads++;
|
|
((function() {
|
|
var loadPackage = (function(metadata) {
|
|
var PACKAGE_PATH;
|
|
if (typeof window === "object") {
|
|
PACKAGE_PATH = window["encodeURIComponent"](window.location.pathname.toString().substring(0, window.location.pathname.toString().lastIndexOf("/")) + "/")
|
|
} else if (typeof location !== "undefined") {
|
|
PACKAGE_PATH = encodeURIComponent(location.pathname.toString().substring(0, location.pathname.toString().lastIndexOf("/")) + "/")
|
|
} else {
|
|
throw "using preloaded data can only be done on a web page or in a web worker"
|
|
}
|
|
var PACKAGE_NAME = "../../build/cv-wasm.data";
|
|
var REMOTE_PACKAGE_BASE = "cv-wasm.data";
|
|
if (typeof Module["locateFilePackage"] === "function" && !Module["locateFile"]) {
|
|
Module["locateFile"] = Module["locateFilePackage"];
|
|
Module.printErr("warning: you defined Module.locateFilePackage, that has been renamed to Module.locateFile (using your locateFilePackage for now)")
|
|
}
|
|
var REMOTE_PACKAGE_NAME = typeof Module["locateFile"] === "function" ? Module["locateFile"](REMOTE_PACKAGE_BASE) : (Module["filePackagePrefixURL"] || "") + REMOTE_PACKAGE_BASE;
|
|
var REMOTE_PACKAGE_SIZE = metadata.remote_package_size;
|
|
var PACKAGE_UUID = metadata.package_uuid;
|
|
|
|
function fetchRemotePackage(packageName, packageSize, callback, errback) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", packageName, true);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.onprogress = (function(event) {
|
|
var url = packageName;
|
|
var size = packageSize;
|
|
if (event.total) size = event.total;
|
|
if (event.loaded) {
|
|
if (!xhr.addedTotal) {
|
|
xhr.addedTotal = true;
|
|
if (!Module.dataFileDownloads) Module.dataFileDownloads = {};
|
|
Module.dataFileDownloads[url] = {
|
|
loaded: event.loaded,
|
|
total: size
|
|
}
|
|
} else {
|
|
Module.dataFileDownloads[url].loaded = event.loaded
|
|
}
|
|
var total = 0;
|
|
var loaded = 0;
|
|
var num = 0;
|
|
for (var download in Module.dataFileDownloads) {
|
|
var data = Module.dataFileDownloads[download];
|
|
total += data.total;
|
|
loaded += data.loaded;
|
|
num++
|
|
}
|
|
total = Math.ceil(total * Module.expectedDataFileDownloads / num);
|
|
if (Module["setStatus"]) Module["setStatus"]("Downloading data... (" + loaded + "/" + total + ")")
|
|
} else if (!Module.dataFileDownloads) {
|
|
if (Module["setStatus"]) Module["setStatus"]("Downloading data...")
|
|
}
|
|
});
|
|
xhr.onerror = (function(event) {
|
|
throw new Error("NetworkError for: " + packageName)
|
|
});
|
|
xhr.onload = (function(event) {
|
|
if (xhr.status == 200 || xhr.status == 304 || xhr.status == 206 || xhr.status == 0 && xhr.response) {
|
|
var packageData = xhr.response;
|
|
callback(packageData)
|
|
} else {
|
|
throw new Error(xhr.statusText + " : " + xhr.responseURL)
|
|
}
|
|
});
|
|
xhr.send(null)
|
|
}
|
|
|
|
function handleError(error) {
|
|
console.error("package error:", error)
|
|
}
|
|
var fetchedCallback = null;
|
|
var fetched = Module["getPreloadedPackage"] ? Module["getPreloadedPackage"](REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE) : null;
|
|
if (!fetched) fetchRemotePackage(REMOTE_PACKAGE_NAME, REMOTE_PACKAGE_SIZE, (function(data) {
|
|
if (fetchedCallback) {
|
|
fetchedCallback(data);
|
|
fetchedCallback = null
|
|
} else {
|
|
fetched = data
|
|
}
|
|
}), handleError);
|
|
|
|
function runWithFS() {
|
|
function assert(check, msg) {
|
|
if (!check) throw msg + (new Error).stack
|
|
}
|
|
Module["FS_createPath"]("/", "test", true, true);
|
|
Module["FS_createPath"]("/test", "data", true, true);
|
|
|
|
function DataRequest(start, end, crunched, audio) {
|
|
this.start = start;
|
|
this.end = end;
|
|
this.crunched = crunched;
|
|
this.audio = audio
|
|
}
|
|
DataRequest.prototype = {
|
|
requests: {},
|
|
open: (function(mode, name) {
|
|
this.name = name;
|
|
this.requests[name] = this;
|
|
Module["addRunDependency"]("fp " + this.name)
|
|
}),
|
|
send: (function() {}),
|
|
onload: (function() {
|
|
var byteArray = this.byteArray.subarray(this.start, this.end);
|
|
this.finish(byteArray)
|
|
}),
|
|
finish: (function(byteArray) {
|
|
var that = this;
|
|
Module["FS_createDataFile"](this.name, null, byteArray, true, true, true);
|
|
Module["removeRunDependency"]("fp " + that.name);
|
|
this.requests[this.name] = null
|
|
})
|
|
};
|
|
var files = metadata.files;
|
|
for (i = 0; i < files.length; ++i) {
|
|
(new DataRequest(files[i].start, files[i].end, files[i].crunched, files[i].audio)).open("GET", files[i].filename)
|
|
}
|
|
|
|
function processPackageData(arrayBuffer) {
|
|
Module.finishedDataFileDownloads++;
|
|
assert(arrayBuffer, "Loading data file failed.");
|
|
assert(arrayBuffer instanceof ArrayBuffer, "bad input to processPackageData");
|
|
var byteArray = new Uint8Array(arrayBuffer);
|
|
if (Module["SPLIT_MEMORY"]) Module.printErr("warning: you should run the file packager with --no-heap-copy when SPLIT_MEMORY is used, otherwise copying into the heap may fail due to the splitting");
|
|
var ptr = Module["getMemory"](byteArray.length);
|
|
Module["HEAPU8"].set(byteArray, ptr);
|
|
DataRequest.prototype.byteArray = Module["HEAPU8"].subarray(ptr, ptr + byteArray.length);
|
|
var files = metadata.files;
|
|
for (i = 0; i < files.length; ++i) {
|
|
DataRequest.prototype.requests[files[i].filename].onload()
|
|
}
|
|
Module["removeRunDependency"]("datafile_../../build/cv-wasm.data")
|
|
}
|
|
Module["addRunDependency"]("datafile_../../build/cv-wasm.data");
|
|
if (!Module.preloadResults) Module.preloadResults = {};
|
|
Module.preloadResults[PACKAGE_NAME] = {
|
|
fromCache: false
|
|
};
|
|
if (fetched) {
|
|
processPackageData(fetched);
|
|
fetched = null
|
|
} else {
|
|
fetchedCallback = processPackageData
|
|
}
|
|
}
|
|
if (Module["calledRun"]) {
|
|
runWithFS()
|
|
} else {
|
|
if (!Module["preRun"]) Module["preRun"] = [];
|
|
Module["preRun"].push(runWithFS)
|
|
}
|
|
});
|
|
loadPackage({
|
|
"files":[
|
|
{
|
|
"audio": 0,
|
|
"start": 129768,
|
|
"crunched": 0,
|
|
"end": 471174,
|
|
"filename": "/test/data/haarcascade_eye.xml"
|
|
},
|
|
{
|
|
"audio": 0,
|
|
"start": 475724,
|
|
"crunched": 0,
|
|
"end": 1405851,
|
|
"filename": "/test/data/haarcascade_frontalface_default.xml"
|
|
}],
|
|
"remote_package_size": 1405851,
|
|
"package_uuid": "dc160868-5d20-4fa9-9fa1-47aa876cd0af"
|
|
})
|
|
}))();
|
|
var Module;
|
|
if (!Module) Module = (typeof cv !== "undefined" ? cv : null) || {};
|
|
var moduleOverrides = {};
|
|
for (var key in Module) {
|
|
if (Module.hasOwnProperty(key)) {
|
|
moduleOverrides[key] = Module[key]
|
|
}
|
|
}
|
|
var ENVIRONMENT_IS_WEB = false;
|
|
var ENVIRONMENT_IS_WORKER = false;
|
|
var ENVIRONMENT_IS_NODE = false;
|
|
var ENVIRONMENT_IS_SHELL = false;
|
|
if (Module["ENVIRONMENT"]) {
|
|
if (Module["ENVIRONMENT"] === "WEB") {
|
|
ENVIRONMENT_IS_WEB = true
|
|
} else if (Module["ENVIRONMENT"] === "WORKER") {
|
|
ENVIRONMENT_IS_WORKER = true
|
|
} else if (Module["ENVIRONMENT"] === "NODE") {
|
|
ENVIRONMENT_IS_NODE = true
|
|
} else if (Module["ENVIRONMENT"] === "SHELL") {
|
|
ENVIRONMENT_IS_SHELL = true
|
|
} else {
|
|
throw new Error("The provided Module['ENVIRONMENT'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.")
|
|
}
|
|
} else {
|
|
ENVIRONMENT_IS_WEB = typeof window === "object";
|
|
ENVIRONMENT_IS_WORKER = typeof importScripts === "function";
|
|
ENVIRONMENT_IS_NODE = typeof process === "object" && typeof require === "function" && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
|
|
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER
|
|
}
|
|
Module["read"] = function shell_read(url) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, false);
|
|
xhr.send(null);
|
|
return xhr.responseText
|
|
};
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module["readBinary"] = function readBinary(url) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, false);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.send(null);
|
|
return new Uint8Array(xhr.response)
|
|
}
|
|
}
|
|
Module["readAsync"] = function readAsync(url, onload, onerror) {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, true);
|
|
xhr.responseType = "arraybuffer";
|
|
xhr.onload = function xhr_onload() {
|
|
if (xhr.status == 200 || xhr.status == 0 && xhr.response) {
|
|
onload(xhr.response)
|
|
} else {
|
|
onerror()
|
|
}
|
|
};
|
|
xhr.onerror = onerror;
|
|
xhr.send(null)
|
|
};
|
|
if (typeof arguments != "undefined") {
|
|
Module["arguments"] = arguments
|
|
}
|
|
if (typeof console !== "undefined") {
|
|
if (!Module["print"]) Module["print"] = function shell_print(x) {
|
|
console.log(x)
|
|
};
|
|
if (!Module["printErr"]) Module["printErr"] = function shell_printErr(x) {
|
|
console.warn(x)
|
|
}
|
|
} else {
|
|
var TRY_USE_DUMP = false;
|
|
if (!Module["print"]) Module["print"] = TRY_USE_DUMP && typeof dump !== "undefined" ? (function(x) {
|
|
dump(x)
|
|
}) : (function(x) {})
|
|
}
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module["load"] = importScripts
|
|
}
|
|
if (typeof Module["setWindowTitle"] === "undefined") {
|
|
Module["setWindowTitle"] = (function(title) {
|
|
document.title = title
|
|
})
|
|
}
|
|
function globalEval(x) {
|
|
eval.call(null, x)
|
|
}
|
|
if (!Module["load"] && Module["read"]) {
|
|
Module["load"] = function load(f) {
|
|
globalEval(Module["read"](f))
|
|
}
|
|
}
|
|
if (!Module["print"]) {
|
|
Module["print"] = (function() {})
|
|
}
|
|
if (!Module["printErr"]) {
|
|
Module["printErr"] = Module["print"]
|
|
}
|
|
if (!Module["arguments"]) {
|
|
Module["arguments"] = []
|
|
}
|
|
if (!Module["thisProgram"]) {
|
|
Module["thisProgram"] = "./this.program"
|
|
}
|
|
if (!Module["quit"]) {
|
|
Module["quit"] = (function(status, toThrow) {
|
|
throw toThrow
|
|
})
|
|
}
|
|
Module.print = Module["print"];
|
|
Module.printErr = Module["printErr"];
|
|
Module["preRun"] = [];
|
|
Module["postRun"] = [];
|
|
for (var key in moduleOverrides) {
|
|
if (moduleOverrides.hasOwnProperty(key)) {
|
|
Module[key] = moduleOverrides[key]
|
|
}
|
|
}
|
|
moduleOverrides = undefined;
|
|
var Runtime = {
|
|
setTempRet0: (function(value) {
|
|
tempRet0 = value;
|
|
return value
|
|
}),
|
|
getTempRet0: (function() {
|
|
return tempRet0
|
|
}),
|
|
stackSave: (function() {
|
|
return STACKTOP
|
|
}),
|
|
stackRestore: (function(stackTop) {
|
|
STACKTOP = stackTop
|
|
}),
|
|
getNativeTypeSize: (function(type) {
|
|
switch (type) {
|
|
case "i1":
|
|
case "i8":
|
|
return 1;
|
|
case "i16":
|
|
return 2;
|
|
case "i32":
|
|
return 4;
|
|
case "i64":
|
|
return 8;
|
|
case "float":
|
|
return 4;
|
|
case "double":
|
|
return 8;
|
|
default:
|
|
{
|
|
if (type[type.length - 1] === "*") {
|
|
return Runtime.QUANTUM_SIZE
|
|
} else if (type[0] === "i") {
|
|
var bits = parseInt(type.substr(1));
|
|
assert(bits % 8 === 0);
|
|
return bits / 8
|
|
} else {
|
|
return 0
|
|
}
|
|
}
|
|
}
|
|
}),
|
|
getNativeFieldSize: (function(type) {
|
|
return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE)
|
|
}),
|
|
STACK_ALIGN: 16,
|
|
prepVararg: (function(ptr, type) {
|
|
if (type === "double" || type === "i64") {
|
|
if (ptr & 7) {
|
|
assert((ptr & 7) === 4);
|
|
ptr += 4
|
|
}
|
|
} else {
|
|
assert((ptr & 3) === 0)
|
|
}
|
|
return ptr
|
|
}),
|
|
getAlignSize: (function(type, size, vararg) {
|
|
if (!vararg && (type == "i64" || type == "double")) return 8;
|
|
if (!type) return Math.min(size, 8);
|
|
return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE)
|
|
}),
|
|
dynCall: (function(sig, ptr, args) {
|
|
if (args && args.length) {
|
|
return Module["dynCall_" + sig].apply(null, [ptr].concat(args))
|
|
} else {
|
|
return Module["dynCall_" + sig].call(null, ptr)
|
|
}
|
|
}),
|
|
functionPointers: [],
|
|
addFunction: (function(func) {
|
|
for (var i = 0; i < Runtime.functionPointers.length; i++) {
|
|
if (!Runtime.functionPointers[i]) {
|
|
Runtime.functionPointers[i] = func;
|
|
return 2 * (1 + i)
|
|
}
|
|
}
|
|
throw "Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS."
|
|
}),
|
|
removeFunction: (function(index) {
|
|
Runtime.functionPointers[(index - 2) / 2] = null
|
|
}),
|
|
warnOnce: (function(text) {
|
|
if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
|
|
if (!Runtime.warnOnce.shown[text]) {
|
|
Runtime.warnOnce.shown[text] = 1;
|
|
Module.printErr(text)
|
|
}
|
|
}),
|
|
funcWrappers: {},
|
|
getFuncWrapper: (function(func, sig) {
|
|
assert(sig);
|
|
if (!Runtime.funcWrappers[sig]) {
|
|
Runtime.funcWrappers[sig] = {}
|
|
}
|
|
var sigCache = Runtime.funcWrappers[sig];
|
|
if (!sigCache[func]) {
|
|
if (sig.length === 1) {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return Runtime.dynCall(sig, func)
|
|
}
|
|
} else if (sig.length === 2) {
|
|
sigCache[func] = function dynCall_wrapper(arg) {
|
|
return Runtime.dynCall(sig, func, [arg])
|
|
}
|
|
} else {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments))
|
|
}
|
|
}
|
|
}
|
|
return sigCache[func]
|
|
}),
|
|
getCompilerSetting: (function(name) {
|
|
throw "You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work"
|
|
}),
|
|
stackAlloc: (function(size) {
|
|
var ret = STACKTOP;
|
|
STACKTOP = STACKTOP + size | 0;
|
|
STACKTOP = STACKTOP + 15 & -16;
|
|
return ret
|
|
}),
|
|
staticAlloc: (function(size) {
|
|
var ret = STATICTOP;
|
|
STATICTOP = STATICTOP + size | 0;
|
|
STATICTOP = STATICTOP + 15 & -16;
|
|
return ret
|
|
}),
|
|
dynamicAlloc: (function(size) {
|
|
var ret = HEAP32[DYNAMICTOP_PTR >> 2];
|
|
var end = (ret + size + 15 | 0) & -16;
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = end;
|
|
if (end >= TOTAL_MEMORY) {
|
|
var success = enlargeMemory();
|
|
if (!success) {
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = ret;
|
|
return 0
|
|
}
|
|
}
|
|
return ret
|
|
}),
|
|
alignMemory: (function(size, quantum) {
|
|
var ret = size = Math.ceil(size / (quantum ? quantum : 16)) * (quantum ? quantum : 16);
|
|
return ret
|
|
}),
|
|
makeBigInt: (function(low, high, unsigned) {
|
|
var ret = unsigned ? +(low >>> 0) + +(high >>> 0) * 4294967296 : +(low >>> 0) + +(high | 0) * 4294967296;
|
|
return ret
|
|
}),
|
|
GLOBAL_BASE: 1024,
|
|
QUANTUM_SIZE: 4,
|
|
__dummy__: 0
|
|
};
|
|
Module["Runtime"] = Runtime;
|
|
var ABORT = 0;
|
|
var EXITSTATUS = 0;
|
|
|
|
function assert(condition, text) {
|
|
if (!condition) {
|
|
abort("Assertion failed: " + text)
|
|
}
|
|
}
|
|
|
|
function getCFunc(ident) {
|
|
var func = Module["_" + ident];
|
|
if (!func) {
|
|
try {
|
|
func = eval("_" + ident)
|
|
} catch (e) {}
|
|
}
|
|
assert(func, "Cannot call unknown function " + ident + " (perhaps LLVM optimizations or closure removed it?)");
|
|
return func
|
|
}
|
|
var cwrap, ccall;
|
|
((function() {
|
|
var JSfuncs = {
|
|
"stackSave": (function() {
|
|
Runtime.stackSave()
|
|
}),
|
|
"stackRestore": (function() {
|
|
Runtime.stackRestore()
|
|
}),
|
|
"arrayToC": (function(arr) {
|
|
var ret = Runtime.stackAlloc(arr.length);
|
|
writeArrayToMemory(arr, ret);
|
|
return ret
|
|
}),
|
|
"stringToC": (function(str) {
|
|
var ret = 0;
|
|
if (str !== null && str !== undefined && str !== 0) {
|
|
var len = (str.length << 2) + 1;
|
|
ret = Runtime.stackAlloc(len);
|
|
stringToUTF8(str, ret, len)
|
|
}
|
|
return ret
|
|
})
|
|
};
|
|
var toC = {
|
|
"string": JSfuncs["stringToC"],
|
|
"array": JSfuncs["arrayToC"]
|
|
};
|
|
ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
|
|
var func = getCFunc(ident);
|
|
var cArgs = [];
|
|
var stack = 0;
|
|
if (args) {
|
|
for (var i = 0; i < args.length; i++) {
|
|
var converter = toC[argTypes[i]];
|
|
if (converter) {
|
|
if (stack === 0) stack = Runtime.stackSave();
|
|
cArgs[i] = converter(args[i])
|
|
} else {
|
|
cArgs[i] = args[i]
|
|
}
|
|
}
|
|
}
|
|
var ret = func.apply(null, cArgs);
|
|
if (returnType === "string") ret = Pointer_stringify(ret);
|
|
if (stack !== 0) {
|
|
if (opts && opts.async) {
|
|
EmterpreterAsync.asyncFinalizers.push((function() {
|
|
Runtime.stackRestore(stack)
|
|
}));
|
|
return
|
|
}
|
|
Runtime.stackRestore(stack)
|
|
}
|
|
return ret
|
|
};
|
|
var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
|
|
|
|
function parseJSFunc(jsfunc) {
|
|
var parsed = jsfunc.toString().match(sourceRegex).slice(1);
|
|
return {
|
|
arguments: parsed[0],
|
|
body: parsed[1],
|
|
returnValue: parsed[2]
|
|
}
|
|
}
|
|
var JSsource = null;
|
|
|
|
function ensureJSsource() {
|
|
if (!JSsource) {
|
|
JSsource = {};
|
|
for (var fun in JSfuncs) {
|
|
if (JSfuncs.hasOwnProperty(fun)) {
|
|
JSsource[fun] = parseJSFunc(JSfuncs[fun])
|
|
}
|
|
}
|
|
}
|
|
}
|
|
cwrap = function cwrap(ident, returnType, argTypes) {
|
|
argTypes = argTypes || [];
|
|
var cfunc = getCFunc(ident);
|
|
var numericArgs = argTypes.every((function(type) {
|
|
return type === "number"
|
|
}));
|
|
var numericRet = returnType !== "string";
|
|
if (numericRet && numericArgs) {
|
|
return cfunc
|
|
}
|
|
var argNames = argTypes.map((function(x, i) {
|
|
return "$" + i
|
|
}));
|
|
var funcstr = "(function(" + argNames.join(",") + ") {";
|
|
var nargs = argTypes.length;
|
|
if (!numericArgs) {
|
|
ensureJSsource();
|
|
funcstr += "var stack = " + JSsource["stackSave"].body + ";";
|
|
for (var i = 0; i < nargs; i++) {
|
|
var arg = argNames[i],
|
|
type = argTypes[i];
|
|
if (type === "number") continue;
|
|
var convertCode = JSsource[type + "ToC"];
|
|
funcstr += "var " + convertCode.arguments + " = " + arg + ";";
|
|
funcstr += convertCode.body + ";";
|
|
funcstr += arg + "=(" + convertCode.returnValue + ");"
|
|
}
|
|
}
|
|
var cfuncname = parseJSFunc((function() {
|
|
return cfunc
|
|
})).returnValue;
|
|
funcstr += "var ret = " + cfuncname + "(" + argNames.join(",") + ");";
|
|
if (!numericRet) {
|
|
var strgfy = parseJSFunc((function() {
|
|
return Pointer_stringify
|
|
})).returnValue;
|
|
funcstr += "ret = " + strgfy + "(ret);"
|
|
}
|
|
if (!numericArgs) {
|
|
ensureJSsource();
|
|
funcstr += JSsource["stackRestore"].body.replace("()", "(stack)") + ";"
|
|
}
|
|
funcstr += "return ret})";
|
|
return eval(funcstr)
|
|
}
|
|
}))();
|
|
Module["ccall"] = ccall;
|
|
Module["cwrap"] = cwrap;
|
|
|
|
function setValue(ptr, value, type, noSafe) {
|
|
type = type || "i8";
|
|
if (type.charAt(type.length - 1) === "*") type = "i32";
|
|
switch (type) {
|
|
case "i1":
|
|
HEAP8[ptr >> 0] = value;
|
|
break;
|
|
case "i8":
|
|
HEAP8[ptr >> 0] = value;
|
|
break;
|
|
case "i16":
|
|
HEAP16[ptr >> 1] = value;
|
|
break;
|
|
case "i32":
|
|
HEAP32[ptr >> 2] = value;
|
|
break;
|
|
case "i64":
|
|
tempI64 = [value >>> 0, (tempDouble = value, +Math_abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math_min(+Math_floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math_ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0)], HEAP32[ptr >> 2] = tempI64[0], HEAP32[ptr + 4 >> 2] = tempI64[1];
|
|
break;
|
|
case "float":
|
|
HEAPF32[ptr >> 2] = value;
|
|
break;
|
|
case "double":
|
|
HEAPF64[ptr >> 3] = value;
|
|
break;
|
|
default:
|
|
abort("invalid type for setValue: " + type)
|
|
}
|
|
}
|
|
Module["setValue"] = setValue;
|
|
|
|
function getValue(ptr, type, noSafe) {
|
|
type = type || "i8";
|
|
if (type.charAt(type.length - 1) === "*") type = "i32";
|
|
switch (type) {
|
|
case "i1":
|
|
return HEAP8[ptr >> 0];
|
|
case "i8":
|
|
return HEAP8[ptr >> 0];
|
|
case "i16":
|
|
return HEAP16[ptr >> 1];
|
|
case "i32":
|
|
return HEAP32[ptr >> 2];
|
|
case "i64":
|
|
return HEAP32[ptr >> 2];
|
|
case "float":
|
|
return HEAPF32[ptr >> 2];
|
|
case "double":
|
|
return HEAPF64[ptr >> 3];
|
|
default:
|
|
abort("invalid type for setValue: " + type)
|
|
}
|
|
return null
|
|
}
|
|
Module["getValue"] = getValue;
|
|
var ALLOC_NORMAL = 0;
|
|
var ALLOC_STACK = 1;
|
|
var ALLOC_STATIC = 2;
|
|
var ALLOC_DYNAMIC = 3;
|
|
var ALLOC_NONE = 4;
|
|
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
|
|
Module["ALLOC_STACK"] = ALLOC_STACK;
|
|
Module["ALLOC_STATIC"] = ALLOC_STATIC;
|
|
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
|
|
Module["ALLOC_NONE"] = ALLOC_NONE;
|
|
|
|
function allocate(slab, types, allocator, ptr) {
|
|
var zeroinit, size;
|
|
if (typeof slab === "number") {
|
|
zeroinit = true;
|
|
size = slab
|
|
} else {
|
|
zeroinit = false;
|
|
size = slab.length
|
|
}
|
|
var singleType = typeof types === "string" ? types : null;
|
|
var ret;
|
|
if (allocator == ALLOC_NONE) {
|
|
ret = ptr
|
|
} else {
|
|
ret = [typeof _malloc === "function" ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length))
|
|
}
|
|
if (zeroinit) {
|
|
var ptr = ret,
|
|
stop;
|
|
assert((ret & 3) == 0);
|
|
stop = ret + (size & ~3);
|
|
for (; ptr < stop; ptr += 4) {
|
|
HEAP32[ptr >> 2] = 0
|
|
}
|
|
stop = ret + size;
|
|
while (ptr < stop) {
|
|
HEAP8[ptr++ >> 0] = 0
|
|
}
|
|
return ret
|
|
}
|
|
if (singleType === "i8") {
|
|
if (slab.subarray || slab.slice) {
|
|
HEAPU8.set(slab, ret)
|
|
} else {
|
|
HEAPU8.set(new Uint8Array(slab), ret)
|
|
}
|
|
return ret
|
|
}
|
|
var i = 0,
|
|
type, typeSize, previousType;
|
|
while (i < size) {
|
|
var curr = slab[i];
|
|
if (typeof curr === "function") {
|
|
curr = Runtime.getFunctionIndex(curr)
|
|
}
|
|
type = singleType || types[i];
|
|
if (type === 0) {
|
|
i++;
|
|
continue
|
|
}
|
|
if (type == "i64") type = "i32";
|
|
setValue(ret + i, curr, type);
|
|
if (previousType !== type) {
|
|
typeSize = Runtime.getNativeTypeSize(type);
|
|
previousType = type
|
|
}
|
|
i += typeSize
|
|
}
|
|
return ret
|
|
}
|
|
Module["allocate"] = allocate;
|
|
|
|
function getMemory(size) {
|
|
if (!staticSealed) return Runtime.staticAlloc(size);
|
|
if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
|
|
return _malloc(size)
|
|
}
|
|
Module["getMemory"] = getMemory;
|
|
|
|
function Pointer_stringify(ptr, length) {
|
|
if (length === 0 || !ptr) return "";
|
|
var hasUtf = 0;
|
|
var t;
|
|
var i = 0;
|
|
while (1) {
|
|
t = HEAPU8[ptr + i >> 0];
|
|
hasUtf |= t;
|
|
if (t == 0 && !length) break;
|
|
i++;
|
|
if (length && i == length) break
|
|
}
|
|
if (!length) length = i;
|
|
var ret = "";
|
|
if (hasUtf < 128) {
|
|
var MAX_CHUNK = 1024;
|
|
var curr;
|
|
while (length > 0) {
|
|
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
|
|
ret = ret ? ret + curr : curr;
|
|
ptr += MAX_CHUNK;
|
|
length -= MAX_CHUNK
|
|
}
|
|
return ret
|
|
}
|
|
return Module["UTF8ToString"](ptr)
|
|
}
|
|
Module["Pointer_stringify"] = Pointer_stringify;
|
|
|
|
function AsciiToString(ptr) {
|
|
var str = "";
|
|
while (1) {
|
|
var ch = HEAP8[ptr++ >> 0];
|
|
if (!ch) return str;
|
|
str += String.fromCharCode(ch)
|
|
}
|
|
}
|
|
Module["AsciiToString"] = AsciiToString;
|
|
|
|
function stringToAscii(str, outPtr) {
|
|
return writeAsciiToMemory(str, outPtr, false)
|
|
}
|
|
Module["stringToAscii"] = stringToAscii;
|
|
var UTF8Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf8") : undefined;
|
|
|
|
function UTF8ArrayToString(u8Array, idx) {
|
|
var endPtr = idx;
|
|
while (u8Array[endPtr]) ++endPtr;
|
|
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
|
|
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr))
|
|
} else {
|
|
var u0, u1, u2, u3, u4, u5;
|
|
var str = "";
|
|
while (1) {
|
|
u0 = u8Array[idx++];
|
|
if (!u0) return str;
|
|
if (!(u0 & 128)) {
|
|
str += String.fromCharCode(u0);
|
|
continue
|
|
}
|
|
u1 = u8Array[idx++] & 63;
|
|
if ((u0 & 224) == 192) {
|
|
str += String.fromCharCode((u0 & 31) << 6 | u1);
|
|
continue
|
|
}
|
|
u2 = u8Array[idx++] & 63;
|
|
if ((u0 & 240) == 224) {
|
|
u0 = (u0 & 15) << 12 | u1 << 6 | u2
|
|
} else {
|
|
u3 = u8Array[idx++] & 63;
|
|
if ((u0 & 248) == 240) {
|
|
u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | u3
|
|
} else {
|
|
u4 = u8Array[idx++] & 63;
|
|
if ((u0 & 252) == 248) {
|
|
u0 = (u0 & 3) << 24 | u1 << 18 | u2 << 12 | u3 << 6 | u4
|
|
} else {
|
|
u5 = u8Array[idx++] & 63;
|
|
u0 = (u0 & 1) << 30 | u1 << 24 | u2 << 18 | u3 << 12 | u4 << 6 | u5
|
|
}
|
|
}
|
|
}
|
|
if (u0 < 65536) {
|
|
str += String.fromCharCode(u0)
|
|
} else {
|
|
var ch = u0 - 65536;
|
|
str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023)
|
|
}
|
|
}
|
|
}
|
|
}
|
|
Module["UTF8ArrayToString"] = UTF8ArrayToString;
|
|
|
|
function UTF8ToString(ptr) {
|
|
return UTF8ArrayToString(HEAPU8, ptr)
|
|
}
|
|
Module["UTF8ToString"] = UTF8ToString;
|
|
|
|
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
|
|
if (!(maxBytesToWrite > 0)) return 0;
|
|
var startIdx = outIdx;
|
|
var endIdx = outIdx + maxBytesToWrite - 1;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
var u = str.charCodeAt(i);
|
|
if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023;
|
|
if (u <= 127) {
|
|
if (outIdx >= endIdx) break;
|
|
outU8Array[outIdx++] = u
|
|
} else if (u <= 2047) {
|
|
if (outIdx + 1 >= endIdx) break;
|
|
outU8Array[outIdx++] = 192 | u >> 6;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else if (u <= 65535) {
|
|
if (outIdx + 2 >= endIdx) break;
|
|
outU8Array[outIdx++] = 224 | u >> 12;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else if (u <= 2097151) {
|
|
if (outIdx + 3 >= endIdx) break;
|
|
outU8Array[outIdx++] = 240 | u >> 18;
|
|
outU8Array[outIdx++] = 128 | u >> 12 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else if (u <= 67108863) {
|
|
if (outIdx + 4 >= endIdx) break;
|
|
outU8Array[outIdx++] = 248 | u >> 24;
|
|
outU8Array[outIdx++] = 128 | u >> 18 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 12 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
} else {
|
|
if (outIdx + 5 >= endIdx) break;
|
|
outU8Array[outIdx++] = 252 | u >> 30;
|
|
outU8Array[outIdx++] = 128 | u >> 24 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 18 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 12 & 63;
|
|
outU8Array[outIdx++] = 128 | u >> 6 & 63;
|
|
outU8Array[outIdx++] = 128 | u & 63
|
|
}
|
|
}
|
|
outU8Array[outIdx] = 0;
|
|
return outIdx - startIdx
|
|
}
|
|
Module["stringToUTF8Array"] = stringToUTF8Array;
|
|
|
|
function stringToUTF8(str, outPtr, maxBytesToWrite) {
|
|
return stringToUTF8Array(str, HEAPU8, outPtr, maxBytesToWrite)
|
|
}
|
|
Module["stringToUTF8"] = stringToUTF8;
|
|
|
|
function lengthBytesUTF8(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
var u = str.charCodeAt(i);
|
|
if (u >= 55296 && u <= 57343) u = 65536 + ((u & 1023) << 10) | str.charCodeAt(++i) & 1023;
|
|
if (u <= 127) {
|
|
++len
|
|
} else if (u <= 2047) {
|
|
len += 2
|
|
} else if (u <= 65535) {
|
|
len += 3
|
|
} else if (u <= 2097151) {
|
|
len += 4
|
|
} else if (u <= 67108863) {
|
|
len += 5
|
|
} else {
|
|
len += 6
|
|
}
|
|
}
|
|
return len
|
|
}
|
|
Module["lengthBytesUTF8"] = lengthBytesUTF8;
|
|
var UTF16Decoder = typeof TextDecoder !== "undefined" ? new TextDecoder("utf-16le") : undefined;
|
|
|
|
function demangle(func) {
|
|
var __cxa_demangle_func = Module["___cxa_demangle"] || Module["__cxa_demangle"];
|
|
if (__cxa_demangle_func) {
|
|
try {
|
|
var s = func.substr(1);
|
|
var len = lengthBytesUTF8(s) + 1;
|
|
var buf = _malloc(len);
|
|
stringToUTF8(s, buf, len);
|
|
var status = _malloc(4);
|
|
var ret = __cxa_demangle_func(buf, 0, 0, status);
|
|
if (getValue(status, "i32") === 0 && ret) {
|
|
return Pointer_stringify(ret)
|
|
}
|
|
} catch (e) {} finally {
|
|
if (buf) _free(buf);
|
|
if (status) _free(status);
|
|
if (ret) _free(ret)
|
|
}
|
|
return func
|
|
}
|
|
Runtime.warnOnce("warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling");
|
|
return func
|
|
}
|
|
|
|
function demangleAll(text) {
|
|
var regex = /__Z[\w\d_]+/g;
|
|
return text.replace(regex, (function(x) {
|
|
var y = demangle(x);
|
|
return x === y ? x : x + " [" + y + "]"
|
|
}))
|
|
}
|
|
|
|
function jsStackTrace() {
|
|
var err = new Error;
|
|
if (!err.stack) {
|
|
try {
|
|
throw new Error(0)
|
|
} catch (e) {
|
|
err = e
|
|
}
|
|
if (!err.stack) {
|
|
return "(no stack trace available)"
|
|
}
|
|
}
|
|
return err.stack.toString()
|
|
}
|
|
|
|
function stackTrace() {
|
|
var js = jsStackTrace();
|
|
if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"]();
|
|
return demangleAll(js)
|
|
}
|
|
Module["stackTrace"] = stackTrace;
|
|
var WASM_PAGE_SIZE = 65536;
|
|
var ASMJS_PAGE_SIZE = 16777216;
|
|
var MIN_TOTAL_MEMORY = 16777216;
|
|
|
|
function alignUp(x, multiple) {
|
|
if (x % multiple > 0) {
|
|
x += multiple - x % multiple
|
|
}
|
|
return x
|
|
}
|
|
var HEAP, buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
|
|
|
|
function updateGlobalBuffer(buf) {
|
|
Module["buffer"] = buffer = buf
|
|
}
|
|
|
|
function updateGlobalBufferViews() {
|
|
Module["HEAP8"] = HEAP8 = new Int8Array(buffer);
|
|
Module["HEAP16"] = HEAP16 = new Int16Array(buffer);
|
|
Module["HEAP32"] = HEAP32 = new Int32Array(buffer);
|
|
Module["HEAPU8"] = HEAPU8 = new Uint8Array(buffer);
|
|
Module["HEAPU16"] = HEAPU16 = new Uint16Array(buffer);
|
|
Module["HEAPU32"] = HEAPU32 = new Uint32Array(buffer);
|
|
Module["HEAPF32"] = HEAPF32 = new Float32Array(buffer);
|
|
Module["HEAPF64"] = HEAPF64 = new Float64Array(buffer)
|
|
}
|
|
var STATIC_BASE, STATICTOP, staticSealed;
|
|
var STACK_BASE, STACKTOP, STACK_MAX;
|
|
var DYNAMIC_BASE, DYNAMICTOP_PTR;
|
|
STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
|
|
staticSealed = false;
|
|
|
|
function abortOnCannotGrowMemory() {
|
|
abort("Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value " + TOTAL_MEMORY + ", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ")
|
|
}
|
|
if (!Module["reallocBuffer"]) Module["reallocBuffer"] = (function(size) {
|
|
var ret;
|
|
try {
|
|
if (ArrayBuffer.transfer) {
|
|
ret = ArrayBuffer.transfer(buffer, size)
|
|
} else {
|
|
var oldHEAP8 = HEAP8;
|
|
ret = new ArrayBuffer(size);
|
|
var temp = new Int8Array(ret);
|
|
temp.set(oldHEAP8)
|
|
}
|
|
} catch (e) {
|
|
return false
|
|
}
|
|
var success = _emscripten_replace_memory(ret);
|
|
if (!success) return false;
|
|
return ret
|
|
});
|
|
|
|
function enlargeMemory() {
|
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE;
|
|
var LIMIT = 2147483648 - PAGE_MULTIPLE;
|
|
if (HEAP32[DYNAMICTOP_PTR >> 2] > LIMIT) {
|
|
return false
|
|
}
|
|
var OLD_TOTAL_MEMORY = TOTAL_MEMORY;
|
|
TOTAL_MEMORY = Math.max(TOTAL_MEMORY, MIN_TOTAL_MEMORY);
|
|
while (TOTAL_MEMORY < HEAP32[DYNAMICTOP_PTR >> 2]) {
|
|
if (TOTAL_MEMORY <= 536870912) {
|
|
TOTAL_MEMORY = alignUp(2 * TOTAL_MEMORY, PAGE_MULTIPLE)
|
|
} else {
|
|
TOTAL_MEMORY = Math.min(alignUp((3 * TOTAL_MEMORY + 2147483648) / 4, PAGE_MULTIPLE), LIMIT)
|
|
}
|
|
}
|
|
var replacement = Module["reallocBuffer"](TOTAL_MEMORY);
|
|
if (!replacement || replacement.byteLength != TOTAL_MEMORY) {
|
|
TOTAL_MEMORY = OLD_TOTAL_MEMORY;
|
|
return false
|
|
}
|
|
updateGlobalBuffer(replacement);
|
|
updateGlobalBufferViews();
|
|
return true
|
|
}
|
|
var byteLength;
|
|
try {
|
|
byteLength = Function.prototype.call.bind(Object.getOwnPropertyDescriptor(ArrayBuffer.prototype, "byteLength").get);
|
|
byteLength(new ArrayBuffer(4))
|
|
} catch (e) {
|
|
byteLength = (function(buffer) {
|
|
return buffer.byteLength
|
|
})
|
|
}
|
|
var TOTAL_STACK = Module["TOTAL_STACK"] || 5242880;
|
|
var TOTAL_MEMORY = Module["TOTAL_MEMORY"] || 134217728;
|
|
if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr("TOTAL_MEMORY should be larger than TOTAL_STACK, was " + TOTAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")");
|
|
if (Module["buffer"]) {
|
|
buffer = Module["buffer"]
|
|
} else {
|
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Memory === "function") {
|
|
Module["wasmMemory"] = new WebAssembly.Memory({
|
|
"initial": TOTAL_MEMORY / WASM_PAGE_SIZE
|
|
});
|
|
buffer = Module["wasmMemory"].buffer
|
|
} else {
|
|
buffer = new ArrayBuffer(TOTAL_MEMORY)
|
|
}
|
|
}
|
|
updateGlobalBufferViews();
|
|
|
|
function getTotalMemory() {
|
|
return TOTAL_MEMORY
|
|
}
|
|
HEAP32[0] = 1668509029;
|
|
HEAP16[1] = 25459;
|
|
if (HEAPU8[2] !== 115 || HEAPU8[3] !== 99) throw "Runtime error: expected the system to be little-endian!";
|
|
Module["HEAP"] = HEAP;
|
|
Module["buffer"] = buffer;
|
|
Module["HEAP8"] = HEAP8;
|
|
Module["HEAP16"] = HEAP16;
|
|
Module["HEAP32"] = HEAP32;
|
|
Module["HEAPU8"] = HEAPU8;
|
|
Module["HEAPU16"] = HEAPU16;
|
|
Module["HEAPU32"] = HEAPU32;
|
|
Module["HEAPF32"] = HEAPF32;
|
|
Module["HEAPF64"] = HEAPF64;
|
|
|
|
function callRuntimeCallbacks(callbacks) {
|
|
while (callbacks.length > 0) {
|
|
var callback = callbacks.shift();
|
|
if (typeof callback == "function") {
|
|
callback();
|
|
continue
|
|
}
|
|
var func = callback.func;
|
|
if (typeof func === "number") {
|
|
if (callback.arg === undefined) {
|
|
Module["dynCall_v"](func)
|
|
} else {
|
|
Module["dynCall_vi"](func, callback.arg)
|
|
}
|
|
} else {
|
|
func(callback.arg === undefined ? null : callback.arg)
|
|
}
|
|
}
|
|
}
|
|
var __ATPRERUN__ = [];
|
|
var __ATINIT__ = [];
|
|
var __ATMAIN__ = [];
|
|
var __ATEXIT__ = [];
|
|
var __ATPOSTRUN__ = [];
|
|
var runtimeInitialized = false;
|
|
var runtimeExited = false;
|
|
|
|
function preRun() {
|
|
if (Module["preRun"]) {
|
|
if (typeof Module["preRun"] == "function") Module["preRun"] = [Module["preRun"]];
|
|
while (Module["preRun"].length) {
|
|
addOnPreRun(Module["preRun"].shift())
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPRERUN__)
|
|
}
|
|
|
|
function ensureInitRuntime() {
|
|
if (runtimeInitialized) return;
|
|
runtimeInitialized = true;
|
|
callRuntimeCallbacks(__ATINIT__)
|
|
}
|
|
|
|
function preMain() {
|
|
callRuntimeCallbacks(__ATMAIN__)
|
|
}
|
|
|
|
function exitRuntime() {
|
|
callRuntimeCallbacks(__ATEXIT__);
|
|
runtimeExited = true
|
|
}
|
|
|
|
function postRun() {
|
|
if (Module["postRun"]) {
|
|
if (typeof Module["postRun"] == "function") Module["postRun"] = [Module["postRun"]];
|
|
while (Module["postRun"].length) {
|
|
addOnPostRun(Module["postRun"].shift())
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPOSTRUN__)
|
|
}
|
|
|
|
function addOnPreRun(cb) {
|
|
__ATPRERUN__.unshift(cb)
|
|
}
|
|
Module["addOnPreRun"] = addOnPreRun;
|
|
|
|
function addOnInit(cb) {
|
|
__ATINIT__.unshift(cb)
|
|
}
|
|
Module["addOnInit"] = addOnInit;
|
|
|
|
function addOnPreMain(cb) {
|
|
__ATMAIN__.unshift(cb)
|
|
}
|
|
Module["addOnPreMain"] = addOnPreMain;
|
|
|
|
function addOnExit(cb) {
|
|
__ATEXIT__.unshift(cb)
|
|
}
|
|
Module["addOnExit"] = addOnExit;
|
|
|
|
function addOnPostRun(cb) {
|
|
__ATPOSTRUN__.unshift(cb)
|
|
}
|
|
Module["addOnPostRun"] = addOnPostRun;
|
|
|
|
function intArrayFromString(stringy, dontAddNull, length) {
|
|
var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1;
|
|
var u8array = new Array(len);
|
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
|
|
if (dontAddNull) u8array.length = numBytesWritten;
|
|
return u8array
|
|
}
|
|
Module["intArrayFromString"] = intArrayFromString;
|
|
|
|
function intArrayToString(array) {
|
|
var ret = [];
|
|
for (var i = 0; i < array.length; i++) {
|
|
var chr = array[i];
|
|
if (chr > 255) {
|
|
chr &= 255
|
|
}
|
|
ret.push(String.fromCharCode(chr))
|
|
}
|
|
return ret.join("")
|
|
}
|
|
Module["intArrayToString"] = intArrayToString;
|
|
|
|
function writeStringToMemory(string, buffer, dontAddNull) {
|
|
Runtime.warnOnce("writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!");
|
|
var lastChar, end;
|
|
if (dontAddNull) {
|
|
end = buffer + lengthBytesUTF8(string);
|
|
lastChar = HEAP8[end]
|
|
}
|
|
stringToUTF8(string, buffer, Infinity);
|
|
if (dontAddNull) HEAP8[end] = lastChar
|
|
}
|
|
Module["writeStringToMemory"] = writeStringToMemory;
|
|
|
|
function writeArrayToMemory(array, buffer) {
|
|
HEAP8.set(array, buffer)
|
|
}
|
|
Module["writeArrayToMemory"] = writeArrayToMemory;
|
|
|
|
function writeAsciiToMemory(str, buffer, dontAddNull) {
|
|
for (var i = 0; i < str.length; ++i) {
|
|
HEAP8[buffer++ >> 0] = str.charCodeAt(i)
|
|
}
|
|
if (!dontAddNull) HEAP8[buffer >> 0] = 0
|
|
}
|
|
Module["writeAsciiToMemory"] = writeAsciiToMemory;
|
|
if (!Math["imul"] || Math["imul"](4294967295, 5) !== -5) Math["imul"] = function imul(a, b) {
|
|
var ah = a >>> 16;
|
|
var al = a & 65535;
|
|
var bh = b >>> 16;
|
|
var bl = b & 65535;
|
|
return al * bl + (ah * bl + al * bh << 16) | 0
|
|
};
|
|
Math.imul = Math["imul"];
|
|
if (!Math["fround"]) {
|
|
var froundBuffer = new Float32Array(1);
|
|
Math["fround"] = (function(x) {
|
|
froundBuffer[0] = x;
|
|
return froundBuffer[0]
|
|
})
|
|
}
|
|
Math.fround = Math["fround"];
|
|
if (!Math["clz32"]) Math["clz32"] = (function(x) {
|
|
x = x >>> 0;
|
|
for (var i = 0; i < 32; i++) {
|
|
if (x & 1 << 31 - i) return i
|
|
}
|
|
return 32
|
|
});
|
|
Math.clz32 = Math["clz32"];
|
|
if (!Math["trunc"]) Math["trunc"] = (function(x) {
|
|
return x < 0 ? Math.ceil(x) : Math.floor(x)
|
|
});
|
|
Math.trunc = Math["trunc"];
|
|
var Math_abs = Math.abs;
|
|
var Math_cos = Math.cos;
|
|
var Math_sin = Math.sin;
|
|
var Math_tan = Math.tan;
|
|
var Math_acos = Math.acos;
|
|
var Math_asin = Math.asin;
|
|
var Math_atan = Math.atan;
|
|
var Math_atan2 = Math.atan2;
|
|
var Math_exp = Math.exp;
|
|
var Math_log = Math.log;
|
|
var Math_sqrt = Math.sqrt;
|
|
var Math_ceil = Math.ceil;
|
|
var Math_floor = Math.floor;
|
|
var Math_pow = Math.pow;
|
|
var Math_imul = Math.imul;
|
|
var Math_fround = Math.fround;
|
|
var Math_round = Math.round;
|
|
var Math_min = Math.min;
|
|
var Math_clz32 = Math.clz32;
|
|
var Math_trunc = Math.trunc;
|
|
var runDependencies = 0;
|
|
var runDependencyWatcher = null;
|
|
var dependenciesFulfilled = null;
|
|
|
|
function getUniqueRunDependency(id) {
|
|
return id
|
|
}
|
|
|
|
function addRunDependency(id) {
|
|
runDependencies++;
|
|
if (Module["monitorRunDependencies"]) {
|
|
Module["monitorRunDependencies"](runDependencies)
|
|
}
|
|
}
|
|
Module["addRunDependency"] = addRunDependency;
|
|
|
|
function removeRunDependency(id) {
|
|
runDependencies--;
|
|
if (Module["monitorRunDependencies"]) {
|
|
Module["monitorRunDependencies"](runDependencies)
|
|
}
|
|
if (runDependencies == 0) {
|
|
if (runDependencyWatcher !== null) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null
|
|
}
|
|
if (dependenciesFulfilled) {
|
|
var callback = dependenciesFulfilled;
|
|
dependenciesFulfilled = null;
|
|
callback()
|
|
}
|
|
}
|
|
}
|
|
Module["removeRunDependency"] = removeRunDependency;
|
|
Module["preloadedImages"] = {};
|
|
Module["preloadedAudios"] = {};
|
|
var memoryInitializer = null;
|
|
|
|
function integrateWasmJS(Module) {
|
|
var method = Module["wasmJSMethod"] || "native-wasm";
|
|
Module["wasmJSMethod"] = method;
|
|
var wasmTextFile = Module["wasmTextFile"] || "cv-wasm.wast";
|
|
var wasmBinaryFile = Module["wasmBinaryFile"] || "cv-wasm.wasm";
|
|
var asmjsCodeFile = Module["asmjsCodeFile"] || "cv-wasm.temp.asm.js";
|
|
if (typeof Module["locateFile"] === "function") {
|
|
wasmTextFile = Module["locateFile"](wasmTextFile);
|
|
wasmBinaryFile = Module["locateFile"](wasmBinaryFile);
|
|
asmjsCodeFile = Module["locateFile"](asmjsCodeFile)
|
|
}
|
|
var wasmPageSize = 64 * 1024;
|
|
var asm2wasmImports = {
|
|
"f64-rem": (function(x, y) {
|
|
return x % y
|
|
}),
|
|
"f64-to-int": (function(x) {
|
|
return x | 0
|
|
}),
|
|
"i32s-div": (function(x, y) {
|
|
return (x | 0) / (y | 0) | 0
|
|
}),
|
|
"i32u-div": (function(x, y) {
|
|
return (x >>> 0) / (y >>> 0) >>> 0
|
|
}),
|
|
"i32s-rem": (function(x, y) {
|
|
return (x | 0) % (y | 0) | 0
|
|
}),
|
|
"i32u-rem": (function(x, y) {
|
|
return (x >>> 0) % (y >>> 0) >>> 0
|
|
}),
|
|
"debugger": (function() {
|
|
debugger
|
|
})
|
|
};
|
|
var info = {
|
|
"global": null,
|
|
"env": null,
|
|
"asm2wasm": asm2wasmImports,
|
|
"parent": Module
|
|
};
|
|
var exports = null;
|
|
|
|
function lookupImport(mod, base) {
|
|
var lookup = info;
|
|
if (mod.indexOf(".") < 0) {
|
|
lookup = (lookup || {})[mod]
|
|
} else {
|
|
var parts = mod.split(".");
|
|
lookup = (lookup || {})[parts[0]];
|
|
lookup = (lookup || {})[parts[1]]
|
|
}
|
|
if (base) {
|
|
lookup = (lookup || {})[base]
|
|
}
|
|
if (lookup === undefined) {
|
|
abort("bad lookupImport to (" + mod + ")." + base)
|
|
}
|
|
return lookup
|
|
}
|
|
|
|
function mergeMemory(newBuffer) {
|
|
var oldBuffer = Module["buffer"];
|
|
if (newBuffer.byteLength < oldBuffer.byteLength) {
|
|
Module["printErr"]("the new buffer in mergeMemory is smaller than the previous one. in native wasm, we should grow memory here")
|
|
}
|
|
var oldView = new Int8Array(oldBuffer);
|
|
var newView = new Int8Array(newBuffer);
|
|
if (!memoryInitializer) {
|
|
oldView.set(newView.subarray(Module["STATIC_BASE"], Module["STATIC_BASE"] + Module["STATIC_BUMP"]), Module["STATIC_BASE"])
|
|
}
|
|
newView.set(oldView);
|
|
updateGlobalBuffer(newBuffer);
|
|
updateGlobalBufferViews()
|
|
}
|
|
var WasmTypes = {
|
|
none: 0,
|
|
i32: 1,
|
|
i64: 2,
|
|
f32: 3,
|
|
f64: 4
|
|
};
|
|
|
|
function fixImports(imports) {
|
|
if (!0) return imports;
|
|
var ret = {};
|
|
for (var i in imports) {
|
|
var fixed = i;
|
|
if (fixed[0] == "_") fixed = fixed.substr(1);
|
|
ret[fixed] = imports[i]
|
|
}
|
|
return ret
|
|
}
|
|
|
|
function getBinary() {
|
|
var binary;
|
|
if (Module["wasmBinary"]) {
|
|
binary = Module["wasmBinary"];
|
|
binary = new Uint8Array(binary)
|
|
} else if (Module["readBinary"]) {
|
|
binary = Module["readBinary"](wasmBinaryFile)
|
|
} else {
|
|
throw "on the web, we need the wasm binary to be preloaded and set on Module['wasmBinary']. emcc.py will do that for you when generating HTML (but not JS)"
|
|
}
|
|
return binary
|
|
}
|
|
|
|
function getBinaryPromise() {
|
|
if (!Module["wasmBinary"] && typeof fetch === "function") {
|
|
return fetch(wasmBinaryFile, {
|
|
credentials: "same-origin"
|
|
}).then((function(response) {
|
|
if (!response["ok"]) {
|
|
throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"
|
|
}
|
|
return response["arrayBuffer"]()
|
|
}))
|
|
}
|
|
return new Promise((function(resolve, reject) {
|
|
resolve(getBinary())
|
|
}))
|
|
}
|
|
|
|
function doJustAsm(global, env, providedBuffer) {
|
|
if (typeof Module["asm"] !== "function" || Module["asm"] === methodHandler) {
|
|
if (!Module["asmPreload"]) {
|
|
eval(Module["read"](asmjsCodeFile))
|
|
} else {
|
|
Module["asm"] = Module["asmPreload"]
|
|
}
|
|
}
|
|
if (typeof Module["asm"] !== "function") {
|
|
Module["printErr"]("asm evalling did not set the module properly");
|
|
return false
|
|
}
|
|
return Module["asm"](global, env, providedBuffer)
|
|
}
|
|
|
|
function doNativeWasm(global, env, providedBuffer) {
|
|
if (typeof WebAssembly !== "object") {
|
|
Module["printErr"]("no native wasm support detected");
|
|
return false
|
|
}
|
|
if (!(Module["wasmMemory"] instanceof WebAssembly.Memory)) {
|
|
Module["printErr"]("no native wasm Memory in use");
|
|
return false
|
|
}
|
|
env["memory"] = Module["wasmMemory"];
|
|
info["global"] = {
|
|
"NaN": NaN,
|
|
"Infinity": Infinity
|
|
};
|
|
info["global.Math"] = global.Math;
|
|
info["env"] = env;
|
|
|
|
function receiveInstance(instance) {
|
|
exports = instance.exports;
|
|
if (exports.memory) mergeMemory(exports.memory);
|
|
Module["asm"] = exports;
|
|
Module["usingWasm"] = true;
|
|
removeRunDependency("wasm-instantiate")
|
|
}
|
|
addRunDependency("wasm-instantiate");
|
|
if (Module["instantiateWasm"]) {
|
|
try {
|
|
return Module["instantiateWasm"](info, receiveInstance)
|
|
} catch (e) {
|
|
Module["printErr"]("Module.instantiateWasm callback failed with error: " + e);
|
|
return false
|
|
}
|
|
}
|
|
getBinaryPromise().then((function(binary) {
|
|
return WebAssembly.instantiate(binary, info)
|
|
})).then((function(output) {
|
|
receiveInstance(output["instance"])
|
|
})).catch((function(reason) {
|
|
Module["printErr"]("failed to asynchronously prepare wasm: " + reason);
|
|
Module["quit"](1, reason)
|
|
}));
|
|
return {}
|
|
}
|
|
|
|
function doWasmPolyfill(global, env, providedBuffer, method) {
|
|
if (typeof WasmJS !== "function") {
|
|
Module["printErr"]("WasmJS not detected - polyfill not bundled?");
|
|
return false
|
|
}
|
|
var wasmJS = WasmJS({});
|
|
wasmJS["outside"] = Module;
|
|
wasmJS["info"] = info;
|
|
wasmJS["lookupImport"] = lookupImport;
|
|
assert(providedBuffer === Module["buffer"]);
|
|
info.global = global;
|
|
info.env = env;
|
|
assert(providedBuffer === Module["buffer"]);
|
|
env["memory"] = providedBuffer;
|
|
assert(env["memory"] instanceof ArrayBuffer);
|
|
wasmJS["providedTotalMemory"] = Module["buffer"].byteLength;
|
|
var code;
|
|
if (method === "interpret-binary") {
|
|
code = getBinary()
|
|
} else {
|
|
code = Module["read"](method == "interpret-asm2wasm" ? asmjsCodeFile : wasmTextFile)
|
|
}
|
|
var temp;
|
|
if (method == "interpret-asm2wasm") {
|
|
temp = wasmJS["_malloc"](code.length + 1);
|
|
wasmJS["writeAsciiToMemory"](code, temp);
|
|
wasmJS["_load_asm2wasm"](temp)
|
|
} else if (method === "interpret-s-expr") {
|
|
temp = wasmJS["_malloc"](code.length + 1);
|
|
wasmJS["writeAsciiToMemory"](code, temp);
|
|
wasmJS["_load_s_expr2wasm"](temp)
|
|
} else if (method === "interpret-binary") {
|
|
temp = wasmJS["_malloc"](code.length);
|
|
wasmJS["HEAPU8"].set(code, temp);
|
|
wasmJS["_load_binary2wasm"](temp, code.length)
|
|
} else {
|
|
throw "what? " + method
|
|
}
|
|
wasmJS["_free"](temp);
|
|
wasmJS["_instantiate"](temp);
|
|
if (Module["newBuffer"]) {
|
|
mergeMemory(Module["newBuffer"]);
|
|
Module["newBuffer"] = null
|
|
}
|
|
exports = wasmJS["asmExports"];
|
|
return exports
|
|
}
|
|
Module["asmPreload"] = Module["asm"];
|
|
var asmjsReallocBuffer = Module["reallocBuffer"];
|
|
var wasmReallocBuffer = (function(size) {
|
|
var PAGE_MULTIPLE = Module["usingWasm"] ? WASM_PAGE_SIZE : ASMJS_PAGE_SIZE;
|
|
size = alignUp(size, PAGE_MULTIPLE);
|
|
var old = Module["buffer"];
|
|
var oldSize = old.byteLength;
|
|
if (Module["usingWasm"]) {
|
|
try {
|
|
var result = Module["wasmMemory"].grow((size - oldSize) / wasmPageSize);
|
|
if (result !== (-1 | 0)) {
|
|
return Module["buffer"] = Module["wasmMemory"].buffer
|
|
} else {
|
|
return null
|
|
}
|
|
} catch (e) {
|
|
return null
|
|
}
|
|
} else {
|
|
exports["__growWasmMemory"]((size - oldSize) / wasmPageSize);
|
|
return Module["buffer"] !== old ? Module["buffer"] : null
|
|
}
|
|
});
|
|
Module["reallocBuffer"] = (function(size) {
|
|
if (finalMethod === "asmjs") {
|
|
return asmjsReallocBuffer(size)
|
|
} else {
|
|
return wasmReallocBuffer(size)
|
|
}
|
|
});
|
|
var finalMethod = "";
|
|
Module["asm"] = (function(global, env, providedBuffer) {
|
|
global = fixImports(global);
|
|
env = fixImports(env);
|
|
if (!env["table"]) {
|
|
var TABLE_SIZE = Module["wasmTableSize"];
|
|
if (TABLE_SIZE === undefined) TABLE_SIZE = 1024;
|
|
var MAX_TABLE_SIZE = Module["wasmMaxTableSize"];
|
|
if (typeof WebAssembly === "object" && typeof WebAssembly.Table === "function") {
|
|
if (MAX_TABLE_SIZE !== undefined) {
|
|
env["table"] = new WebAssembly.Table({
|
|
"initial": TABLE_SIZE,
|
|
"maximum": MAX_TABLE_SIZE,
|
|
"element": "anyfunc"
|
|
})
|
|
} else {
|
|
env["table"] = new WebAssembly.Table({
|
|
"initial": TABLE_SIZE,
|
|
element: "anyfunc"
|
|
})
|
|
}
|
|
} else {
|
|
env["table"] = new Array(TABLE_SIZE)
|
|
}
|
|
Module["wasmTable"] = env["table"]
|
|
}
|
|
if (!env["memoryBase"]) {
|
|
env["memoryBase"] = Module["STATIC_BASE"]
|
|
}
|
|
if (!env["tableBase"]) {
|
|
env["tableBase"] = 0
|
|
}
|
|
var exports;
|
|
var methods = method.split(",");
|
|
for (var i = 0; i < methods.length; i++) {
|
|
var curr = methods[i];
|
|
finalMethod = curr;
|
|
if (curr === "native-wasm") {
|
|
if (exports = doNativeWasm(global, env, providedBuffer)) break
|
|
} else if (curr === "asmjs") {
|
|
if (exports = doJustAsm(global, env, providedBuffer)) break
|
|
} else if (curr === "interpret-asm2wasm" || curr === "interpret-s-expr" || curr === "interpret-binary") {
|
|
if (exports = doWasmPolyfill(global, env, providedBuffer, curr)) break
|
|
} else {
|
|
throw "bad method: " + curr
|
|
}
|
|
}
|
|
if (!exports) throw "no binaryen method succeeded. consider enabling more options, like interpreting, if you want that: https://github.com/kripken/emscripten/wiki/WebAssembly#binaryen-methods";
|
|
return exports
|
|
});
|
|
var methodHandler = Module["asm"]
|
|
}
|
|
integrateWasmJS(Module);
|
|
var ASM_CONSTS = [];
|
|
STATIC_BASE = Runtime.GLOBAL_BASE;
|
|
STATICTOP = STATIC_BASE + 1009888;
|
|
__ATINIT__.push({
|
|
func: (function() {
|
|
__GLOBAL__I_000101()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_persistence_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_iostream_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_bind_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_haar_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_hog_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_38()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_37()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_36()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_knearest_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_loadsave_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_imgwarp_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_histogram_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1428()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_umatrix_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_system_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
__GLOBAL__sub_I_bindings_cpp()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1436()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1435()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1434()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1433()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1432()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1431()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1430()
|
|
})
|
|
}, {
|
|
func: (function() {
|
|
___cxx_global_var_init_1429()
|
|
})
|
|
});
|
|
memoryInitializer = Module["wasmJSMethod"].indexOf("asmjs") >= 0 || Module["wasmJSMethod"].indexOf("interpret-asm2wasm") >= 0 ? "cv-wasm.js.mem" : null;
|
|
var STATIC_BUMP = 1009888;
|
|
Module["STATIC_BASE"] = STATIC_BASE;
|
|
Module["STATIC_BUMP"] = STATIC_BUMP;
|
|
var tempDoublePtr = STATICTOP;
|
|
STATICTOP += 16;
|
|
|
|
function _atexit(func, arg) {
|
|
__ATEXIT__.unshift({
|
|
func: func,
|
|
arg: arg
|
|
})
|
|
}
|
|
|
|
function ___cxa_atexit() {
|
|
return _atexit.apply(null, arguments)
|
|
}
|
|
var emval_symbols = {};
|
|
|
|
function embind_init_charCodes() {
|
|
var codes = new Array(256);
|
|
for (var i = 0; i < 256; ++i) {
|
|
codes[i] = String.fromCharCode(i)
|
|
}
|
|
embind_charCodes = codes
|
|
}
|
|
var embind_charCodes = undefined;
|
|
|
|
function readLatin1String(ptr) {
|
|
var ret = "";
|
|
var c = ptr;
|
|
while (HEAPU8[c]) {
|
|
ret += embind_charCodes[HEAPU8[c++]]
|
|
}
|
|
return ret
|
|
}
|
|
|
|
function getStringOrSymbol(address) {
|
|
var symbol = emval_symbols[address];
|
|
if (symbol === undefined) {
|
|
return readLatin1String(address)
|
|
} else {
|
|
return symbol
|
|
}
|
|
}
|
|
var emval_free_list = [];
|
|
var emval_handle_array = [{}, {
|
|
value: undefined
|
|
}, {
|
|
value: null
|
|
}, {
|
|
value: true
|
|
}, {
|
|
value: false
|
|
}];
|
|
|
|
function count_emval_handles() {
|
|
var count = 0;
|
|
for (var i = 5; i < emval_handle_array.length; ++i) {
|
|
if (emval_handle_array[i] !== undefined) {
|
|
++count
|
|
}
|
|
}
|
|
return count
|
|
}
|
|
|
|
function get_first_emval() {
|
|
for (var i = 5; i < emval_handle_array.length; ++i) {
|
|
if (emval_handle_array[i] !== undefined) {
|
|
return emval_handle_array[i]
|
|
}
|
|
}
|
|
return null
|
|
}
|
|
|
|
function init_emval() {
|
|
Module["count_emval_handles"] = count_emval_handles;
|
|
Module["get_first_emval"] = get_first_emval
|
|
}
|
|
|
|
function __emval_register(value) {
|
|
switch (value) {
|
|
case undefined:
|
|
{
|
|
return 1
|
|
};
|
|
case null:
|
|
{
|
|
return 2
|
|
};
|
|
case true:
|
|
{
|
|
return 3
|
|
};
|
|
case false:
|
|
{
|
|
return 4
|
|
};
|
|
default:
|
|
{
|
|
var handle = emval_free_list.length ? emval_free_list.pop() : emval_handle_array.length;
|
|
emval_handle_array[handle] = {
|
|
refcount: 1,
|
|
value: value
|
|
};
|
|
return handle
|
|
}
|
|
}
|
|
}
|
|
|
|
function __emval_new_cstring(v) {
|
|
return __emval_register(getStringOrSymbol(v))
|
|
}
|
|
|
|
function __ZSt18uncaught_exceptionv() {
|
|
return !!__ZSt18uncaught_exceptionv.uncaught_exception
|
|
}
|
|
var EXCEPTIONS = {
|
|
last: 0,
|
|
caught: [],
|
|
infos: {},
|
|
deAdjust: (function(adjusted) {
|
|
if (!adjusted || EXCEPTIONS.infos[adjusted]) return adjusted;
|
|
for (var ptr in EXCEPTIONS.infos) {
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
if (info.adjusted === adjusted) {
|
|
return ptr
|
|
}
|
|
}
|
|
return adjusted
|
|
}),
|
|
addRef: (function(ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
info.refcount++
|
|
}),
|
|
decRef: (function(ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
assert(info.refcount > 0);
|
|
info.refcount--;
|
|
if (info.refcount === 0 && !info.rethrown) {
|
|
if (info.destructor) {
|
|
Module["dynCall_vi"](info.destructor, ptr)
|
|
}
|
|
delete EXCEPTIONS.infos[ptr];
|
|
___cxa_free_exception(ptr)
|
|
}
|
|
}),
|
|
clearRef: (function(ptr) {
|
|
if (!ptr) return;
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
info.refcount = 0
|
|
})
|
|
};
|
|
|
|
function ___resumeException(ptr) {
|
|
if (!EXCEPTIONS.last) {
|
|
EXCEPTIONS.last = ptr
|
|
}
|
|
throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -s DISABLE_EXCEPTION_CATCHING=0 or DISABLE_EXCEPTION_CATCHING=2 to catch."
|
|
}
|
|
|
|
function ___cxa_find_matching_catch() {
|
|
var thrown = EXCEPTIONS.last;
|
|
if (!thrown) {
|
|
return (Runtime.setTempRet0(0), 0) | 0
|
|
}
|
|
var info = EXCEPTIONS.infos[thrown];
|
|
var throwntype = info.type;
|
|
if (!throwntype) {
|
|
return (Runtime.setTempRet0(0), thrown) | 0
|
|
}
|
|
var typeArray = Array.prototype.slice.call(arguments);
|
|
var pointer = Module["___cxa_is_pointer_type"](throwntype);
|
|
if (!___cxa_find_matching_catch.buffer) ___cxa_find_matching_catch.buffer = _malloc(4);
|
|
HEAP32[___cxa_find_matching_catch.buffer >> 2] = thrown;
|
|
thrown = ___cxa_find_matching_catch.buffer;
|
|
for (var i = 0; i < typeArray.length; i++) {
|
|
if (typeArray[i] && Module["___cxa_can_catch"](typeArray[i], throwntype, thrown)) {
|
|
thrown = HEAP32[thrown >> 2];
|
|
info.adjusted = thrown;
|
|
return (Runtime.setTempRet0(typeArray[i]), thrown) | 0
|
|
}
|
|
}
|
|
thrown = HEAP32[thrown >> 2];
|
|
return (Runtime.setTempRet0(throwntype), thrown) | 0
|
|
}
|
|
|
|
function ___cxa_throw(ptr, type, destructor) {
|
|
EXCEPTIONS.infos[ptr] = {
|
|
ptr: ptr,
|
|
adjusted: ptr,
|
|
type: type,
|
|
destructor: destructor,
|
|
refcount: 0,
|
|
caught: false,
|
|
rethrown: false
|
|
};
|
|
EXCEPTIONS.last = ptr;
|
|
if (!("uncaught_exception" in __ZSt18uncaught_exceptionv)) {
|
|
__ZSt18uncaught_exceptionv.uncaught_exception = 1
|
|
} else {
|
|
__ZSt18uncaught_exceptionv.uncaught_exception++
|
|
}
|
|
throw ptr + " - Exception catching is disabled, this exception cannot be caught. Compile with -s DISABLE_EXCEPTION_CATCHING=0 or DISABLE_EXCEPTION_CATCHING=2 to catch."
|
|
}
|
|
Module["_pthread_mutex_unlock"] = _pthread_mutex_unlock;
|
|
Module["_pthread_mutex_lock"] = _pthread_mutex_lock;
|
|
|
|
function _free() {}
|
|
Module["_free"] = _free;
|
|
|
|
function _malloc(bytes) {
|
|
var ptr = Runtime.dynamicAlloc(bytes + 8);
|
|
return ptr + 8 & 4294967288
|
|
}
|
|
Module["_malloc"] = _malloc;
|
|
var awaitingDependencies = {};
|
|
var registeredTypes = {};
|
|
var typeDependencies = {};
|
|
var char_0 = 48;
|
|
var char_9 = 57;
|
|
|
|
function makeLegalFunctionName(name) {
|
|
if (undefined === name) {
|
|
return "_unknown"
|
|
}
|
|
name = name.replace(/[^a-zA-Z0-9_]/g, "$");
|
|
var f = name.charCodeAt(0);
|
|
if (f >= char_0 && f <= char_9) {
|
|
return "_" + name
|
|
} else {
|
|
return name
|
|
}
|
|
}
|
|
|
|
function createNamedFunction(name, body) {
|
|
name = makeLegalFunctionName(name);
|
|
return (new Function("body", "return function " + name + "() {\n" + ' "use strict";' + " return body.apply(this, arguments);\n" + "};\n"))(body)
|
|
}
|
|
|
|
function extendError(baseErrorType, errorName) {
|
|
var errorClass = createNamedFunction(errorName, (function(message) {
|
|
this.name = errorName;
|
|
this.message = message;
|
|
var stack = (new Error(message)).stack;
|
|
if (stack !== undefined) {
|
|
this.stack = this.toString() + "\n" + stack.replace(/^Error(:[^\n]*)?\n/, "")
|
|
}
|
|
}));
|
|
errorClass.prototype = Object.create(baseErrorType.prototype);
|
|
errorClass.prototype.constructor = errorClass;
|
|
errorClass.prototype.toString = (function() {
|
|
if (this.message === undefined) {
|
|
return this.name
|
|
} else {
|
|
return this.name + ": " + this.message
|
|
}
|
|
});
|
|
return errorClass
|
|
}
|
|
var BindingError = undefined;
|
|
|
|
function throwBindingError(message) {
|
|
throw new BindingError(message)
|
|
}
|
|
var InternalError = undefined;
|
|
|
|
function throwInternalError(message) {
|
|
throw new InternalError(message)
|
|
}
|
|
|
|
function whenDependentTypesAreResolved(myTypes, dependentTypes, getTypeConverters) {
|
|
myTypes.forEach((function(type) {
|
|
typeDependencies[type] = dependentTypes
|
|
}));
|
|
|
|
function onComplete(typeConverters) {
|
|
var myTypeConverters = getTypeConverters(typeConverters);
|
|
if (myTypeConverters.length !== myTypes.length) {
|
|
throwInternalError("Mismatched type converter count")
|
|
}
|
|
for (var i = 0; i < myTypes.length; ++i) {
|
|
registerType(myTypes[i], myTypeConverters[i])
|
|
}
|
|
}
|
|
var typeConverters = new Array(dependentTypes.length);
|
|
var unregisteredTypes = [];
|
|
var registered = 0;
|
|
dependentTypes.forEach((function(dt, i) {
|
|
if (registeredTypes.hasOwnProperty(dt)) {
|
|
typeConverters[i] = registeredTypes[dt]
|
|
} else {
|
|
unregisteredTypes.push(dt);
|
|
if (!awaitingDependencies.hasOwnProperty(dt)) {
|
|
awaitingDependencies[dt] = []
|
|
}
|
|
awaitingDependencies[dt].push((function() {
|
|
typeConverters[i] = registeredTypes[dt];
|
|
++registered;
|
|
if (registered === unregisteredTypes.length) {
|
|
onComplete(typeConverters)
|
|
}
|
|
}))
|
|
}
|
|
}));
|
|
if (0 === unregisteredTypes.length) {
|
|
onComplete(typeConverters)
|
|
}
|
|
}
|
|
|
|
function registerType(rawType, registeredInstance, options) {
|
|
options = options || {};
|
|
if (!("argPackAdvance" in registeredInstance)) {
|
|
throw new TypeError("registerType registeredInstance requires argPackAdvance")
|
|
}
|
|
var name = registeredInstance.name;
|
|
if (!rawType) {
|
|
throwBindingError('type "' + name + '" must have a positive integer typeid pointer')
|
|
}
|
|
if (registeredTypes.hasOwnProperty(rawType)) {
|
|
if (options.ignoreDuplicateRegistrations) {
|
|
return
|
|
} else {
|
|
throwBindingError("Cannot register type '" + name + "' twice")
|
|
}
|
|
}
|
|
registeredTypes[rawType] = registeredInstance;
|
|
delete typeDependencies[rawType];
|
|
if (awaitingDependencies.hasOwnProperty(rawType)) {
|
|
var callbacks = awaitingDependencies[rawType];
|
|
delete awaitingDependencies[rawType];
|
|
callbacks.forEach((function(cb) {
|
|
cb()
|
|
}))
|
|
}
|
|
}
|
|
|
|
function simpleReadValueFromPointer(pointer) {
|
|
return this["fromWireType"](HEAPU32[pointer >> 2])
|
|
}
|
|
|
|
function __embind_register_std_string(rawType, name) {
|
|
name = readLatin1String(name);
|
|
registerType(rawType, {
|
|
name: name,
|
|
"fromWireType": (function(value) {
|
|
var length = HEAPU32[value >> 2];
|
|
var a = new Array(length);
|
|
for (var i = 0; i < length; ++i) {
|
|
a[i] = String.fromCharCode(HEAPU8[value + 4 + i])
|
|
}
|
|
_free(value);
|
|
return a.join("")
|
|
}),
|
|
"toWireType": (function(destructors, value) {
|
|
if (value instanceof ArrayBuffer) {
|
|
value = new Uint8Array(value)
|
|
}
|
|
|
|
function getTAElement(ta, index) {
|
|
return ta[index]
|
|
}
|
|
|
|
function getStringElement(string, index) {
|
|
return string.charCodeAt(index)
|
|
}
|
|
var getElement;
|
|
if (value instanceof Uint8Array) {
|
|
getElement = getTAElement
|
|
} else if (value instanceof Uint8ClampedArray) {
|
|
getElement = getTAElement
|
|
} else if (value instanceof Int8Array) {
|
|
getElement = getTAElement
|
|
} else if (typeof value === "string") {
|
|
getElement = getStringElement
|
|
} else {
|
|
throwBindingError("Cannot pass non-string to std::string")
|
|
}
|
|
var length = value.length;
|
|
var ptr = _malloc(4 + length);
|
|
HEAPU32[ptr >> 2] = length;
|
|
for (var i = 0; i < length; ++i) {
|
|
var charCode = getElement(value, i);
|
|
if (charCode > 255) {
|
|
_free(ptr);
|
|
throwBindingError("String has UTF-16 code units that do not fit in 8 bits")
|
|
}
|
|
HEAPU8[ptr + 4 + i] = charCode
|
|
}
|
|
if (destructors !== null) {
|
|
destructors.push(_free, ptr)
|
|
}
|
|
return ptr
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": simpleReadValueFromPointer,
|
|
destructorFunction: (function(ptr) {
|
|
_free(ptr)
|
|
})
|
|
})
|
|
}
|
|
|
|
function __embind_register_std_wstring(rawType, charSize, name) {
|
|
name = readLatin1String(name);
|
|
var getHeap, shift;
|
|
if (charSize === 2) {
|
|
getHeap = (function() {
|
|
return HEAPU16
|
|
});
|
|
shift = 1
|
|
} else if (charSize === 4) {
|
|
getHeap = (function() {
|
|
return HEAPU32
|
|
});
|
|
shift = 2
|
|
}
|
|
registerType(rawType, {
|
|
name: name,
|
|
"fromWireType": (function(value) {
|
|
var HEAP = getHeap();
|
|
var length = HEAPU32[value >> 2];
|
|
var a = new Array(length);
|
|
var start = value + 4 >> shift;
|
|
for (var i = 0; i < length; ++i) {
|
|
a[i] = String.fromCharCode(HEAP[start + i])
|
|
}
|
|
_free(value);
|
|
return a.join("")
|
|
}),
|
|
"toWireType": (function(destructors, value) {
|
|
var HEAP = getHeap();
|
|
var length = value.length;
|
|
var ptr = _malloc(4 + length * charSize);
|
|
HEAPU32[ptr >> 2] = length;
|
|
var start = ptr + 4 >> shift;
|
|
for (var i = 0; i < length; ++i) {
|
|
HEAP[start + i] = value.charCodeAt(i)
|
|
}
|
|
if (destructors !== null) {
|
|
destructors.push(_free, ptr)
|
|
}
|
|
return ptr
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": simpleReadValueFromPointer,
|
|
destructorFunction: (function(ptr) {
|
|
_free(ptr)
|
|
})
|
|
})
|
|
}
|
|
|
|
function _pthread_mutex_init() {}
|
|
|
|
function __emval_decref(handle) {
|
|
if (handle > 4 && 0 === --emval_handle_array[handle].refcount) {
|
|
emval_handle_array[handle] = undefined;
|
|
emval_free_list.push(handle)
|
|
}
|
|
}
|
|
var structRegistrations = {};
|
|
|
|
function runDestructors(destructors) {
|
|
while (destructors.length) {
|
|
var ptr = destructors.pop();
|
|
var del = destructors.pop();
|
|
del(ptr)
|
|
}
|
|
}
|
|
|
|
function __embind_finalize_value_object(structType) {
|
|
var reg = structRegistrations[structType];
|
|
delete structRegistrations[structType];
|
|
var rawConstructor = reg.rawConstructor;
|
|
var rawDestructor = reg.rawDestructor;
|
|
var fieldRecords = reg.fields;
|
|
var fieldTypes = fieldRecords.map((function(field) {
|
|
return field.getterReturnType
|
|
})).concat(fieldRecords.map((function(field) {
|
|
return field.setterArgumentType
|
|
})));
|
|
whenDependentTypesAreResolved([structType], fieldTypes, (function(fieldTypes) {
|
|
var fields = {};
|
|
fieldRecords.forEach((function(field, i) {
|
|
var fieldName = field.fieldName;
|
|
var getterReturnType = fieldTypes[i];
|
|
var getter = field.getter;
|
|
var getterContext = field.getterContext;
|
|
var setterArgumentType = fieldTypes[i + fieldRecords.length];
|
|
var setter = field.setter;
|
|
var setterContext = field.setterContext;
|
|
fields[fieldName] = {
|
|
read: (function(ptr) {
|
|
return getterReturnType["fromWireType"](getter(getterContext, ptr))
|
|
}),
|
|
write: (function(ptr, o) {
|
|
var destructors = [];
|
|
setter(setterContext, ptr, setterArgumentType["toWireType"](destructors, o));
|
|
runDestructors(destructors)
|
|
})
|
|
}
|
|
}));
|
|
return [{
|
|
name: reg.name,
|
|
"fromWireType": (function(ptr) {
|
|
var rv = {};
|
|
for (var i in fields) {
|
|
rv[i] = fields[i].read(ptr)
|
|
}
|
|
rawDestructor(ptr);
|
|
return rv
|
|
}),
|
|
"toWireType": (function(destructors, o) {
|
|
for (var fieldName in fields) {
|
|
if (!(fieldName in o)) {
|
|
throw new TypeError("Missing field")
|
|
}
|
|
}
|
|
var ptr = rawConstructor();
|
|
for (fieldName in fields) {
|
|
fields[fieldName].write(ptr, o[fieldName])
|
|
}
|
|
if (destructors !== null) {
|
|
destructors.push(rawDestructor, ptr)
|
|
}
|
|
return ptr
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": simpleReadValueFromPointer,
|
|
destructorFunction: rawDestructor
|
|
}]
|
|
}))
|
|
}
|
|
var PTHREAD_SPECIFIC = {};
|
|
var PTHREAD_SPECIFIC_NEXT_KEY = 1;
|
|
var ERRNO_CODES = {
|
|
EPERM: 1,
|
|
ENOENT: 2,
|
|
ESRCH: 3,
|
|
EINTR: 4,
|
|
EIO: 5,
|
|
ENXIO: 6,
|
|
E2BIG: 7,
|
|
ENOEXEC: 8,
|
|
EBADF: 9,
|
|
ECHILD: 10,
|
|
EAGAIN: 11,
|
|
EWOULDBLOCK: 11,
|
|
ENOMEM: 12,
|
|
EACCES: 13,
|
|
EFAULT: 14,
|
|
ENOTBLK: 15,
|
|
EBUSY: 16,
|
|
EEXIST: 17,
|
|
EXDEV: 18,
|
|
ENODEV: 19,
|
|
ENOTDIR: 20,
|
|
EISDIR: 21,
|
|
EINVAL: 22,
|
|
ENFILE: 23,
|
|
EMFILE: 24,
|
|
ENOTTY: 25,
|
|
ETXTBSY: 26,
|
|
EFBIG: 27,
|
|
ENOSPC: 28,
|
|
ESPIPE: 29,
|
|
EROFS: 30,
|
|
EMLINK: 31,
|
|
EPIPE: 32,
|
|
EDOM: 33,
|
|
ERANGE: 34,
|
|
ENOMSG: 42,
|
|
EIDRM: 43,
|
|
ECHRNG: 44,
|
|
EL2NSYNC: 45,
|
|
EL3HLT: 46,
|
|
EL3RST: 47,
|
|
ELNRNG: 48,
|
|
EUNATCH: 49,
|
|
ENOCSI: 50,
|
|
EL2HLT: 51,
|
|
EDEADLK: 35,
|
|
ENOLCK: 37,
|
|
EBADE: 52,
|
|
EBADR: 53,
|
|
EXFULL: 54,
|
|
ENOANO: 55,
|
|
EBADRQC: 56,
|
|
EBADSLT: 57,
|
|
EDEADLOCK: 35,
|
|
EBFONT: 59,
|
|
ENOSTR: 60,
|
|
ENODATA: 61,
|
|
ETIME: 62,
|
|
ENOSR: 63,
|
|
ENONET: 64,
|
|
ENOPKG: 65,
|
|
EREMOTE: 66,
|
|
ENOLINK: 67,
|
|
EADV: 68,
|
|
ESRMNT: 69,
|
|
ECOMM: 70,
|
|
EPROTO: 71,
|
|
EMULTIHOP: 72,
|
|
EDOTDOT: 73,
|
|
EBADMSG: 74,
|
|
ENOTUNIQ: 76,
|
|
EBADFD: 77,
|
|
EREMCHG: 78,
|
|
ELIBACC: 79,
|
|
ELIBBAD: 80,
|
|
ELIBSCN: 81,
|
|
ELIBMAX: 82,
|
|
ELIBEXEC: 83,
|
|
ENOSYS: 38,
|
|
ENOTEMPTY: 39,
|
|
ENAMETOOLONG: 36,
|
|
ELOOP: 40,
|
|
EOPNOTSUPP: 95,
|
|
EPFNOSUPPORT: 96,
|
|
ECONNRESET: 104,
|
|
ENOBUFS: 105,
|
|
EAFNOSUPPORT: 97,
|
|
EPROTOTYPE: 91,
|
|
ENOTSOCK: 88,
|
|
ENOPROTOOPT: 92,
|
|
ESHUTDOWN: 108,
|
|
ECONNREFUSED: 111,
|
|
EADDRINUSE: 98,
|
|
ECONNABORTED: 103,
|
|
ENETUNREACH: 101,
|
|
ENETDOWN: 100,
|
|
ETIMEDOUT: 110,
|
|
EHOSTDOWN: 112,
|
|
EHOSTUNREACH: 113,
|
|
EINPROGRESS: 115,
|
|
EALREADY: 114,
|
|
EDESTADDRREQ: 89,
|
|
EMSGSIZE: 90,
|
|
EPROTONOSUPPORT: 93,
|
|
ESOCKTNOSUPPORT: 94,
|
|
EADDRNOTAVAIL: 99,
|
|
ENETRESET: 102,
|
|
EISCONN: 106,
|
|
ENOTCONN: 107,
|
|
ETOOMANYREFS: 109,
|
|
EUSERS: 87,
|
|
EDQUOT: 122,
|
|
ESTALE: 116,
|
|
ENOTSUP: 95,
|
|
ENOMEDIUM: 123,
|
|
EILSEQ: 84,
|
|
EOVERFLOW: 75,
|
|
ECANCELED: 125,
|
|
ENOTRECOVERABLE: 131,
|
|
EOWNERDEAD: 130,
|
|
ESTRPIPE: 86
|
|
};
|
|
|
|
function _pthread_key_create(key, destructor) {
|
|
if (key == 0) {
|
|
return ERRNO_CODES.EINVAL
|
|
}
|
|
HEAP32[key >> 2] = PTHREAD_SPECIFIC_NEXT_KEY;
|
|
PTHREAD_SPECIFIC[PTHREAD_SPECIFIC_NEXT_KEY] = 0;
|
|
PTHREAD_SPECIFIC_NEXT_KEY++;
|
|
return 0
|
|
}
|
|
|
|
function getTypeName(type) {
|
|
var ptr = ___getTypeName(type);
|
|
var rv = readLatin1String(ptr);
|
|
_free(ptr);
|
|
return rv
|
|
}
|
|
|
|
function requireRegisteredType(rawType, humanName) {
|
|
var impl = registeredTypes[rawType];
|
|
if (undefined === impl) {
|
|
throwBindingError(humanName + " has unknown type " + getTypeName(rawType))
|
|
}
|
|
return impl
|
|
}
|
|
|
|
function __emval_take_value(type, argv) {
|
|
type = requireRegisteredType(type, "_emval_take_value");
|
|
var v = type["readValueFromPointer"](argv);
|
|
return __emval_register(v)
|
|
}
|
|
var _llvm_pow_f32 = Math_pow;
|
|
var ERRNO_MESSAGES = {
|
|
0: "Success",
|
|
1: "Not super-user",
|
|
2: "No such file or directory",
|
|
3: "No such process",
|
|
4: "Interrupted system call",
|
|
5: "I/O error",
|
|
6: "No such device or address",
|
|
7: "Arg list too long",
|
|
8: "Exec format error",
|
|
9: "Bad file number",
|
|
10: "No children",
|
|
11: "No more processes",
|
|
12: "Not enough core",
|
|
13: "Permission denied",
|
|
14: "Bad address",
|
|
15: "Block device required",
|
|
16: "Mount device busy",
|
|
17: "File exists",
|
|
18: "Cross-device link",
|
|
19: "No such device",
|
|
20: "Not a directory",
|
|
21: "Is a directory",
|
|
22: "Invalid argument",
|
|
23: "Too many open files in system",
|
|
24: "Too many open files",
|
|
25: "Not a typewriter",
|
|
26: "Text file busy",
|
|
27: "File too large",
|
|
28: "No space left on device",
|
|
29: "Illegal seek",
|
|
30: "Read only file system",
|
|
31: "Too many links",
|
|
32: "Broken pipe",
|
|
33: "Math arg out of domain of func",
|
|
34: "Math result not representable",
|
|
35: "File locking deadlock error",
|
|
36: "File or path name too long",
|
|
37: "No record locks available",
|
|
38: "Function not implemented",
|
|
39: "Directory not empty",
|
|
40: "Too many symbolic links",
|
|
42: "No message of desired type",
|
|
43: "Identifier removed",
|
|
44: "Channel number out of range",
|
|
45: "Level 2 not synchronized",
|
|
46: "Level 3 halted",
|
|
47: "Level 3 reset",
|
|
48: "Link number out of range",
|
|
49: "Protocol driver not attached",
|
|
50: "No CSI structure available",
|
|
51: "Level 2 halted",
|
|
52: "Invalid exchange",
|
|
53: "Invalid request descriptor",
|
|
54: "Exchange full",
|
|
55: "No anode",
|
|
56: "Invalid request code",
|
|
57: "Invalid slot",
|
|
59: "Bad font file fmt",
|
|
60: "Device not a stream",
|
|
61: "No data (for no delay io)",
|
|
62: "Timer expired",
|
|
63: "Out of streams resources",
|
|
64: "Machine is not on the network",
|
|
65: "Package not installed",
|
|
66: "The object is remote",
|
|
67: "The link has been severed",
|
|
68: "Advertise error",
|
|
69: "Srmount error",
|
|
70: "Communication error on send",
|
|
71: "Protocol error",
|
|
72: "Multihop attempted",
|
|
73: "Cross mount point (not really error)",
|
|
74: "Trying to read unreadable message",
|
|
75: "Value too large for defined data type",
|
|
76: "Given log. name not unique",
|
|
77: "f.d. invalid for this operation",
|
|
78: "Remote address changed",
|
|
79: "Can access a needed shared lib",
|
|
80: "Accessing a corrupted shared lib",
|
|
81: ".lib section in a.out corrupted",
|
|
82: "Attempting to link in too many libs",
|
|
83: "Attempting to exec a shared library",
|
|
84: "Illegal byte sequence",
|
|
86: "Streams pipe error",
|
|
87: "Too many users",
|
|
88: "Socket operation on non-socket",
|
|
89: "Destination address required",
|
|
90: "Message too long",
|
|
91: "Protocol wrong type for socket",
|
|
92: "Protocol not available",
|
|
93: "Unknown protocol",
|
|
94: "Socket type not supported",
|
|
95: "Not supported",
|
|
96: "Protocol family not supported",
|
|
97: "Address family not supported by protocol family",
|
|
98: "Address already in use",
|
|
99: "Address not available",
|
|
100: "Network interface is not configured",
|
|
101: "Network is unreachable",
|
|
102: "Connection reset by network",
|
|
103: "Connection aborted",
|
|
104: "Connection reset by peer",
|
|
105: "No buffer space available",
|
|
106: "Socket is already connected",
|
|
107: "Socket is not connected",
|
|
108: "Can't send after socket shutdown",
|
|
109: "Too many references",
|
|
110: "Connection timed out",
|
|
111: "Connection refused",
|
|
112: "Host is down",
|
|
113: "Host is unreachable",
|
|
114: "Socket already connected",
|
|
115: "Connection already in progress",
|
|
116: "Stale file handle",
|
|
122: "Quota exceeded",
|
|
123: "No medium (in tape drive)",
|
|
125: "Operation canceled",
|
|
130: "Previous owner died",
|
|
131: "State not recoverable"
|
|
};
|
|
|
|
function ___setErrNo(value) {
|
|
if (Module["___errno_location"]) HEAP32[Module["___errno_location"]() >> 2] = value;
|
|
return value
|
|
}
|
|
var PATH = {
|
|
splitPath: (function(filename) {
|
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
|
|
return splitPathRe.exec(filename).slice(1)
|
|
}),
|
|
normalizeArray: (function(parts, allowAboveRoot) {
|
|
var up = 0;
|
|
for (var i = parts.length - 1; i >= 0; i--) {
|
|
var last = parts[i];
|
|
if (last === ".") {
|
|
parts.splice(i, 1)
|
|
} else if (last === "..") {
|
|
parts.splice(i, 1);
|
|
up++
|
|
} else if (up) {
|
|
parts.splice(i, 1);
|
|
up--
|
|
}
|
|
}
|
|
if (allowAboveRoot) {
|
|
for (; up--; up) {
|
|
parts.unshift("..")
|
|
}
|
|
}
|
|
return parts
|
|
}),
|
|
normalize: (function(path) {
|
|
var isAbsolute = path.charAt(0) === "/",
|
|
trailingSlash = path.substr(-1) === "/";
|
|
path = PATH.normalizeArray(path.split("/").filter((function(p) {
|
|
return !!p
|
|
})), !isAbsolute).join("/");
|
|
if (!path && !isAbsolute) {
|
|
path = "."
|
|
}
|
|
if (path && trailingSlash) {
|
|
path += "/"
|
|
}
|
|
return (isAbsolute ? "/" : "") + path
|
|
}),
|
|
dirname: (function(path) {
|
|
var result = PATH.splitPath(path),
|
|
root = result[0],
|
|
dir = result[1];
|
|
if (!root && !dir) {
|
|
return "."
|
|
}
|
|
if (dir) {
|
|
dir = dir.substr(0, dir.length - 1)
|
|
}
|
|
return root + dir
|
|
}),
|
|
basename: (function(path) {
|
|
if (path === "/") return "/";
|
|
var lastSlash = path.lastIndexOf("/");
|
|
if (lastSlash === -1) return path;
|
|
return path.substr(lastSlash + 1)
|
|
}),
|
|
extname: (function(path) {
|
|
return PATH.splitPath(path)[3]
|
|
}),
|
|
join: (function() {
|
|
var paths = Array.prototype.slice.call(arguments, 0);
|
|
return PATH.normalize(paths.join("/"))
|
|
}),
|
|
join2: (function(l, r) {
|
|
return PATH.normalize(l + "/" + r)
|
|
}),
|
|
resolve: (function() {
|
|
var resolvedPath = "",
|
|
resolvedAbsolute = false;
|
|
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
|
|
var path = i >= 0 ? arguments[i] : FS.cwd();
|
|
if (typeof path !== "string") {
|
|
throw new TypeError("Arguments to path.resolve must be strings")
|
|
} else if (!path) {
|
|
return ""
|
|
}
|
|
resolvedPath = path + "/" + resolvedPath;
|
|
resolvedAbsolute = path.charAt(0) === "/"
|
|
}
|
|
resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter((function(p) {
|
|
return !!p
|
|
})), !resolvedAbsolute).join("/");
|
|
return (resolvedAbsolute ? "/" : "") + resolvedPath || "."
|
|
}),
|
|
relative: (function(from, to) {
|
|
from = PATH.resolve(from).substr(1);
|
|
to = PATH.resolve(to).substr(1);
|
|
|
|
function trim(arr) {
|
|
var start = 0;
|
|
for (; start < arr.length; start++) {
|
|
if (arr[start] !== "") break
|
|
}
|
|
var end = arr.length - 1;
|
|
for (; end >= 0; end--) {
|
|
if (arr[end] !== "") break
|
|
}
|
|
if (start > end) return [];
|
|
return arr.slice(start, end - start + 1)
|
|
}
|
|
var fromParts = trim(from.split("/"));
|
|
var toParts = trim(to.split("/"));
|
|
var length = Math.min(fromParts.length, toParts.length);
|
|
var samePartsLength = length;
|
|
for (var i = 0; i < length; i++) {
|
|
if (fromParts[i] !== toParts[i]) {
|
|
samePartsLength = i;
|
|
break
|
|
}
|
|
}
|
|
var outputParts = [];
|
|
for (var i = samePartsLength; i < fromParts.length; i++) {
|
|
outputParts.push("..")
|
|
}
|
|
outputParts = outputParts.concat(toParts.slice(samePartsLength));
|
|
return outputParts.join("/")
|
|
})
|
|
};
|
|
var TTY = {
|
|
ttys: [],
|
|
init: (function() {}),
|
|
shutdown: (function() {}),
|
|
register: (function(dev, ops) {
|
|
TTY.ttys[dev] = {
|
|
input: [],
|
|
output: [],
|
|
ops: ops
|
|
};
|
|
FS.registerDevice(dev, TTY.stream_ops)
|
|
}),
|
|
stream_ops: {
|
|
open: (function(stream) {
|
|
var tty = TTY.ttys[stream.node.rdev];
|
|
if (!tty) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
stream.tty = tty;
|
|
stream.seekable = false
|
|
}),
|
|
close: (function(stream) {
|
|
stream.tty.ops.flush(stream.tty)
|
|
}),
|
|
flush: (function(stream) {
|
|
stream.tty.ops.flush(stream.tty)
|
|
}),
|
|
read: (function(stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.get_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO)
|
|
}
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = stream.tty.ops.get_char(stream.tty)
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset + i] = result
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return bytesRead
|
|
}),
|
|
write: (function(stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.put_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO)
|
|
}
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
stream.tty.ops.put_char(stream.tty, buffer[offset + i])
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return i
|
|
})
|
|
},
|
|
default_tty_ops: {
|
|
get_char: (function(tty) {
|
|
if (!tty.input.length) {
|
|
var result = null;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
var BUFSIZE = 256;
|
|
var buf = new Buffer(BUFSIZE);
|
|
var bytesRead = 0;
|
|
var isPosixPlatform = process.platform != "win32";
|
|
var fd = process.stdin.fd;
|
|
if (isPosixPlatform) {
|
|
var usingDevice = false;
|
|
try {
|
|
fd = fs.openSync("/dev/stdin", "r");
|
|
usingDevice = true
|
|
} catch (e) {}
|
|
}
|
|
try {
|
|
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null)
|
|
} catch (e) {
|
|
if (e.toString().indexOf("EOF") != -1) bytesRead = 0;
|
|
else throw e
|
|
}
|
|
if (usingDevice) {
|
|
fs.closeSync(fd)
|
|
}
|
|
if (bytesRead > 0) {
|
|
result = buf.slice(0, bytesRead).toString("utf-8")
|
|
} else {
|
|
result = null
|
|
}
|
|
} else if (typeof window != "undefined" && typeof window.prompt == "function") {
|
|
result = window.prompt("Input: ");
|
|
if (result !== null) {
|
|
result += "\n"
|
|
}
|
|
} else if (typeof readline == "function") {
|
|
result = readline();
|
|
if (result !== null) {
|
|
result += "\n"
|
|
}
|
|
}
|
|
if (!result) {
|
|
return null
|
|
}
|
|
tty.input = intArrayFromString(result, true)
|
|
}
|
|
return tty.input.shift()
|
|
}),
|
|
put_char: (function(tty, val) {
|
|
if (val === null || val === 10) {
|
|
Module["print"](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
} else {
|
|
if (val != 0) tty.output.push(val)
|
|
}
|
|
}),
|
|
flush: (function(tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
Module["print"](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
}
|
|
})
|
|
},
|
|
default_tty1_ops: {
|
|
put_char: (function(tty, val) {
|
|
if (val === null || val === 10) {
|
|
Module["printErr"](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
} else {
|
|
if (val != 0) tty.output.push(val)
|
|
}
|
|
}),
|
|
flush: (function(tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
Module["printErr"](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = []
|
|
}
|
|
})
|
|
}
|
|
};
|
|
var MEMFS = {
|
|
ops_table: null,
|
|
mount: (function(mount) {
|
|
return MEMFS.createNode(null, "/", 16384 | 511, 0)
|
|
}),
|
|
createNode: (function(parent, name, mode, dev) {
|
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (!MEMFS.ops_table) {
|
|
MEMFS.ops_table = {
|
|
dir: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
lookup: MEMFS.node_ops.lookup,
|
|
mknod: MEMFS.node_ops.mknod,
|
|
rename: MEMFS.node_ops.rename,
|
|
unlink: MEMFS.node_ops.unlink,
|
|
rmdir: MEMFS.node_ops.rmdir,
|
|
readdir: MEMFS.node_ops.readdir,
|
|
symlink: MEMFS.node_ops.symlink
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek
|
|
}
|
|
},
|
|
file: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek,
|
|
read: MEMFS.stream_ops.read,
|
|
write: MEMFS.stream_ops.write,
|
|
allocate: MEMFS.stream_ops.allocate,
|
|
mmap: MEMFS.stream_ops.mmap,
|
|
msync: MEMFS.stream_ops.msync
|
|
}
|
|
},
|
|
link: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
readlink: MEMFS.node_ops.readlink
|
|
},
|
|
stream: {}
|
|
},
|
|
chrdev: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: FS.chrdev_stream_ops
|
|
}
|
|
}
|
|
}
|
|
var node = FS.createNode(parent, name, mode, dev);
|
|
if (FS.isDir(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.dir.node;
|
|
node.stream_ops = MEMFS.ops_table.dir.stream;
|
|
node.contents = {}
|
|
} else if (FS.isFile(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.file.node;
|
|
node.stream_ops = MEMFS.ops_table.file.stream;
|
|
node.usedBytes = 0;
|
|
node.contents = null
|
|
} else if (FS.isLink(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.link.node;
|
|
node.stream_ops = MEMFS.ops_table.link.stream
|
|
} else if (FS.isChrdev(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.chrdev.node;
|
|
node.stream_ops = MEMFS.ops_table.chrdev.stream
|
|
}
|
|
node.timestamp = Date.now();
|
|
if (parent) {
|
|
parent.contents[name] = node
|
|
}
|
|
return node
|
|
}),
|
|
getFileDataAsRegularArray: (function(node) {
|
|
if (node.contents && node.contents.subarray) {
|
|
var arr = [];
|
|
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
|
|
return arr
|
|
}
|
|
return node.contents
|
|
}),
|
|
getFileDataAsTypedArray: (function(node) {
|
|
if (!node.contents) return new Uint8Array;
|
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes);
|
|
return new Uint8Array(node.contents)
|
|
}),
|
|
expandFileStorage: (function(node, newCapacity) {
|
|
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
|
|
node.contents = MEMFS.getFileDataAsRegularArray(node);
|
|
node.usedBytes = node.contents.length
|
|
}
|
|
if (!node.contents || node.contents.subarray) {
|
|
var prevCapacity = node.contents ? node.contents.length : 0;
|
|
if (prevCapacity >= newCapacity) return;
|
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
|
|
newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) | 0);
|
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256);
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newCapacity);
|
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0);
|
|
return
|
|
}
|
|
if (!node.contents && newCapacity > 0) node.contents = [];
|
|
while (node.contents.length < newCapacity) node.contents.push(0)
|
|
}),
|
|
resizeFileStorage: (function(node, newSize) {
|
|
if (node.usedBytes == newSize) return;
|
|
if (newSize == 0) {
|
|
node.contents = null;
|
|
node.usedBytes = 0;
|
|
return
|
|
}
|
|
if (!node.contents || node.contents.subarray) {
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(new ArrayBuffer(newSize));
|
|
if (oldContents) {
|
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes)))
|
|
}
|
|
node.usedBytes = newSize;
|
|
return
|
|
}
|
|
if (!node.contents) node.contents = [];
|
|
if (node.contents.length > newSize) node.contents.length = newSize;
|
|
else
|
|
while (node.contents.length < newSize) node.contents.push(0);
|
|
node.usedBytes = newSize
|
|
}),
|
|
node_ops: {
|
|
getattr: (function(node) {
|
|
var attr = {};
|
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
|
|
attr.ino = node.id;
|
|
attr.mode = node.mode;
|
|
attr.nlink = 1;
|
|
attr.uid = 0;
|
|
attr.gid = 0;
|
|
attr.rdev = node.rdev;
|
|
if (FS.isDir(node.mode)) {
|
|
attr.size = 4096
|
|
} else if (FS.isFile(node.mode)) {
|
|
attr.size = node.usedBytes
|
|
} else if (FS.isLink(node.mode)) {
|
|
attr.size = node.link.length
|
|
} else {
|
|
attr.size = 0
|
|
}
|
|
attr.atime = new Date(node.timestamp);
|
|
attr.mtime = new Date(node.timestamp);
|
|
attr.ctime = new Date(node.timestamp);
|
|
attr.blksize = 4096;
|
|
attr.blocks = Math.ceil(attr.size / attr.blksize);
|
|
return attr
|
|
}),
|
|
setattr: (function(node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp
|
|
}
|
|
if (attr.size !== undefined) {
|
|
MEMFS.resizeFileStorage(node, attr.size)
|
|
}
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
throw FS.genericErrors[ERRNO_CODES.ENOENT]
|
|
}),
|
|
mknod: (function(parent, name, mode, dev) {
|
|
return MEMFS.createNode(parent, name, mode, dev)
|
|
}),
|
|
rename: (function(old_node, new_dir, new_name) {
|
|
if (FS.isDir(old_node.mode)) {
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name)
|
|
} catch (e) {}
|
|
if (new_node) {
|
|
for (var i in new_node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)
|
|
}
|
|
}
|
|
}
|
|
delete old_node.parent.contents[old_node.name];
|
|
old_node.name = new_name;
|
|
new_dir.contents[new_name] = old_node;
|
|
old_node.parent = new_dir
|
|
}),
|
|
unlink: (function(parent, name) {
|
|
delete parent.contents[name]
|
|
}),
|
|
rmdir: (function(parent, name) {
|
|
var node = FS.lookupNode(parent, name);
|
|
for (var i in node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)
|
|
}
|
|
delete parent.contents[name]
|
|
}),
|
|
readdir: (function(node) {
|
|
var entries = [".", ".."];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue
|
|
}
|
|
entries.push(key)
|
|
}
|
|
return entries
|
|
}),
|
|
symlink: (function(parent, newname, oldpath) {
|
|
var node = MEMFS.createNode(parent, newname, 511 | 40960, 0);
|
|
node.link = oldpath;
|
|
return node
|
|
}),
|
|
readlink: (function(node) {
|
|
if (!FS.isLink(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return node.link
|
|
})
|
|
},
|
|
stream_ops: {
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= stream.node.usedBytes) return 0;
|
|
var size = Math.min(stream.node.usedBytes - position, length);
|
|
assert(size >= 0);
|
|
if (size > 8 && contents.subarray) {
|
|
buffer.set(contents.subarray(position, position + size), offset)
|
|
} else {
|
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]
|
|
}
|
|
return size
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position, canOwn) {
|
|
if (!length) return 0;
|
|
var node = stream.node;
|
|
node.timestamp = Date.now();
|
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) {
|
|
if (canOwn) {
|
|
node.contents = buffer.subarray(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length
|
|
} else if (node.usedBytes === 0 && position === 0) {
|
|
node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
|
|
node.usedBytes = length;
|
|
return length
|
|
} else if (position + length <= node.usedBytes) {
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
return length
|
|
}
|
|
}
|
|
MEMFS.expandFileStorage(node, position + length);
|
|
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
else {
|
|
for (var i = 0; i < length; i++) {
|
|
node.contents[position + i] = buffer[offset + i]
|
|
}
|
|
}
|
|
node.usedBytes = Math.max(node.usedBytes, position + length);
|
|
return length
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.usedBytes
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return position
|
|
}),
|
|
allocate: (function(stream, offset, length) {
|
|
MEMFS.expandFileStorage(stream.node, offset + length);
|
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length)
|
|
}),
|
|
mmap: (function(stream, buffer, offset, length, position, prot, flags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
var ptr;
|
|
var allocated;
|
|
var contents = stream.node.contents;
|
|
if (!(flags & 2) && (contents.buffer === buffer || contents.buffer === buffer.buffer)) {
|
|
allocated = false;
|
|
ptr = contents.byteOffset
|
|
} else {
|
|
if (position > 0 || position + length < stream.node.usedBytes) {
|
|
if (contents.subarray) {
|
|
contents = contents.subarray(position, position + length)
|
|
} else {
|
|
contents = Array.prototype.slice.call(contents, position, position + length)
|
|
}
|
|
}
|
|
allocated = true;
|
|
ptr = _malloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM)
|
|
}
|
|
buffer.set(contents, ptr)
|
|
}
|
|
return {
|
|
ptr: ptr,
|
|
allocated: allocated
|
|
}
|
|
}),
|
|
msync: (function(stream, buffer, offset, length, mmapFlags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
if (mmapFlags & 2) {
|
|
return 0
|
|
}
|
|
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
|
|
return 0
|
|
})
|
|
}
|
|
};
|
|
var IDBFS = {
|
|
dbs: {},
|
|
indexedDB: (function() {
|
|
if (typeof indexedDB !== "undefined") return indexedDB;
|
|
var ret = null;
|
|
if (typeof window === "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
assert(ret, "IDBFS used, but indexedDB not supported");
|
|
return ret
|
|
}),
|
|
DB_VERSION: 21,
|
|
DB_STORE_NAME: "FILE_DATA",
|
|
mount: (function(mount) {
|
|
return MEMFS.mount.apply(null, arguments)
|
|
}),
|
|
syncfs: (function(mount, populate, callback) {
|
|
IDBFS.getLocalSet(mount, (function(err, local) {
|
|
if (err) return callback(err);
|
|
IDBFS.getRemoteSet(mount, (function(err, remote) {
|
|
if (err) return callback(err);
|
|
var src = populate ? remote : local;
|
|
var dst = populate ? local : remote;
|
|
IDBFS.reconcile(src, dst, callback)
|
|
}))
|
|
}))
|
|
}),
|
|
getDB: (function(name, callback) {
|
|
var db = IDBFS.dbs[name];
|
|
if (db) {
|
|
return callback(null, db)
|
|
}
|
|
var req;
|
|
try {
|
|
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
if (!req) {
|
|
return callback("Unable to connect to IndexedDB")
|
|
}
|
|
req.onupgradeneeded = (function(e) {
|
|
var db = e.target.result;
|
|
var transaction = e.target.transaction;
|
|
var fileStore;
|
|
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
|
|
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME)
|
|
} else {
|
|
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME)
|
|
}
|
|
if (!fileStore.indexNames.contains("timestamp")) {
|
|
fileStore.createIndex("timestamp", "timestamp", {
|
|
unique: false
|
|
})
|
|
}
|
|
});
|
|
req.onsuccess = (function() {
|
|
db = req.result;
|
|
IDBFS.dbs[name] = db;
|
|
callback(null, db)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
getLocalSet: (function(mount, callback) {
|
|
var entries = {};
|
|
|
|
function isRealDir(p) {
|
|
return p !== "." && p !== ".."
|
|
}
|
|
|
|
function toAbsolute(root) {
|
|
return (function(p) {
|
|
return PATH.join2(root, p)
|
|
})
|
|
}
|
|
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
|
|
while (check.length) {
|
|
var path = check.pop();
|
|
var stat;
|
|
try {
|
|
stat = FS.stat(path)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
if (FS.isDir(stat.mode)) {
|
|
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)))
|
|
}
|
|
entries[path] = {
|
|
timestamp: stat.mtime
|
|
}
|
|
}
|
|
return callback(null, {
|
|
type: "local",
|
|
entries: entries
|
|
})
|
|
}),
|
|
getRemoteSet: (function(mount, callback) {
|
|
var entries = {};
|
|
IDBFS.getDB(mount.mountpoint, (function(err, db) {
|
|
if (err) return callback(err);
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readonly");
|
|
transaction.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
});
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
var index = store.index("timestamp");
|
|
index.openKeyCursor().onsuccess = (function(event) {
|
|
var cursor = event.target.result;
|
|
if (!cursor) {
|
|
return callback(null, {
|
|
type: "remote",
|
|
db: db,
|
|
entries: entries
|
|
})
|
|
}
|
|
entries[cursor.primaryKey] = {
|
|
timestamp: cursor.key
|
|
};
|
|
cursor.continue()
|
|
})
|
|
}))
|
|
}),
|
|
loadLocalEntry: (function(path, callback) {
|
|
var stat, node;
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
node = lookup.node;
|
|
stat = FS.stat(path)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
if (FS.isDir(stat.mode)) {
|
|
return callback(null, {
|
|
timestamp: stat.mtime,
|
|
mode: stat.mode
|
|
})
|
|
} else if (FS.isFile(stat.mode)) {
|
|
node.contents = MEMFS.getFileDataAsTypedArray(node);
|
|
return callback(null, {
|
|
timestamp: stat.mtime,
|
|
mode: stat.mode,
|
|
contents: node.contents
|
|
})
|
|
} else {
|
|
return callback(new Error("node type not supported"))
|
|
}
|
|
}),
|
|
storeLocalEntry: (function(path, entry, callback) {
|
|
try {
|
|
if (FS.isDir(entry.mode)) {
|
|
FS.mkdir(path, entry.mode)
|
|
} else if (FS.isFile(entry.mode)) {
|
|
FS.writeFile(path, entry.contents, {
|
|
encoding: "binary",
|
|
canOwn: true
|
|
})
|
|
} else {
|
|
return callback(new Error("node type not supported"))
|
|
}
|
|
FS.chmod(path, entry.mode);
|
|
FS.utime(path, entry.timestamp, entry.timestamp)
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
callback(null)
|
|
}),
|
|
removeLocalEntry: (function(path, callback) {
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
var stat = FS.stat(path);
|
|
if (FS.isDir(stat.mode)) {
|
|
FS.rmdir(path)
|
|
} else if (FS.isFile(stat.mode)) {
|
|
FS.unlink(path)
|
|
}
|
|
} catch (e) {
|
|
return callback(e)
|
|
}
|
|
callback(null)
|
|
}),
|
|
loadRemoteEntry: (function(store, path, callback) {
|
|
var req = store.get(path);
|
|
req.onsuccess = (function(event) {
|
|
callback(null, event.target.result)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
storeRemoteEntry: (function(store, path, entry, callback) {
|
|
var req = store.put(entry, path);
|
|
req.onsuccess = (function() {
|
|
callback(null)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
removeRemoteEntry: (function(store, path, callback) {
|
|
var req = store.delete(path);
|
|
req.onsuccess = (function() {
|
|
callback(null)
|
|
});
|
|
req.onerror = (function(e) {
|
|
callback(this.error);
|
|
e.preventDefault()
|
|
})
|
|
}),
|
|
reconcile: (function(src, dst, callback) {
|
|
var total = 0;
|
|
var create = [];
|
|
Object.keys(src.entries).forEach((function(key) {
|
|
var e = src.entries[key];
|
|
var e2 = dst.entries[key];
|
|
if (!e2 || e.timestamp > e2.timestamp) {
|
|
create.push(key);
|
|
total++
|
|
}
|
|
}));
|
|
var remove = [];
|
|
Object.keys(dst.entries).forEach((function(key) {
|
|
var e = dst.entries[key];
|
|
var e2 = src.entries[key];
|
|
if (!e2) {
|
|
remove.push(key);
|
|
total++
|
|
}
|
|
}));
|
|
if (!total) {
|
|
return callback(null)
|
|
}
|
|
var completed = 0;
|
|
var db = src.type === "remote" ? src.db : dst.db;
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], "readwrite");
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return callback(err)
|
|
}
|
|
return
|
|
}
|
|
if (++completed >= total) {
|
|
return callback(null)
|
|
}
|
|
}
|
|
transaction.onerror = (function(e) {
|
|
done(this.error);
|
|
e.preventDefault()
|
|
});
|
|
create.sort().forEach((function(path) {
|
|
if (dst.type === "local") {
|
|
IDBFS.loadRemoteEntry(store, path, (function(err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeLocalEntry(path, entry, done)
|
|
}))
|
|
} else {
|
|
IDBFS.loadLocalEntry(path, (function(err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeRemoteEntry(store, path, entry, done)
|
|
}))
|
|
}
|
|
}));
|
|
remove.sort().reverse().forEach((function(path) {
|
|
if (dst.type === "local") {
|
|
IDBFS.removeLocalEntry(path, done)
|
|
} else {
|
|
IDBFS.removeRemoteEntry(store, path, done)
|
|
}
|
|
}))
|
|
})
|
|
};
|
|
var NODEFS = {
|
|
isWindows: false,
|
|
staticInit: (function() {
|
|
NODEFS.isWindows = !!process.platform.match(/^win/)
|
|
}),
|
|
mount: (function(mount) {
|
|
assert(ENVIRONMENT_IS_NODE);
|
|
return NODEFS.createNode(null, "/", NODEFS.getMode(mount.opts.root), 0)
|
|
}),
|
|
createNode: (function(parent, name, mode, dev) {
|
|
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.node_ops = NODEFS.node_ops;
|
|
node.stream_ops = NODEFS.stream_ops;
|
|
return node
|
|
}),
|
|
getMode: (function(path) {
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
if (NODEFS.isWindows) {
|
|
stat.mode = stat.mode | (stat.mode & 146) >> 1
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
return stat.mode
|
|
}),
|
|
realPath: (function(node) {
|
|
var parts = [];
|
|
while (node.parent !== node) {
|
|
parts.push(node.name);
|
|
node = node.parent
|
|
}
|
|
parts.push(node.mount.opts.root);
|
|
parts.reverse();
|
|
return PATH.join.apply(null, parts)
|
|
}),
|
|
flagsToPermissionStringMap: {
|
|
0: "r",
|
|
1: "r+",
|
|
2: "r+",
|
|
64: "r",
|
|
65: "r+",
|
|
66: "r+",
|
|
129: "rx+",
|
|
193: "rx+",
|
|
514: "w+",
|
|
577: "w",
|
|
578: "w+",
|
|
705: "wx",
|
|
706: "wx+",
|
|
1024: "a",
|
|
1025: "a",
|
|
1026: "a+",
|
|
1089: "a",
|
|
1090: "a+",
|
|
1153: "ax",
|
|
1154: "ax+",
|
|
1217: "ax",
|
|
1218: "ax+",
|
|
4096: "rs",
|
|
4098: "rs+"
|
|
},
|
|
flagsToPermissionString: (function(flags) {
|
|
flags &= ~2097152;
|
|
flags &= ~2048;
|
|
flags &= ~32768;
|
|
flags &= ~524288;
|
|
if (flags in NODEFS.flagsToPermissionStringMap) {
|
|
return NODEFS.flagsToPermissionStringMap[flags]
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
}),
|
|
node_ops: {
|
|
getattr: (function(node) {
|
|
var path = NODEFS.realPath(node);
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
if (NODEFS.isWindows && !stat.blksize) {
|
|
stat.blksize = 4096
|
|
}
|
|
if (NODEFS.isWindows && !stat.blocks) {
|
|
stat.blocks = (stat.size + stat.blksize - 1) / stat.blksize | 0
|
|
}
|
|
return {
|
|
dev: stat.dev,
|
|
ino: stat.ino,
|
|
mode: stat.mode,
|
|
nlink: stat.nlink,
|
|
uid: stat.uid,
|
|
gid: stat.gid,
|
|
rdev: stat.rdev,
|
|
size: stat.size,
|
|
atime: stat.atime,
|
|
mtime: stat.mtime,
|
|
ctime: stat.ctime,
|
|
blksize: stat.blksize,
|
|
blocks: stat.blocks
|
|
}
|
|
}),
|
|
setattr: (function(node, attr) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (attr.mode !== undefined) {
|
|
fs.chmodSync(path, attr.mode);
|
|
node.mode = attr.mode
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
var date = new Date(attr.timestamp);
|
|
fs.utimesSync(path, date, date)
|
|
}
|
|
if (attr.size !== undefined) {
|
|
fs.truncateSync(path, attr.size)
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
var mode = NODEFS.getMode(path);
|
|
return NODEFS.createNode(parent, name, mode)
|
|
}),
|
|
mknod: (function(parent, name, mode, dev) {
|
|
var node = NODEFS.createNode(parent, name, mode, dev);
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (FS.isDir(node.mode)) {
|
|
fs.mkdirSync(path, node.mode)
|
|
} else {
|
|
fs.writeFileSync(path, "", {
|
|
mode: node.mode
|
|
})
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
return node
|
|
}),
|
|
rename: (function(oldNode, newDir, newName) {
|
|
var oldPath = NODEFS.realPath(oldNode);
|
|
var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
|
|
try {
|
|
fs.renameSync(oldPath, newPath)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
unlink: (function(parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.unlinkSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
rmdir: (function(parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.rmdirSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
readdir: (function(node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
return fs.readdirSync(path)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
symlink: (function(parent, newName, oldPath) {
|
|
var newPath = PATH.join2(NODEFS.realPath(parent), newName);
|
|
try {
|
|
fs.symlinkSync(oldPath, newPath)
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
readlink: (function(node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
path = fs.readlinkSync(path);
|
|
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
|
|
return path
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
})
|
|
},
|
|
stream_ops: {
|
|
open: (function(stream) {
|
|
var path = NODEFS.realPath(stream.node);
|
|
try {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags))
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
close: (function(stream) {
|
|
try {
|
|
if (FS.isFile(stream.node.mode) && stream.nfd) {
|
|
fs.closeSync(stream.nfd)
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}),
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
if (length === 0) return 0;
|
|
var nbuffer = new Buffer(length);
|
|
var res;
|
|
try {
|
|
res = fs.readSync(stream.nfd, nbuffer, 0, length, position)
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
if (res > 0) {
|
|
for (var i = 0; i < res; i++) {
|
|
buffer[offset + i] = nbuffer[i]
|
|
}
|
|
}
|
|
return res
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position) {
|
|
var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
|
|
var res;
|
|
try {
|
|
res = fs.writeSync(stream.nfd, nbuffer, 0, length, position)
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
return res
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
try {
|
|
var stat = fs.fstatSync(stream.nfd);
|
|
position += stat.size
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code])
|
|
}
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return position
|
|
})
|
|
}
|
|
};
|
|
var WORKERFS = {
|
|
DIR_MODE: 16895,
|
|
FILE_MODE: 33279,
|
|
reader: null,
|
|
mount: (function(mount) {
|
|
assert(ENVIRONMENT_IS_WORKER);
|
|
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync;
|
|
var root = WORKERFS.createNode(null, "/", WORKERFS.DIR_MODE, 0);
|
|
var createdParents = {};
|
|
|
|
function ensureParent(path) {
|
|
var parts = path.split("/");
|
|
var parent = root;
|
|
for (var i = 0; i < parts.length - 1; i++) {
|
|
var curr = parts.slice(0, i + 1).join("/");
|
|
if (!createdParents[curr]) {
|
|
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0)
|
|
}
|
|
parent = createdParents[curr]
|
|
}
|
|
return parent
|
|
}
|
|
|
|
function base(path) {
|
|
var parts = path.split("/");
|
|
return parts[parts.length - 1]
|
|
}
|
|
Array.prototype.forEach.call(mount.opts["files"] || [], (function(file) {
|
|
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate)
|
|
}));
|
|
(mount.opts["blobs"] || []).forEach((function(obj) {
|
|
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"])
|
|
}));
|
|
(mount.opts["packages"] || []).forEach((function(pack) {
|
|
pack["metadata"].files.forEach((function(file) {
|
|
var name = file.filename.substr(1);
|
|
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack["blob"].slice(file.start, file.end))
|
|
}))
|
|
}));
|
|
return root
|
|
}),
|
|
createNode: (function(parent, name, mode, dev, contents, mtime) {
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.mode = mode;
|
|
node.node_ops = WORKERFS.node_ops;
|
|
node.stream_ops = WORKERFS.stream_ops;
|
|
node.timestamp = (mtime || new Date).getTime();
|
|
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
|
|
if (mode === WORKERFS.FILE_MODE) {
|
|
node.size = contents.size;
|
|
node.contents = contents
|
|
} else {
|
|
node.size = 4096;
|
|
node.contents = {}
|
|
}
|
|
if (parent) {
|
|
parent.contents[name] = node
|
|
}
|
|
return node
|
|
}),
|
|
node_ops: {
|
|
getattr: (function(node) {
|
|
return {
|
|
dev: 1,
|
|
ino: undefined,
|
|
mode: node.mode,
|
|
nlink: 1,
|
|
uid: 0,
|
|
gid: 0,
|
|
rdev: undefined,
|
|
size: node.size,
|
|
atime: new Date(node.timestamp),
|
|
mtime: new Date(node.timestamp),
|
|
ctime: new Date(node.timestamp),
|
|
blksize: 4096,
|
|
blocks: Math.ceil(node.size / 4096)
|
|
}
|
|
}),
|
|
setattr: (function(node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp
|
|
}
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}),
|
|
mknod: (function(parent, name, mode, dev) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
rename: (function(oldNode, newDir, newName) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
unlink: (function(parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
rmdir: (function(parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
readdir: (function(node) {
|
|
var entries = [".", ".."];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue
|
|
}
|
|
entries.push(key)
|
|
}
|
|
return entries
|
|
}),
|
|
symlink: (function(parent, newName, oldPath) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}),
|
|
readlink: (function(node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
})
|
|
},
|
|
stream_ops: {
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
if (position >= stream.node.size) return 0;
|
|
var chunk = stream.node.contents.slice(position, position + length);
|
|
var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
|
|
buffer.set(new Uint8Array(ab), offset);
|
|
return chunk.size
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) {
|
|
position += stream.position
|
|
} else if (whence === 2) {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.size
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return position
|
|
})
|
|
}
|
|
};
|
|
STATICTOP += 16;
|
|
STATICTOP += 16;
|
|
STATICTOP += 16;
|
|
var FS = {
|
|
root: null,
|
|
mounts: [],
|
|
devices: [null],
|
|
streams: [],
|
|
nextInode: 1,
|
|
nameTable: null,
|
|
currentPath: "/",
|
|
initialized: false,
|
|
ignorePermissions: true,
|
|
trackingDelegate: {},
|
|
tracking: {
|
|
openFlags: {
|
|
READ: 1,
|
|
WRITE: 2
|
|
}
|
|
},
|
|
ErrnoError: null,
|
|
genericErrors: {},
|
|
filesystems: null,
|
|
syncFSRequests: 0,
|
|
handleFSError: (function(e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e + " : " + stackTrace();
|
|
return ___setErrNo(e.errno)
|
|
}),
|
|
lookupPath: (function(path, opts) {
|
|
path = PATH.resolve(FS.cwd(), path);
|
|
opts = opts || {};
|
|
if (!path) return {
|
|
path: "",
|
|
node: null
|
|
};
|
|
var defaults = {
|
|
follow_mount: true,
|
|
recurse_count: 0
|
|
};
|
|
for (var key in defaults) {
|
|
if (opts[key] === undefined) {
|
|
opts[key] = defaults[key]
|
|
}
|
|
}
|
|
if (opts.recurse_count > 8) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP)
|
|
}
|
|
var parts = PATH.normalizeArray(path.split("/").filter((function(p) {
|
|
return !!p
|
|
})), false);
|
|
var current = FS.root;
|
|
var current_path = "/";
|
|
for (var i = 0; i < parts.length; i++) {
|
|
var islast = i === parts.length - 1;
|
|
if (islast && opts.parent) {
|
|
break
|
|
}
|
|
current = FS.lookupNode(current, parts[i]);
|
|
current_path = PATH.join2(current_path, parts[i]);
|
|
if (FS.isMountpoint(current)) {
|
|
if (!islast || islast && opts.follow_mount) {
|
|
current = current.mounted.root
|
|
}
|
|
}
|
|
if (!islast || opts.follow) {
|
|
var count = 0;
|
|
while (FS.isLink(current.mode)) {
|
|
var link = FS.readlink(current_path);
|
|
current_path = PATH.resolve(PATH.dirname(current_path), link);
|
|
var lookup = FS.lookupPath(current_path, {
|
|
recurse_count: opts.recurse_count
|
|
});
|
|
current = lookup.node;
|
|
if (count++ > 40) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP)
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return {
|
|
path: current_path,
|
|
node: current
|
|
}
|
|
}),
|
|
getPath: (function(node) {
|
|
var path;
|
|
while (true) {
|
|
if (FS.isRoot(node)) {
|
|
var mount = node.mount.mountpoint;
|
|
if (!path) return mount;
|
|
return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path
|
|
}
|
|
path = path ? node.name + "/" + path : node.name;
|
|
node = node.parent
|
|
}
|
|
}),
|
|
hashName: (function(parentid, name) {
|
|
var hash = 0;
|
|
for (var i = 0; i < name.length; i++) {
|
|
hash = (hash << 5) - hash + name.charCodeAt(i) | 0
|
|
}
|
|
return (parentid + hash >>> 0) % FS.nameTable.length
|
|
}),
|
|
hashAddNode: (function(node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
node.name_next = FS.nameTable[hash];
|
|
FS.nameTable[hash] = node
|
|
}),
|
|
hashRemoveNode: (function(node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
if (FS.nameTable[hash] === node) {
|
|
FS.nameTable[hash] = node.name_next
|
|
} else {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
if (current.name_next === node) {
|
|
current.name_next = node.name_next;
|
|
break
|
|
}
|
|
current = current.name_next
|
|
}
|
|
}
|
|
}),
|
|
lookupNode: (function(parent, name) {
|
|
var err = FS.mayLookup(parent);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err, parent)
|
|
}
|
|
var hash = FS.hashName(parent.id, name);
|
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
|
|
var nodeName = node.name;
|
|
if (node.parent.id === parent.id && nodeName === name) {
|
|
return node
|
|
}
|
|
}
|
|
return FS.lookup(parent, name)
|
|
}),
|
|
createNode: (function(parent, name, mode, rdev) {
|
|
if (!FS.FSNode) {
|
|
FS.FSNode = (function(parent, name, mode, rdev) {
|
|
if (!parent) {
|
|
parent = this
|
|
}
|
|
this.parent = parent;
|
|
this.mount = parent.mount;
|
|
this.mounted = null;
|
|
this.id = FS.nextInode++;
|
|
this.name = name;
|
|
this.mode = mode;
|
|
this.node_ops = {};
|
|
this.stream_ops = {};
|
|
this.rdev = rdev
|
|
});
|
|
FS.FSNode.prototype = {};
|
|
var readMode = 292 | 73;
|
|
var writeMode = 146;
|
|
Object.defineProperties(FS.FSNode.prototype, {
|
|
read: {
|
|
get: (function() {
|
|
return (this.mode & readMode) === readMode
|
|
}),
|
|
set: (function(val) {
|
|
val ? this.mode |= readMode : this.mode &= ~readMode
|
|
})
|
|
},
|
|
write: {
|
|
get: (function() {
|
|
return (this.mode & writeMode) === writeMode
|
|
}),
|
|
set: (function(val) {
|
|
val ? this.mode |= writeMode : this.mode &= ~writeMode
|
|
})
|
|
},
|
|
isFolder: {
|
|
get: (function() {
|
|
return FS.isDir(this.mode)
|
|
})
|
|
},
|
|
isDevice: {
|
|
get: (function() {
|
|
return FS.isChrdev(this.mode)
|
|
})
|
|
}
|
|
})
|
|
}
|
|
var node = new FS.FSNode(parent, name, mode, rdev);
|
|
FS.hashAddNode(node);
|
|
return node
|
|
}),
|
|
destroyNode: (function(node) {
|
|
FS.hashRemoveNode(node)
|
|
}),
|
|
isRoot: (function(node) {
|
|
return node === node.parent
|
|
}),
|
|
isMountpoint: (function(node) {
|
|
return !!node.mounted
|
|
}),
|
|
isFile: (function(mode) {
|
|
return (mode & 61440) === 32768
|
|
}),
|
|
isDir: (function(mode) {
|
|
return (mode & 61440) === 16384
|
|
}),
|
|
isLink: (function(mode) {
|
|
return (mode & 61440) === 40960
|
|
}),
|
|
isChrdev: (function(mode) {
|
|
return (mode & 61440) === 8192
|
|
}),
|
|
isBlkdev: (function(mode) {
|
|
return (mode & 61440) === 24576
|
|
}),
|
|
isFIFO: (function(mode) {
|
|
return (mode & 61440) === 4096
|
|
}),
|
|
isSocket: (function(mode) {
|
|
return (mode & 49152) === 49152
|
|
}),
|
|
flagModes: {
|
|
"r": 0,
|
|
"rs": 1052672,
|
|
"r+": 2,
|
|
"w": 577,
|
|
"wx": 705,
|
|
"xw": 705,
|
|
"w+": 578,
|
|
"wx+": 706,
|
|
"xw+": 706,
|
|
"a": 1089,
|
|
"ax": 1217,
|
|
"xa": 1217,
|
|
"a+": 1090,
|
|
"ax+": 1218,
|
|
"xa+": 1218
|
|
},
|
|
modeStringToFlags: (function(str) {
|
|
var flags = FS.flagModes[str];
|
|
if (typeof flags === "undefined") {
|
|
throw new Error("Unknown file open mode: " + str)
|
|
}
|
|
return flags
|
|
}),
|
|
flagsToPermissionString: (function(flag) {
|
|
var perms = ["r", "w", "rw"][flag & 3];
|
|
if (flag & 512) {
|
|
perms += "w"
|
|
}
|
|
return perms
|
|
}),
|
|
nodePermissions: (function(node, perms) {
|
|
if (FS.ignorePermissions) {
|
|
return 0
|
|
}
|
|
if (perms.indexOf("r") !== -1 && !(node.mode & 292)) {
|
|
return ERRNO_CODES.EACCES
|
|
} else if (perms.indexOf("w") !== -1 && !(node.mode & 146)) {
|
|
return ERRNO_CODES.EACCES
|
|
} else if (perms.indexOf("x") !== -1 && !(node.mode & 73)) {
|
|
return ERRNO_CODES.EACCES
|
|
}
|
|
return 0
|
|
}),
|
|
mayLookup: (function(dir) {
|
|
var err = FS.nodePermissions(dir, "x");
|
|
if (err) return err;
|
|
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
|
|
return 0
|
|
}),
|
|
mayCreate: (function(dir, name) {
|
|
try {
|
|
var node = FS.lookupNode(dir, name);
|
|
return ERRNO_CODES.EEXIST
|
|
} catch (e) {}
|
|
return FS.nodePermissions(dir, "wx")
|
|
}),
|
|
mayDelete: (function(dir, name, isdir) {
|
|
var node;
|
|
try {
|
|
node = FS.lookupNode(dir, name)
|
|
} catch (e) {
|
|
return e.errno
|
|
}
|
|
var err = FS.nodePermissions(dir, "wx");
|
|
if (err) {
|
|
return err
|
|
}
|
|
if (isdir) {
|
|
if (!FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.ENOTDIR
|
|
}
|
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
|
|
return ERRNO_CODES.EBUSY
|
|
}
|
|
} else {
|
|
if (FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.EISDIR
|
|
}
|
|
}
|
|
return 0
|
|
}),
|
|
mayOpen: (function(node, flags) {
|
|
if (!node) {
|
|
return ERRNO_CODES.ENOENT
|
|
}
|
|
if (FS.isLink(node.mode)) {
|
|
return ERRNO_CODES.ELOOP
|
|
} else if (FS.isDir(node.mode)) {
|
|
if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) {
|
|
return ERRNO_CODES.EISDIR
|
|
}
|
|
}
|
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags))
|
|
}),
|
|
MAX_OPEN_FDS: 4096,
|
|
nextfd: (function(fd_start, fd_end) {
|
|
fd_start = fd_start || 0;
|
|
fd_end = fd_end || FS.MAX_OPEN_FDS;
|
|
for (var fd = fd_start; fd <= fd_end; fd++) {
|
|
if (!FS.streams[fd]) {
|
|
return fd
|
|
}
|
|
}
|
|
throw new FS.ErrnoError(ERRNO_CODES.EMFILE)
|
|
}),
|
|
getStream: (function(fd) {
|
|
return FS.streams[fd]
|
|
}),
|
|
createStream: (function(stream, fd_start, fd_end) {
|
|
if (!FS.FSStream) {
|
|
FS.FSStream = (function() {});
|
|
FS.FSStream.prototype = {};
|
|
Object.defineProperties(FS.FSStream.prototype, {
|
|
object: {
|
|
get: (function() {
|
|
return this.node
|
|
}),
|
|
set: (function(val) {
|
|
this.node = val
|
|
})
|
|
},
|
|
isRead: {
|
|
get: (function() {
|
|
return (this.flags & 2097155) !== 1
|
|
})
|
|
},
|
|
isWrite: {
|
|
get: (function() {
|
|
return (this.flags & 2097155) !== 0
|
|
})
|
|
},
|
|
isAppend: {
|
|
get: (function() {
|
|
return this.flags & 1024
|
|
})
|
|
}
|
|
})
|
|
}
|
|
var newStream = new FS.FSStream;
|
|
for (var p in stream) {
|
|
newStream[p] = stream[p]
|
|
}
|
|
stream = newStream;
|
|
var fd = FS.nextfd(fd_start, fd_end);
|
|
stream.fd = fd;
|
|
FS.streams[fd] = stream;
|
|
return stream
|
|
}),
|
|
closeStream: (function(fd) {
|
|
FS.streams[fd] = null
|
|
}),
|
|
chrdev_stream_ops: {
|
|
open: (function(stream) {
|
|
var device = FS.getDevice(stream.node.rdev);
|
|
stream.stream_ops = device.stream_ops;
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream)
|
|
}
|
|
}),
|
|
llseek: (function() {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
})
|
|
},
|
|
major: (function(dev) {
|
|
return dev >> 8
|
|
}),
|
|
minor: (function(dev) {
|
|
return dev & 255
|
|
}),
|
|
makedev: (function(ma, mi) {
|
|
return ma << 8 | mi
|
|
}),
|
|
registerDevice: (function(dev, ops) {
|
|
FS.devices[dev] = {
|
|
stream_ops: ops
|
|
}
|
|
}),
|
|
getDevice: (function(dev) {
|
|
return FS.devices[dev]
|
|
}),
|
|
getMounts: (function(mount) {
|
|
var mounts = [];
|
|
var check = [mount];
|
|
while (check.length) {
|
|
var m = check.pop();
|
|
mounts.push(m);
|
|
check.push.apply(check, m.mounts)
|
|
}
|
|
return mounts
|
|
}),
|
|
syncfs: (function(populate, callback) {
|
|
if (typeof populate === "function") {
|
|
callback = populate;
|
|
populate = false
|
|
}
|
|
FS.syncFSRequests++;
|
|
if (FS.syncFSRequests > 1) {
|
|
console.log("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work")
|
|
}
|
|
var mounts = FS.getMounts(FS.root.mount);
|
|
var completed = 0;
|
|
|
|
function doCallback(err) {
|
|
assert(FS.syncFSRequests > 0);
|
|
FS.syncFSRequests--;
|
|
return callback(err)
|
|
}
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return doCallback(err)
|
|
}
|
|
return
|
|
}
|
|
if (++completed >= mounts.length) {
|
|
doCallback(null)
|
|
}
|
|
}
|
|
mounts.forEach((function(mount) {
|
|
if (!mount.type.syncfs) {
|
|
return done(null)
|
|
}
|
|
mount.type.syncfs(mount, populate, done)
|
|
}))
|
|
}),
|
|
mount: (function(type, opts, mountpoint) {
|
|
var root = mountpoint === "/";
|
|
var pseudo = !mountpoint;
|
|
var node;
|
|
if (root && FS.root) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
} else if (!root && !pseudo) {
|
|
var lookup = FS.lookupPath(mountpoint, {
|
|
follow_mount: false
|
|
});
|
|
mountpoint = lookup.path;
|
|
node = lookup.node;
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
if (!FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
}
|
|
var mount = {
|
|
type: type,
|
|
opts: opts,
|
|
mountpoint: mountpoint,
|
|
mounts: []
|
|
};
|
|
var mountRoot = type.mount(mount);
|
|
mountRoot.mount = mount;
|
|
mount.root = mountRoot;
|
|
if (root) {
|
|
FS.root = mountRoot
|
|
} else if (node) {
|
|
node.mounted = mount;
|
|
if (node.mount) {
|
|
node.mount.mounts.push(mount)
|
|
}
|
|
}
|
|
return mountRoot
|
|
}),
|
|
unmount: (function(mountpoint) {
|
|
var lookup = FS.lookupPath(mountpoint, {
|
|
follow_mount: false
|
|
});
|
|
if (!FS.isMountpoint(lookup.node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var node = lookup.node;
|
|
var mount = node.mounted;
|
|
var mounts = FS.getMounts(mount);
|
|
Object.keys(FS.nameTable).forEach((function(hash) {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
var next = current.name_next;
|
|
if (mounts.indexOf(current.mount) !== -1) {
|
|
FS.destroyNode(current)
|
|
}
|
|
current = next
|
|
}
|
|
}));
|
|
node.mounted = null;
|
|
var idx = node.mount.mounts.indexOf(mount);
|
|
assert(idx !== -1);
|
|
node.mount.mounts.splice(idx, 1)
|
|
}),
|
|
lookup: (function(parent, name) {
|
|
return parent.node_ops.lookup(parent, name)
|
|
}),
|
|
mknod: (function(path, mode, dev) {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
if (!name || name === "." || name === "..") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var err = FS.mayCreate(parent, name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.mknod) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
return parent.node_ops.mknod(parent, name, mode, dev)
|
|
}),
|
|
create: (function(path, mode) {
|
|
mode = mode !== undefined ? mode : 438;
|
|
mode &= 4095;
|
|
mode |= 32768;
|
|
return FS.mknod(path, mode, 0)
|
|
}),
|
|
mkdir: (function(path, mode) {
|
|
mode = mode !== undefined ? mode : 511;
|
|
mode &= 511 | 512;
|
|
mode |= 16384;
|
|
return FS.mknod(path, mode, 0)
|
|
}),
|
|
mkdirTree: (function(path, mode) {
|
|
var dirs = path.split("/");
|
|
var d = "";
|
|
for (var i = 0; i < dirs.length; ++i) {
|
|
if (!dirs[i]) continue;
|
|
d += "/" + dirs[i];
|
|
try {
|
|
FS.mkdir(d, mode)
|
|
} catch (e) {
|
|
if (e.errno != ERRNO_CODES.EEXIST) throw e
|
|
}
|
|
}
|
|
}),
|
|
mkdev: (function(path, mode, dev) {
|
|
if (typeof dev === "undefined") {
|
|
dev = mode;
|
|
mode = 438
|
|
}
|
|
mode |= 8192;
|
|
return FS.mknod(path, mode, dev)
|
|
}),
|
|
symlink: (function(oldpath, newpath) {
|
|
if (!PATH.resolve(oldpath)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
var lookup = FS.lookupPath(newpath, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
var newname = PATH.basename(newpath);
|
|
var err = FS.mayCreate(parent, newname);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.symlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
return parent.node_ops.symlink(parent, newname, oldpath)
|
|
}),
|
|
rename: (function(old_path, new_path) {
|
|
var old_dirname = PATH.dirname(old_path);
|
|
var new_dirname = PATH.dirname(new_path);
|
|
var old_name = PATH.basename(old_path);
|
|
var new_name = PATH.basename(new_path);
|
|
var lookup, old_dir, new_dir;
|
|
try {
|
|
lookup = FS.lookupPath(old_path, {
|
|
parent: true
|
|
});
|
|
old_dir = lookup.node;
|
|
lookup = FS.lookupPath(new_path, {
|
|
parent: true
|
|
});
|
|
new_dir = lookup.node
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
if (old_dir.mount !== new_dir.mount) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EXDEV)
|
|
}
|
|
var old_node = FS.lookupNode(old_dir, old_name);
|
|
var relative = PATH.relative(old_path, new_dirname);
|
|
if (relative.charAt(0) !== ".") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
relative = PATH.relative(new_path, old_dirname);
|
|
if (relative.charAt(0) !== ".") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY)
|
|
}
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name)
|
|
} catch (e) {}
|
|
if (old_node === new_node) {
|
|
return
|
|
}
|
|
var isdir = FS.isDir(old_node.mode);
|
|
var err = FS.mayDelete(old_dir, old_name, isdir);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
err = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!old_dir.node_ops.rename) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
if (new_dir !== old_dir) {
|
|
err = FS.nodePermissions(old_dir, "w");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willMovePath"]) {
|
|
FS.trackingDelegate["willMovePath"](old_path, new_path)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message)
|
|
}
|
|
FS.hashRemoveNode(old_node);
|
|
try {
|
|
old_dir.node_ops.rename(old_node, new_dir, new_name)
|
|
} catch (e) {
|
|
throw e
|
|
} finally {
|
|
FS.hashAddNode(old_node)
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["onMovePath"]) FS.trackingDelegate["onMovePath"](old_path, new_path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onMovePath']('" + old_path + "', '" + new_path + "') threw an exception: " + e.message)
|
|
}
|
|
}),
|
|
rmdir: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, true);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.rmdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willDeletePath"]) {
|
|
FS.trackingDelegate["willDeletePath"](path)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
parent.node_ops.rmdir(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
}),
|
|
readdir: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
var node = lookup.node;
|
|
if (!node.node_ops.readdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
return node.node_ops.readdir(node)
|
|
}),
|
|
unlink: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, false);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
if (!parent.node_ops.unlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY)
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["willDeletePath"]) {
|
|
FS.trackingDelegate["willDeletePath"](path)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
parent.node_ops.unlink(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate["onDeletePath"]) FS.trackingDelegate["onDeletePath"](path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
}),
|
|
readlink: (function(path) {
|
|
var lookup = FS.lookupPath(path);
|
|
var link = lookup.node;
|
|
if (!link) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (!link.node_ops.readlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link))
|
|
}),
|
|
stat: (function(path, dontFollow) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontFollow
|
|
});
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (!node.node_ops.getattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
return node.node_ops.getattr(node)
|
|
}),
|
|
lstat: (function(path) {
|
|
return FS.stat(path, true)
|
|
}),
|
|
chmod: (function(path, mode, dontFollow) {
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontFollow
|
|
});
|
|
node = lookup.node
|
|
} else {
|
|
node = path
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
mode: mode & 4095 | node.mode & ~4095,
|
|
timestamp: Date.now()
|
|
})
|
|
}),
|
|
lchmod: (function(path, mode) {
|
|
FS.chmod(path, mode, true)
|
|
}),
|
|
fchmod: (function(fd, mode) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
FS.chmod(stream.node, mode)
|
|
}),
|
|
chown: (function(path, uid, gid, dontFollow) {
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontFollow
|
|
});
|
|
node = lookup.node
|
|
} else {
|
|
node = path
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Date.now()
|
|
})
|
|
}),
|
|
lchown: (function(path, uid, gid) {
|
|
FS.chown(path, uid, gid, true)
|
|
}),
|
|
fchown: (function(fd, uid, gid) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
FS.chown(stream.node, uid, gid)
|
|
}),
|
|
truncate: (function(path, len) {
|
|
if (len < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var node;
|
|
if (typeof path === "string") {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
node = lookup.node
|
|
} else {
|
|
node = path
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM)
|
|
}
|
|
if (FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR)
|
|
}
|
|
if (!FS.isFile(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var err = FS.nodePermissions(node, "w");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
size: len,
|
|
timestamp: Date.now()
|
|
})
|
|
}),
|
|
ftruncate: (function(fd, len) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
FS.truncate(stream.node, len)
|
|
}),
|
|
utime: (function(path, atime, mtime) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
var node = lookup.node;
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Math.max(atime, mtime)
|
|
})
|
|
}),
|
|
open: (function(path, flags, mode, fd_start, fd_end) {
|
|
if (path === "") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
flags = typeof flags === "string" ? FS.modeStringToFlags(flags) : flags;
|
|
mode = typeof mode === "undefined" ? 438 : mode;
|
|
if (flags & 64) {
|
|
mode = mode & 4095 | 32768
|
|
} else {
|
|
mode = 0
|
|
}
|
|
var node;
|
|
if (typeof path === "object") {
|
|
node = path
|
|
} else {
|
|
path = PATH.normalize(path);
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !(flags & 131072)
|
|
});
|
|
node = lookup.node
|
|
} catch (e) {}
|
|
}
|
|
var created = false;
|
|
if (flags & 64) {
|
|
if (node) {
|
|
if (flags & 128) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EEXIST)
|
|
}
|
|
} else {
|
|
node = FS.mknod(path, mode, 0);
|
|
created = true
|
|
}
|
|
}
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (FS.isChrdev(node.mode)) {
|
|
flags &= ~512
|
|
}
|
|
if (flags & 65536 && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
if (!created) {
|
|
var err = FS.mayOpen(node, flags);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
}
|
|
if (flags & 512) {
|
|
FS.truncate(node, 0)
|
|
}
|
|
flags &= ~(128 | 512);
|
|
var stream = FS.createStream({
|
|
node: node,
|
|
path: FS.getPath(node),
|
|
flags: flags,
|
|
seekable: true,
|
|
position: 0,
|
|
stream_ops: node.stream_ops,
|
|
ungotten: [],
|
|
error: false
|
|
}, fd_start, fd_end);
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream)
|
|
}
|
|
if (Module["logReadFiles"] && !(flags & 1)) {
|
|
if (!FS.readFiles) FS.readFiles = {};
|
|
if (!(path in FS.readFiles)) {
|
|
FS.readFiles[path] = 1;
|
|
Module["printErr"]("read file: " + path)
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate["onOpenFile"]) {
|
|
var trackingFlags = 0;
|
|
if ((flags & 2097155) !== 1) {
|
|
trackingFlags |= FS.tracking.openFlags.READ
|
|
}
|
|
if ((flags & 2097155) !== 0) {
|
|
trackingFlags |= FS.tracking.openFlags.WRITE
|
|
}
|
|
FS.trackingDelegate["onOpenFile"](path, trackingFlags)
|
|
}
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onOpenFile']('" + path + "', flags) threw an exception: " + e.message)
|
|
}
|
|
return stream
|
|
}),
|
|
close: (function(stream) {
|
|
if (stream.getdents) stream.getdents = null;
|
|
try {
|
|
if (stream.stream_ops.close) {
|
|
stream.stream_ops.close(stream)
|
|
}
|
|
} catch (e) {
|
|
throw e
|
|
} finally {
|
|
FS.closeStream(stream.fd)
|
|
}
|
|
}),
|
|
llseek: (function(stream, offset, whence) {
|
|
if (!stream.seekable || !stream.stream_ops.llseek) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
}
|
|
stream.position = stream.stream_ops.llseek(stream, offset, whence);
|
|
stream.ungotten = [];
|
|
return stream.position
|
|
}),
|
|
read: (function(stream, buffer, offset, length, position) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR)
|
|
}
|
|
if (!stream.stream_ops.read) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
var seeking = true;
|
|
if (typeof position === "undefined") {
|
|
position = stream.position;
|
|
seeking = false
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
}
|
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
|
|
if (!seeking) stream.position += bytesRead;
|
|
return bytesRead
|
|
}),
|
|
write: (function(stream, buffer, offset, length, position, canOwn) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR)
|
|
}
|
|
if (!stream.stream_ops.write) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if (stream.flags & 1024) {
|
|
FS.llseek(stream, 0, 2)
|
|
}
|
|
var seeking = true;
|
|
if (typeof position === "undefined") {
|
|
position = stream.position;
|
|
seeking = false
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE)
|
|
}
|
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
|
|
if (!seeking) stream.position += bytesWritten;
|
|
try {
|
|
if (stream.path && FS.trackingDelegate["onWriteToFile"]) FS.trackingDelegate["onWriteToFile"](stream.path)
|
|
} catch (e) {
|
|
console.log("FS.trackingDelegate['onWriteToFile']('" + path + "') threw an exception: " + e.message)
|
|
}
|
|
return bytesWritten
|
|
}),
|
|
allocate: (function(stream, offset, length) {
|
|
if (offset < 0 || length <= 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL)
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF)
|
|
}
|
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
if (!stream.stream_ops.allocate) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP)
|
|
}
|
|
stream.stream_ops.allocate(stream, offset, length)
|
|
}),
|
|
mmap: (function(stream, buffer, offset, length, position, prot, flags) {
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EACCES)
|
|
}
|
|
if (!stream.stream_ops.mmap) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV)
|
|
}
|
|
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags)
|
|
}),
|
|
msync: (function(stream, buffer, offset, length, mmapFlags) {
|
|
if (!stream || !stream.stream_ops.msync) {
|
|
return 0
|
|
}
|
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags)
|
|
}),
|
|
munmap: (function(stream) {
|
|
return 0
|
|
}),
|
|
ioctl: (function(stream, cmd, arg) {
|
|
if (!stream.stream_ops.ioctl) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY)
|
|
}
|
|
return stream.stream_ops.ioctl(stream, cmd, arg)
|
|
}),
|
|
readFile: (function(path, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || "r";
|
|
opts.encoding = opts.encoding || "binary";
|
|
if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"')
|
|
}
|
|
var ret;
|
|
var stream = FS.open(path, opts.flags);
|
|
var stat = FS.stat(path);
|
|
var length = stat.size;
|
|
var buf = new Uint8Array(length);
|
|
FS.read(stream, buf, 0, length, 0);
|
|
if (opts.encoding === "utf8") {
|
|
ret = UTF8ArrayToString(buf, 0)
|
|
} else if (opts.encoding === "binary") {
|
|
ret = buf
|
|
}
|
|
FS.close(stream);
|
|
return ret
|
|
}),
|
|
writeFile: (function(path, data, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || "w";
|
|
opts.encoding = opts.encoding || "utf8";
|
|
if (opts.encoding !== "utf8" && opts.encoding !== "binary") {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"')
|
|
}
|
|
var stream = FS.open(path, opts.flags, opts.mode);
|
|
if (opts.encoding === "utf8") {
|
|
var buf = new Uint8Array(lengthBytesUTF8(data) + 1);
|
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
|
|
FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn)
|
|
} else if (opts.encoding === "binary") {
|
|
FS.write(stream, data, 0, data.length, 0, opts.canOwn)
|
|
}
|
|
FS.close(stream)
|
|
}),
|
|
cwd: (function() {
|
|
return FS.currentPath
|
|
}),
|
|
chdir: (function(path) {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
if (lookup.node === null) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT)
|
|
}
|
|
if (!FS.isDir(lookup.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR)
|
|
}
|
|
var err = FS.nodePermissions(lookup.node, "x");
|
|
if (err) {
|
|
throw new FS.ErrnoError(err)
|
|
}
|
|
FS.currentPath = lookup.path
|
|
}),
|
|
createDefaultDirectories: (function() {
|
|
FS.mkdir("/tmp");
|
|
FS.mkdir("/home");
|
|
FS.mkdir("/home/web_user")
|
|
}),
|
|
createDefaultDevices: (function() {
|
|
FS.mkdir("/dev");
|
|
FS.registerDevice(FS.makedev(1, 3), {
|
|
read: (function() {
|
|
return 0
|
|
}),
|
|
write: (function(stream, buffer, offset, length, pos) {
|
|
return length
|
|
})
|
|
});
|
|
FS.mkdev("/dev/null", FS.makedev(1, 3));
|
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
|
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
|
|
FS.mkdev("/dev/tty", FS.makedev(5, 0));
|
|
FS.mkdev("/dev/tty1", FS.makedev(6, 0));
|
|
var random_device;
|
|
if (typeof crypto !== "undefined") {
|
|
var randomBuffer = new Uint8Array(1);
|
|
random_device = (function() {
|
|
crypto.getRandomValues(randomBuffer);
|
|
return randomBuffer[0]
|
|
})
|
|
} else if (ENVIRONMENT_IS_NODE) {
|
|
random_device = (function() {
|
|
return require("crypto").randomBytes(1)[0]
|
|
})
|
|
} else {
|
|
random_device = (function() {
|
|
return Math.random() * 256 | 0
|
|
})
|
|
}
|
|
FS.createDevice("/dev", "random", random_device);
|
|
FS.createDevice("/dev", "urandom", random_device);
|
|
FS.mkdir("/dev/shm");
|
|
FS.mkdir("/dev/shm/tmp")
|
|
}),
|
|
createSpecialDirectories: (function() {
|
|
FS.mkdir("/proc");
|
|
FS.mkdir("/proc/self");
|
|
FS.mkdir("/proc/self/fd");
|
|
FS.mount({
|
|
mount: (function() {
|
|
var node = FS.createNode("/proc/self", "fd", 16384 | 511, 73);
|
|
node.node_ops = {
|
|
lookup: (function(parent, name) {
|
|
var fd = +name;
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var ret = {
|
|
parent: null,
|
|
mount: {
|
|
mountpoint: "fake"
|
|
},
|
|
node_ops: {
|
|
readlink: (function() {
|
|
return stream.path
|
|
})
|
|
}
|
|
};
|
|
ret.parent = ret;
|
|
return ret
|
|
})
|
|
};
|
|
return node
|
|
})
|
|
}, {}, "/proc/self/fd")
|
|
}),
|
|
createStandardStreams: (function() {
|
|
if (Module["stdin"]) {
|
|
FS.createDevice("/dev", "stdin", Module["stdin"])
|
|
} else {
|
|
FS.symlink("/dev/tty", "/dev/stdin")
|
|
}
|
|
if (Module["stdout"]) {
|
|
FS.createDevice("/dev", "stdout", null, Module["stdout"])
|
|
} else {
|
|
FS.symlink("/dev/tty", "/dev/stdout")
|
|
}
|
|
if (Module["stderr"]) {
|
|
FS.createDevice("/dev", "stderr", null, Module["stderr"])
|
|
} else {
|
|
FS.symlink("/dev/tty1", "/dev/stderr")
|
|
}
|
|
var stdin = FS.open("/dev/stdin", "r");
|
|
assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")");
|
|
var stdout = FS.open("/dev/stdout", "w");
|
|
assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")");
|
|
var stderr = FS.open("/dev/stderr", "w");
|
|
assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")")
|
|
}),
|
|
ensureErrnoError: (function() {
|
|
if (FS.ErrnoError) return;
|
|
FS.ErrnoError = function ErrnoError(errno, node) {
|
|
this.node = node;
|
|
this.setErrno = (function(errno) {
|
|
this.errno = errno;
|
|
for (var key in ERRNO_CODES) {
|
|
if (ERRNO_CODES[key] === errno) {
|
|
this.code = key;
|
|
break
|
|
}
|
|
}
|
|
});
|
|
this.setErrno(errno);
|
|
this.message = ERRNO_MESSAGES[errno]
|
|
};
|
|
FS.ErrnoError.prototype = new Error;
|
|
FS.ErrnoError.prototype.constructor = FS.ErrnoError;
|
|
[ERRNO_CODES.ENOENT].forEach((function(code) {
|
|
FS.genericErrors[code] = new FS.ErrnoError(code);
|
|
FS.genericErrors[code].stack = "<generic error, no stack>"
|
|
}))
|
|
}),
|
|
staticInit: (function() {
|
|
FS.ensureErrnoError();
|
|
FS.nameTable = new Array(4096);
|
|
FS.mount(MEMFS, {}, "/");
|
|
FS.createDefaultDirectories();
|
|
FS.createDefaultDevices();
|
|
FS.createSpecialDirectories();
|
|
FS.filesystems = {
|
|
"MEMFS": MEMFS,
|
|
"IDBFS": IDBFS,
|
|
"NODEFS": NODEFS,
|
|
"WORKERFS": WORKERFS
|
|
}
|
|
}),
|
|
init: (function(input, output, error) {
|
|
assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)");
|
|
FS.init.initialized = true;
|
|
FS.ensureErrnoError();
|
|
Module["stdin"] = input || Module["stdin"];
|
|
Module["stdout"] = output || Module["stdout"];
|
|
Module["stderr"] = error || Module["stderr"];
|
|
FS.createStandardStreams()
|
|
}),
|
|
quit: (function() {
|
|
FS.init.initialized = false;
|
|
var fflush = Module["_fflush"];
|
|
if (fflush) fflush(0);
|
|
for (var i = 0; i < FS.streams.length; i++) {
|
|
var stream = FS.streams[i];
|
|
if (!stream) {
|
|
continue
|
|
}
|
|
FS.close(stream)
|
|
}
|
|
}),
|
|
getMode: (function(canRead, canWrite) {
|
|
var mode = 0;
|
|
if (canRead) mode |= 292 | 73;
|
|
if (canWrite) mode |= 146;
|
|
return mode
|
|
}),
|
|
joinPath: (function(parts, forceRelative) {
|
|
var path = PATH.join.apply(null, parts);
|
|
if (forceRelative && path[0] == "/") path = path.substr(1);
|
|
return path
|
|
}),
|
|
absolutePath: (function(relative, base) {
|
|
return PATH.resolve(base, relative)
|
|
}),
|
|
standardizePath: (function(path) {
|
|
return PATH.normalize(path)
|
|
}),
|
|
findObject: (function(path, dontResolveLastLink) {
|
|
var ret = FS.analyzePath(path, dontResolveLastLink);
|
|
if (ret.exists) {
|
|
return ret.object
|
|
} else {
|
|
___setErrNo(ret.error);
|
|
return null
|
|
}
|
|
}),
|
|
analyzePath: (function(path, dontResolveLastLink) {
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !dontResolveLastLink
|
|
});
|
|
path = lookup.path
|
|
} catch (e) {}
|
|
var ret = {
|
|
isRoot: false,
|
|
exists: false,
|
|
error: 0,
|
|
name: null,
|
|
path: null,
|
|
object: null,
|
|
parentExists: false,
|
|
parentPath: null,
|
|
parentObject: null
|
|
};
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
parent: true
|
|
});
|
|
ret.parentExists = true;
|
|
ret.parentPath = lookup.path;
|
|
ret.parentObject = lookup.node;
|
|
ret.name = PATH.basename(path);
|
|
lookup = FS.lookupPath(path, {
|
|
follow: !dontResolveLastLink
|
|
});
|
|
ret.exists = true;
|
|
ret.path = lookup.path;
|
|
ret.object = lookup.node;
|
|
ret.name = lookup.node.name;
|
|
ret.isRoot = lookup.path === "/"
|
|
} catch (e) {
|
|
ret.error = e.errno
|
|
}
|
|
return ret
|
|
}),
|
|
createFolder: (function(parent, name, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.mkdir(path, mode)
|
|
}),
|
|
createPath: (function(parent, path, canRead, canWrite) {
|
|
parent = typeof parent === "string" ? parent : FS.getPath(parent);
|
|
var parts = path.split("/").reverse();
|
|
while (parts.length) {
|
|
var part = parts.pop();
|
|
if (!part) continue;
|
|
var current = PATH.join2(parent, part);
|
|
try {
|
|
FS.mkdir(current)
|
|
} catch (e) {}
|
|
parent = current
|
|
}
|
|
return current
|
|
}),
|
|
createFile: (function(parent, name, properties, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.create(path, mode)
|
|
}),
|
|
createDataFile: (function(parent, name, data, canRead, canWrite, canOwn) {
|
|
var path = name ? PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name) : parent;
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
var node = FS.create(path, mode);
|
|
if (data) {
|
|
if (typeof data === "string") {
|
|
var arr = new Array(data.length);
|
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
|
|
data = arr
|
|
}
|
|
FS.chmod(node, mode | 146);
|
|
var stream = FS.open(node, "w");
|
|
FS.write(stream, data, 0, data.length, 0, canOwn);
|
|
FS.close(stream);
|
|
FS.chmod(node, mode)
|
|
}
|
|
return node
|
|
}),
|
|
createDevice: (function(parent, name, input, output) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(!!input, !!output);
|
|
if (!FS.createDevice.major) FS.createDevice.major = 64;
|
|
var dev = FS.makedev(FS.createDevice.major++, 0);
|
|
FS.registerDevice(dev, {
|
|
open: (function(stream) {
|
|
stream.seekable = false
|
|
}),
|
|
close: (function(stream) {
|
|
if (output && output.buffer && output.buffer.length) {
|
|
output(10)
|
|
}
|
|
}),
|
|
read: (function(stream, buffer, offset, length, pos) {
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = input()
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN)
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset + i] = result
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return bytesRead
|
|
}),
|
|
write: (function(stream, buffer, offset, length, pos) {
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
output(buffer[offset + i])
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now()
|
|
}
|
|
return i
|
|
})
|
|
});
|
|
return FS.mkdev(path, mode, dev)
|
|
}),
|
|
createLink: (function(parent, name, target, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === "string" ? parent : FS.getPath(parent), name);
|
|
return FS.symlink(target, path)
|
|
}),
|
|
forceLoadFile: (function(obj) {
|
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
|
|
var success = true;
|
|
if (typeof XMLHttpRequest !== "undefined") {
|
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.")
|
|
} else if (Module["read"]) {
|
|
try {
|
|
obj.contents = intArrayFromString(Module["read"](obj.url), true);
|
|
obj.usedBytes = obj.contents.length
|
|
} catch (e) {
|
|
success = false
|
|
}
|
|
} else {
|
|
throw new Error("Cannot load without read() or XMLHttpRequest.")
|
|
}
|
|
if (!success) ___setErrNo(ERRNO_CODES.EIO);
|
|
return success
|
|
}),
|
|
createLazyFile: (function(parent, name, url, canRead, canWrite) {
|
|
function LazyUint8Array() {
|
|
this.lengthKnown = false;
|
|
this.chunks = []
|
|
}
|
|
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
|
|
if (idx > this.length - 1 || idx < 0) {
|
|
return undefined
|
|
}
|
|
var chunkOffset = idx % this.chunkSize;
|
|
var chunkNum = idx / this.chunkSize | 0;
|
|
return this.getter(chunkNum)[chunkOffset]
|
|
};
|
|
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
|
|
this.getter = getter
|
|
};
|
|
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("HEAD", url, false);
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
var datalength = Number(xhr.getResponseHeader("Content-length"));
|
|
var header;
|
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
|
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
|
|
var chunkSize = 1024 * 1024;
|
|
if (!hasByteServing) chunkSize = datalength;
|
|
var doXHR = (function(from, to) {
|
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
|
|
if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!");
|
|
var xhr = new XMLHttpRequest;
|
|
xhr.open("GET", url, false);
|
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
|
|
if (typeof Uint8Array != "undefined") xhr.responseType = "arraybuffer";
|
|
if (xhr.overrideMimeType) {
|
|
xhr.overrideMimeType("text/plain; charset=x-user-defined")
|
|
}
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
if (xhr.response !== undefined) {
|
|
return new Uint8Array(xhr.response || [])
|
|
} else {
|
|
return intArrayFromString(xhr.responseText || "", true)
|
|
}
|
|
});
|
|
var lazyArray = this;
|
|
lazyArray.setDataGetter((function(chunkNum) {
|
|
var start = chunkNum * chunkSize;
|
|
var end = (chunkNum + 1) * chunkSize - 1;
|
|
end = Math.min(end, datalength - 1);
|
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") {
|
|
lazyArray.chunks[chunkNum] = doXHR(start, end)
|
|
}
|
|
if (typeof lazyArray.chunks[chunkNum] === "undefined") throw new Error("doXHR failed!");
|
|
return lazyArray.chunks[chunkNum]
|
|
}));
|
|
if (usesGzip || !datalength) {
|
|
chunkSize = datalength = 1;
|
|
datalength = this.getter(0).length;
|
|
chunkSize = datalength;
|
|
console.log("LazyFiles on gzip forces download of the whole file when length is accessed")
|
|
}
|
|
this._length = datalength;
|
|
this._chunkSize = chunkSize;
|
|
this.lengthKnown = true
|
|
};
|
|
if (typeof XMLHttpRequest !== "undefined") {
|
|
if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";
|
|
var lazyArray = new LazyUint8Array;
|
|
Object.defineProperties(lazyArray, {
|
|
length: {
|
|
get: (function() {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength()
|
|
}
|
|
return this._length
|
|
})
|
|
},
|
|
chunkSize: {
|
|
get: (function() {
|
|
if (!this.lengthKnown) {
|
|
this.cacheLength()
|
|
}
|
|
return this._chunkSize
|
|
})
|
|
}
|
|
});
|
|
var properties = {
|
|
isDevice: false,
|
|
contents: lazyArray
|
|
}
|
|
} else {
|
|
var properties = {
|
|
isDevice: false,
|
|
url: url
|
|
}
|
|
}
|
|
var node = FS.createFile(parent, name, properties, canRead, canWrite);
|
|
if (properties.contents) {
|
|
node.contents = properties.contents
|
|
} else if (properties.url) {
|
|
node.contents = null;
|
|
node.url = properties.url
|
|
}
|
|
Object.defineProperties(node, {
|
|
usedBytes: {
|
|
get: (function() {
|
|
return this.contents.length
|
|
})
|
|
}
|
|
});
|
|
var stream_ops = {};
|
|
var keys = Object.keys(node.stream_ops);
|
|
keys.forEach((function(key) {
|
|
var fn = node.stream_ops[key];
|
|
stream_ops[key] = function forceLoadLazyFile() {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
return fn.apply(null, arguments)
|
|
}
|
|
}));
|
|
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO)
|
|
}
|
|
var contents = stream.node.contents;
|
|
if (position >= contents.length) return 0;
|
|
var size = Math.min(contents.length - position, length);
|
|
assert(size >= 0);
|
|
if (contents.slice) {
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents[position + i]
|
|
}
|
|
} else {
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents.get(position + i)
|
|
}
|
|
}
|
|
return size
|
|
};
|
|
node.stream_ops = stream_ops;
|
|
return node
|
|
}),
|
|
createPreloadedFile: (function(parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
|
|
Browser.init();
|
|
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
|
|
var dep = getUniqueRunDependency("cp " + fullname);
|
|
|
|
function processData(byteArray) {
|
|
function finish(byteArray) {
|
|
if (preFinish) preFinish();
|
|
if (!dontCreateFile) {
|
|
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn)
|
|
}
|
|
if (onload) onload();
|
|
removeRunDependency(dep)
|
|
}
|
|
var handled = false;
|
|
Module["preloadPlugins"].forEach((function(plugin) {
|
|
if (handled) return;
|
|
if (plugin["canHandle"](fullname)) {
|
|
plugin["handle"](byteArray, fullname, finish, (function() {
|
|
if (onerror) onerror();
|
|
removeRunDependency(dep)
|
|
}));
|
|
handled = true
|
|
}
|
|
}));
|
|
if (!handled) finish(byteArray)
|
|
}
|
|
addRunDependency(dep);
|
|
if (typeof url == "string") {
|
|
Browser.asyncLoad(url, (function(byteArray) {
|
|
processData(byteArray)
|
|
}), onerror)
|
|
} else {
|
|
processData(url)
|
|
}
|
|
}),
|
|
indexedDB: (function() {
|
|
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB
|
|
}),
|
|
DB_NAME: (function() {
|
|
return "EM_FS_" + window.location.pathname
|
|
}),
|
|
DB_VERSION: 20,
|
|
DB_STORE_NAME: "FILE_DATA",
|
|
saveFilesToDB: (function(paths, onload, onerror) {
|
|
onload = onload || (function() {});
|
|
onerror = onerror || (function() {});
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION)
|
|
} catch (e) {
|
|
return onerror(e)
|
|
}
|
|
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
|
|
console.log("creating db");
|
|
var db = openRequest.result;
|
|
db.createObjectStore(FS.DB_STORE_NAME)
|
|
};
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readwrite");
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0,
|
|
fail = 0,
|
|
total = paths.length;
|
|
|
|
function finish() {
|
|
if (fail == 0) onload();
|
|
else onerror()
|
|
}
|
|
paths.forEach((function(path) {
|
|
var putRequest = files.put(FS.analyzePath(path).object.contents, path);
|
|
putRequest.onsuccess = function putRequest_onsuccess() {
|
|
ok++;
|
|
if (ok + fail == total) finish()
|
|
};
|
|
putRequest.onerror = function putRequest_onerror() {
|
|
fail++;
|
|
if (ok + fail == total) finish()
|
|
}
|
|
}));
|
|
transaction.onerror = onerror
|
|
};
|
|
openRequest.onerror = onerror
|
|
}),
|
|
loadFilesFromDB: (function(paths, onload, onerror) {
|
|
onload = onload || (function() {});
|
|
onerror = onerror || (function() {});
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION)
|
|
} catch (e) {
|
|
return onerror(e)
|
|
}
|
|
openRequest.onupgradeneeded = onerror;
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
try {
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], "readonly")
|
|
} catch (e) {
|
|
onerror(e);
|
|
return
|
|
}
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0,
|
|
fail = 0,
|
|
total = paths.length;
|
|
|
|
function finish() {
|
|
if (fail == 0) onload();
|
|
else onerror()
|
|
}
|
|
paths.forEach((function(path) {
|
|
var getRequest = files.get(path);
|
|
getRequest.onsuccess = function getRequest_onsuccess() {
|
|
if (FS.analyzePath(path).exists) {
|
|
FS.unlink(path)
|
|
}
|
|
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
|
|
ok++;
|
|
if (ok + fail == total) finish()
|
|
};
|
|
getRequest.onerror = function getRequest_onerror() {
|
|
fail++;
|
|
if (ok + fail == total) finish()
|
|
}
|
|
}));
|
|
transaction.onerror = onerror
|
|
};
|
|
openRequest.onerror = onerror
|
|
})
|
|
};
|
|
var SYSCALLS = {
|
|
DEFAULT_POLLMASK: 5,
|
|
mappings: {},
|
|
umask: 511,
|
|
calculateAt: (function(dirfd, path) {
|
|
if (path[0] !== "/") {
|
|
var dir;
|
|
if (dirfd === -100) {
|
|
dir = FS.cwd()
|
|
} else {
|
|
var dirstream = FS.getStream(dirfd);
|
|
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
dir = dirstream.path
|
|
}
|
|
path = PATH.join2(dir, path)
|
|
}
|
|
return path
|
|
}),
|
|
doStat: (function(func, path, buf) {
|
|
try {
|
|
var stat = func(path)
|
|
} catch (e) {
|
|
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
|
|
return -ERRNO_CODES.ENOTDIR
|
|
}
|
|
throw e
|
|
}
|
|
HEAP32[buf >> 2] = stat.dev;
|
|
HEAP32[buf + 4 >> 2] = 0;
|
|
HEAP32[buf + 8 >> 2] = stat.ino;
|
|
HEAP32[buf + 12 >> 2] = stat.mode;
|
|
HEAP32[buf + 16 >> 2] = stat.nlink;
|
|
HEAP32[buf + 20 >> 2] = stat.uid;
|
|
HEAP32[buf + 24 >> 2] = stat.gid;
|
|
HEAP32[buf + 28 >> 2] = stat.rdev;
|
|
HEAP32[buf + 32 >> 2] = 0;
|
|
HEAP32[buf + 36 >> 2] = stat.size;
|
|
HEAP32[buf + 40 >> 2] = 4096;
|
|
HEAP32[buf + 44 >> 2] = stat.blocks;
|
|
HEAP32[buf + 48 >> 2] = stat.atime.getTime() / 1e3 | 0;
|
|
HEAP32[buf + 52 >> 2] = 0;
|
|
HEAP32[buf + 56 >> 2] = stat.mtime.getTime() / 1e3 | 0;
|
|
HEAP32[buf + 60 >> 2] = 0;
|
|
HEAP32[buf + 64 >> 2] = stat.ctime.getTime() / 1e3 | 0;
|
|
HEAP32[buf + 68 >> 2] = 0;
|
|
HEAP32[buf + 72 >> 2] = stat.ino;
|
|
return 0
|
|
}),
|
|
doMsync: (function(addr, stream, len, flags) {
|
|
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
|
|
FS.msync(stream, buffer, 0, len, flags)
|
|
}),
|
|
doMkdir: (function(path, mode) {
|
|
path = PATH.normalize(path);
|
|
if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1);
|
|
FS.mkdir(path, mode, 0);
|
|
return 0
|
|
}),
|
|
doMknod: (function(path, mode, dev) {
|
|
switch (mode & 61440) {
|
|
case 32768:
|
|
case 8192:
|
|
case 24576:
|
|
case 4096:
|
|
case 49152:
|
|
break;
|
|
default:
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
FS.mknod(path, mode, dev);
|
|
return 0
|
|
}),
|
|
doReadlink: (function(path, buf, bufsize) {
|
|
if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
|
|
var ret = FS.readlink(path);
|
|
var len = Math.min(bufsize, lengthBytesUTF8(ret));
|
|
var endChar = HEAP8[buf + len];
|
|
stringToUTF8(ret, buf, bufsize + 1);
|
|
HEAP8[buf + len] = endChar;
|
|
return len
|
|
}),
|
|
doAccess: (function(path, amode) {
|
|
if (amode & ~7) {
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
var node;
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: true
|
|
});
|
|
node = lookup.node;
|
|
var perms = "";
|
|
if (amode & 4) perms += "r";
|
|
if (amode & 2) perms += "w";
|
|
if (amode & 1) perms += "x";
|
|
if (perms && FS.nodePermissions(node, perms)) {
|
|
return -ERRNO_CODES.EACCES
|
|
}
|
|
return 0
|
|
}),
|
|
doDup: (function(path, flags, suggestFD) {
|
|
var suggest = FS.getStream(suggestFD);
|
|
if (suggest) FS.close(suggest);
|
|
return FS.open(path, flags, 0, suggestFD, suggestFD).fd
|
|
}),
|
|
doReadv: (function(stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[iov + i * 8 >> 2];
|
|
var len = HEAP32[iov + (i * 8 + 4) >> 2];
|
|
var curr = FS.read(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (curr < len) break
|
|
}
|
|
return ret
|
|
}),
|
|
doWritev: (function(stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[iov + i * 8 >> 2];
|
|
var len = HEAP32[iov + (i * 8 + 4) >> 2];
|
|
var curr = FS.write(stream, HEAP8, ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr
|
|
}
|
|
return ret
|
|
}),
|
|
varargs: 0,
|
|
get: (function(varargs) {
|
|
SYSCALLS.varargs += 4;
|
|
var ret = HEAP32[SYSCALLS.varargs - 4 >> 2];
|
|
return ret
|
|
}),
|
|
getStr: (function() {
|
|
var ret = Pointer_stringify(SYSCALLS.get());
|
|
return ret
|
|
}),
|
|
getStreamFromFD: (function() {
|
|
var stream = FS.getStream(SYSCALLS.get());
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return stream
|
|
}),
|
|
getSocketFromFD: (function() {
|
|
var socket = SOCKFS.getSocket(SYSCALLS.get());
|
|
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return socket
|
|
}),
|
|
getSocketAddress: (function(allowNull) {
|
|
var addrp = SYSCALLS.get(),
|
|
addrlen = SYSCALLS.get();
|
|
if (allowNull && addrp === 0) return null;
|
|
var info = __read_sockaddr(addrp, addrlen);
|
|
if (info.errno) throw new FS.ErrnoError(info.errno);
|
|
info.addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
return info
|
|
}),
|
|
get64: (function() {
|
|
var low = SYSCALLS.get(),
|
|
high = SYSCALLS.get();
|
|
if (low >= 0) assert(high === 0);
|
|
else assert(high === -1);
|
|
return low
|
|
}),
|
|
getZero: (function() {
|
|
assert(SYSCALLS.get() === 0)
|
|
})
|
|
};
|
|
|
|
function ___syscall91(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var addr = SYSCALLS.get(),
|
|
len = SYSCALLS.get();
|
|
var info = SYSCALLS.mappings[addr];
|
|
if (!info) return 0;
|
|
if (len === info.len) {
|
|
var stream = FS.getStream(info.fd);
|
|
SYSCALLS.doMsync(addr, stream, len, info.flags);
|
|
FS.munmap(stream);
|
|
SYSCALLS.mappings[addr] = null;
|
|
if (info.allocated) {
|
|
_free(info.malloc)
|
|
}
|
|
}
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function _pthread_mutexattr_destroy() {}
|
|
|
|
function ___syscall54(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
op = SYSCALLS.get();
|
|
switch (op) {
|
|
case 21505:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
case 21506:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
case 21519:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
var argp = SYSCALLS.get();
|
|
HEAP32[argp >> 2] = 0;
|
|
return 0
|
|
};
|
|
case 21520:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return -ERRNO_CODES.EINVAL
|
|
};
|
|
case 21531:
|
|
{
|
|
var argp = SYSCALLS.get();
|
|
return FS.ioctl(stream, op, argp)
|
|
};
|
|
case 21523:
|
|
{
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0
|
|
};
|
|
default:
|
|
abort("bad ioctl syscall " + op)
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function __ZN2cv3EMDERKNS_11_InputArrayES2_iS2_PfRKNS_12_OutputArrayE() {
|
|
Module["printErr"]("missing function: _ZN2cv3EMDERKNS_11_InputArrayES2_iS2_PfRKNS_12_OutputArrayE");
|
|
abort(-1)
|
|
}
|
|
|
|
function upcastPointer(ptr, ptrClass, desiredClass) {
|
|
while (ptrClass !== desiredClass) {
|
|
if (!ptrClass.upcast) {
|
|
throwBindingError("Expected null or instance of " + desiredClass.name + ", got an instance of " + ptrClass.name)
|
|
}
|
|
ptr = ptrClass.upcast(ptr);
|
|
ptrClass = ptrClass.baseClass
|
|
}
|
|
return ptr
|
|
}
|
|
|
|
function constNoSmartPtrRawPointerToWireType(destructors, handle) {
|
|
if (handle === null) {
|
|
if (this.isReference) {
|
|
throwBindingError("null is not a valid " + this.name)
|
|
}
|
|
return 0
|
|
}
|
|
if (!handle.$$) {
|
|
throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name)
|
|
}
|
|
if (!handle.$$.ptr) {
|
|
throwBindingError("Cannot pass deleted object as a pointer of type " + this.name)
|
|
}
|
|
var handleClass = handle.$$.ptrType.registeredClass;
|
|
var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
|
|
return ptr
|
|
}
|
|
|
|
function genericPointerToWireType(destructors, handle) {
|
|
if (handle === null) {
|
|
if (this.isReference) {
|
|
throwBindingError("null is not a valid " + this.name)
|
|
}
|
|
if (this.isSmartPointer) {
|
|
var ptr = this.rawConstructor();
|
|
if (destructors !== null) {
|
|
destructors.push(this.rawDestructor, ptr)
|
|
}
|
|
return ptr
|
|
} else {
|
|
return 0
|
|
}
|
|
}
|
|
if (!handle.$$) {
|
|
throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name)
|
|
}
|
|
if (!handle.$$.ptr) {
|
|
throwBindingError("Cannot pass deleted object as a pointer of type " + this.name)
|
|
}
|
|
if (!this.isConst && handle.$$.ptrType.isConst) {
|
|
throwBindingError("Cannot convert argument of type " + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + " to parameter type " + this.name)
|
|
}
|
|
var handleClass = handle.$$.ptrType.registeredClass;
|
|
var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
|
|
if (this.isSmartPointer) {
|
|
if (undefined === handle.$$.smartPtr) {
|
|
throwBindingError("Passing raw pointer to smart pointer is illegal")
|
|
}
|
|
switch (this.sharingPolicy) {
|
|
case 0:
|
|
if (handle.$$.smartPtrType === this) {
|
|
ptr = handle.$$.smartPtr
|
|
} else {
|
|
throwBindingError("Cannot convert argument of type " + (handle.$$.smartPtrType ? handle.$$.smartPtrType.name : handle.$$.ptrType.name) + " to parameter type " + this.name)
|
|
}
|
|
break;
|
|
case 1:
|
|
ptr = handle.$$.smartPtr;
|
|
break;
|
|
case 2:
|
|
if (handle.$$.smartPtrType === this) {
|
|
ptr = handle.$$.smartPtr
|
|
} else {
|
|
var clonedHandle = handle["clone"]();
|
|
ptr = this.rawShare(ptr, __emval_register((function() {
|
|
clonedHandle["delete"]()
|
|
})));
|
|
if (destructors !== null) {
|
|
destructors.push(this.rawDestructor, ptr)
|
|
}
|
|
}
|
|
break;
|
|
default:
|
|
throwBindingError("Unsupporting sharing policy")
|
|
}
|
|
}
|
|
return ptr
|
|
}
|
|
|
|
function nonConstNoSmartPtrRawPointerToWireType(destructors, handle) {
|
|
if (handle === null) {
|
|
if (this.isReference) {
|
|
throwBindingError("null is not a valid " + this.name)
|
|
}
|
|
return 0
|
|
}
|
|
if (!handle.$$) {
|
|
throwBindingError('Cannot pass "' + _embind_repr(handle) + '" as a ' + this.name)
|
|
}
|
|
if (!handle.$$.ptr) {
|
|
throwBindingError("Cannot pass deleted object as a pointer of type " + this.name)
|
|
}
|
|
if (handle.$$.ptrType.isConst) {
|
|
throwBindingError("Cannot convert argument of type " + handle.$$.ptrType.name + " to parameter type " + this.name)
|
|
}
|
|
var handleClass = handle.$$.ptrType.registeredClass;
|
|
var ptr = upcastPointer(handle.$$.ptr, handleClass, this.registeredClass);
|
|
return ptr
|
|
}
|
|
|
|
function RegisteredPointer_getPointee(ptr) {
|
|
if (this.rawGetPointee) {
|
|
ptr = this.rawGetPointee(ptr)
|
|
}
|
|
return ptr
|
|
}
|
|
|
|
function RegisteredPointer_destructor(ptr) {
|
|
if (this.rawDestructor) {
|
|
this.rawDestructor(ptr)
|
|
}
|
|
}
|
|
|
|
function RegisteredPointer_deleteObject(handle) {
|
|
if (handle !== null) {
|
|
handle["delete"]()
|
|
}
|
|
}
|
|
|
|
function downcastPointer(ptr, ptrClass, desiredClass) {
|
|
if (ptrClass === desiredClass) {
|
|
return ptr
|
|
}
|
|
if (undefined === desiredClass.baseClass) {
|
|
return null
|
|
}
|
|
var rv = downcastPointer(ptr, ptrClass, desiredClass.baseClass);
|
|
if (rv === null) {
|
|
return null
|
|
}
|
|
return desiredClass.downcast(rv)
|
|
}
|
|
var registeredPointers = {};
|
|
|
|
function getInheritedInstanceCount() {
|
|
return Object.keys(registeredInstances).length
|
|
}
|
|
|
|
function getLiveInheritedInstances() {
|
|
var rv = [];
|
|
for (var k in registeredInstances) {
|
|
if (registeredInstances.hasOwnProperty(k)) {
|
|
rv.push(registeredInstances[k])
|
|
}
|
|
}
|
|
return rv
|
|
}
|
|
var deletionQueue = [];
|
|
|
|
function flushPendingDeletes() {
|
|
while (deletionQueue.length) {
|
|
var obj = deletionQueue.pop();
|
|
obj.$$.deleteScheduled = false;
|
|
obj["delete"]()
|
|
}
|
|
}
|
|
var delayFunction = undefined;
|
|
|
|
function setDelayFunction(fn) {
|
|
delayFunction = fn;
|
|
if (deletionQueue.length && delayFunction) {
|
|
delayFunction(flushPendingDeletes)
|
|
}
|
|
}
|
|
|
|
function init_embind() {
|
|
Module["getInheritedInstanceCount"] = getInheritedInstanceCount;
|
|
Module["getLiveInheritedInstances"] = getLiveInheritedInstances;
|
|
Module["flushPendingDeletes"] = flushPendingDeletes;
|
|
Module["setDelayFunction"] = setDelayFunction
|
|
}
|
|
var registeredInstances = {};
|
|
|
|
function getBasestPointer(class_, ptr) {
|
|
if (ptr === undefined) {
|
|
throwBindingError("ptr should not be undefined")
|
|
}
|
|
while (class_.baseClass) {
|
|
ptr = class_.upcast(ptr);
|
|
class_ = class_.baseClass
|
|
}
|
|
return ptr
|
|
}
|
|
|
|
function getInheritedInstance(class_, ptr) {
|
|
ptr = getBasestPointer(class_, ptr);
|
|
return registeredInstances[ptr]
|
|
}
|
|
|
|
function makeClassHandle(prototype, record) {
|
|
if (!record.ptrType || !record.ptr) {
|
|
throwInternalError("makeClassHandle requires ptr and ptrType")
|
|
}
|
|
var hasSmartPtrType = !!record.smartPtrType;
|
|
var hasSmartPtr = !!record.smartPtr;
|
|
if (hasSmartPtrType !== hasSmartPtr) {
|
|
throwInternalError("Both smartPtrType and smartPtr must be specified")
|
|
}
|
|
record.count = {
|
|
value: 1
|
|
};
|
|
return Object.create(prototype, {
|
|
$$: {
|
|
value: record
|
|
}
|
|
})
|
|
}
|
|
|
|
function RegisteredPointer_fromWireType(ptr) {
|
|
var rawPointer = this.getPointee(ptr);
|
|
if (!rawPointer) {
|
|
this.destructor(ptr);
|
|
return null
|
|
}
|
|
var registeredInstance = getInheritedInstance(this.registeredClass, rawPointer);
|
|
if (undefined !== registeredInstance) {
|
|
if (0 === registeredInstance.$$.count.value) {
|
|
registeredInstance.$$.ptr = rawPointer;
|
|
registeredInstance.$$.smartPtr = ptr;
|
|
return registeredInstance["clone"]()
|
|
} else {
|
|
var rv = registeredInstance["clone"]();
|
|
this.destructor(ptr);
|
|
return rv
|
|
}
|
|
}
|
|
|
|
function makeDefaultHandle() {
|
|
if (this.isSmartPointer) {
|
|
return makeClassHandle(this.registeredClass.instancePrototype, {
|
|
ptrType: this.pointeeType,
|
|
ptr: rawPointer,
|
|
smartPtrType: this,
|
|
smartPtr: ptr
|
|
})
|
|
} else {
|
|
return makeClassHandle(this.registeredClass.instancePrototype, {
|
|
ptrType: this,
|
|
ptr: ptr
|
|
})
|
|
}
|
|
}
|
|
var actualType = this.registeredClass.getActualType(rawPointer);
|
|
var registeredPointerRecord = registeredPointers[actualType];
|
|
if (!registeredPointerRecord) {
|
|
return makeDefaultHandle.call(this)
|
|
}
|
|
var toType;
|
|
if (this.isConst) {
|
|
toType = registeredPointerRecord.constPointerType
|
|
} else {
|
|
toType = registeredPointerRecord.pointerType
|
|
}
|
|
var dp = downcastPointer(rawPointer, this.registeredClass, toType.registeredClass);
|
|
if (dp === null) {
|
|
return makeDefaultHandle.call(this)
|
|
}
|
|
if (this.isSmartPointer) {
|
|
return makeClassHandle(toType.registeredClass.instancePrototype, {
|
|
ptrType: toType,
|
|
ptr: dp,
|
|
smartPtrType: this,
|
|
smartPtr: ptr
|
|
})
|
|
} else {
|
|
return makeClassHandle(toType.registeredClass.instancePrototype, {
|
|
ptrType: toType,
|
|
ptr: dp
|
|
})
|
|
}
|
|
}
|
|
|
|
function init_RegisteredPointer() {
|
|
RegisteredPointer.prototype.getPointee = RegisteredPointer_getPointee;
|
|
RegisteredPointer.prototype.destructor = RegisteredPointer_destructor;
|
|
RegisteredPointer.prototype["argPackAdvance"] = 8;
|
|
RegisteredPointer.prototype["readValueFromPointer"] = simpleReadValueFromPointer;
|
|
RegisteredPointer.prototype["deleteObject"] = RegisteredPointer_deleteObject;
|
|
RegisteredPointer.prototype["fromWireType"] = RegisteredPointer_fromWireType
|
|
}
|
|
|
|
function RegisteredPointer(name, registeredClass, isReference, isConst, isSmartPointer, pointeeType, sharingPolicy, rawGetPointee, rawConstructor, rawShare, rawDestructor) {
|
|
this.name = name;
|
|
this.registeredClass = registeredClass;
|
|
this.isReference = isReference;
|
|
this.isConst = isConst;
|
|
this.isSmartPointer = isSmartPointer;
|
|
this.pointeeType = pointeeType;
|
|
this.sharingPolicy = sharingPolicy;
|
|
this.rawGetPointee = rawGetPointee;
|
|
this.rawConstructor = rawConstructor;
|
|
this.rawShare = rawShare;
|
|
this.rawDestructor = rawDestructor;
|
|
if (!isSmartPointer && registeredClass.baseClass === undefined) {
|
|
if (isConst) {
|
|
this["toWireType"] = constNoSmartPtrRawPointerToWireType;
|
|
this.destructorFunction = null
|
|
} else {
|
|
this["toWireType"] = nonConstNoSmartPtrRawPointerToWireType;
|
|
this.destructorFunction = null
|
|
}
|
|
} else {
|
|
this["toWireType"] = genericPointerToWireType
|
|
}
|
|
}
|
|
|
|
function requireFunction(signature, rawFunction) {
|
|
signature = readLatin1String(signature);
|
|
|
|
function makeDynCaller(dynCall) {
|
|
var args = [];
|
|
for (var i = 1; i < signature.length; ++i) {
|
|
args.push("a" + i)
|
|
}
|
|
var name = "dynCall_" + signature + "_" + rawFunction;
|
|
var body = "return function " + name + "(" + args.join(", ") + ") {\n";
|
|
body += " return dynCall(rawFunction" + (args.length ? ", " : "") + args.join(", ") + ");\n";
|
|
body += "};\n";
|
|
return (new Function("dynCall", "rawFunction", body))(dynCall, rawFunction)
|
|
}
|
|
var fp;
|
|
if (Module["FUNCTION_TABLE_" + signature] !== undefined) {
|
|
fp = Module["FUNCTION_TABLE_" + signature][rawFunction]
|
|
} else if (typeof FUNCTION_TABLE !== "undefined") {
|
|
fp = FUNCTION_TABLE[rawFunction]
|
|
} else {
|
|
var dc = Module["asm"]["dynCall_" + signature];
|
|
if (dc === undefined) {
|
|
dc = Module["asm"]["dynCall_" + signature.replace(/f/g, "d")];
|
|
if (dc === undefined) {
|
|
throwBindingError("No dynCall invoker for signature: " + signature)
|
|
}
|
|
}
|
|
fp = makeDynCaller(dc)
|
|
}
|
|
if (typeof fp !== "function") {
|
|
throwBindingError("unknown function pointer with signature " + signature + ": " + rawFunction)
|
|
}
|
|
return fp
|
|
}
|
|
|
|
function __embind_register_smart_ptr(rawType, rawPointeeType, name, sharingPolicy, getPointeeSignature, rawGetPointee, constructorSignature, rawConstructor, shareSignature, rawShare, destructorSignature, rawDestructor) {
|
|
name = readLatin1String(name);
|
|
rawGetPointee = requireFunction(getPointeeSignature, rawGetPointee);
|
|
rawConstructor = requireFunction(constructorSignature, rawConstructor);
|
|
rawShare = requireFunction(shareSignature, rawShare);
|
|
rawDestructor = requireFunction(destructorSignature, rawDestructor);
|
|
whenDependentTypesAreResolved([rawType], [rawPointeeType], (function(pointeeType) {
|
|
pointeeType = pointeeType[0];
|
|
var registeredPointer = new RegisteredPointer(name, pointeeType.registeredClass, false, false, true, pointeeType, sharingPolicy, rawGetPointee, rawConstructor, rawShare, rawDestructor);
|
|
return [registeredPointer]
|
|
}))
|
|
}
|
|
|
|
function _llvm_exp2_f32(x) {
|
|
return Math.pow(2, x)
|
|
}
|
|
|
|
function _llvm_exp2_f64() {
|
|
return _llvm_exp2_f32.apply(null, arguments)
|
|
}
|
|
Module["_pthread_cond_broadcast"] = _pthread_cond_broadcast;
|
|
|
|
function new_(constructor, argumentList) {
|
|
if (!(constructor instanceof Function)) {
|
|
throw new TypeError("new_ called with constructor type " + typeof constructor + " which is not a function")
|
|
}
|
|
var dummy = createNamedFunction(constructor.name || "unknownFunctionName", (function() {}));
|
|
dummy.prototype = constructor.prototype;
|
|
var obj = new dummy;
|
|
var r = constructor.apply(obj, argumentList);
|
|
return r instanceof Object ? r : obj
|
|
}
|
|
|
|
function craftInvokerFunction(humanName, argTypes, classType, cppInvokerFunc, cppTargetFunc) {
|
|
var argCount = argTypes.length;
|
|
if (argCount < 2) {
|
|
throwBindingError("argTypes array size mismatch! Must at least get return value and 'this' types!")
|
|
}
|
|
var isClassMethodFunc = argTypes[1] !== null && classType !== null;
|
|
var argsList = "";
|
|
var argsListWired = "";
|
|
for (var i = 0; i < argCount - 2; ++i) {
|
|
argsList += (i !== 0 ? ", " : "") + "arg" + i;
|
|
argsListWired += (i !== 0 ? ", " : "") + "arg" + i + "Wired"
|
|
}
|
|
var invokerFnBody = "return function " + makeLegalFunctionName(humanName) + "(" + argsList + ") {\n" + "if (arguments.length !== " + (argCount - 2) + ") {\n" + "throwBindingError('function " + humanName + " called with ' + arguments.length + ' arguments, expected " + (argCount - 2) + " args!');\n" + "}\n";
|
|
var needsDestructorStack = false;
|
|
for (var i = 1; i < argTypes.length; ++i) {
|
|
if (argTypes[i] !== null && argTypes[i].destructorFunction === undefined) {
|
|
needsDestructorStack = true;
|
|
break
|
|
}
|
|
}
|
|
if (needsDestructorStack) {
|
|
invokerFnBody += "var destructors = [];\n"
|
|
}
|
|
var dtorStack = needsDestructorStack ? "destructors" : "null";
|
|
var args1 = ["throwBindingError", "invoker", "fn", "runDestructors", "retType", "classParam"];
|
|
var args2 = [throwBindingError, cppInvokerFunc, cppTargetFunc, runDestructors, argTypes[0], argTypes[1]];
|
|
if (isClassMethodFunc) {
|
|
invokerFnBody += "var thisWired = classParam.toWireType(" + dtorStack + ", this);\n"
|
|
}
|
|
for (var i = 0; i < argCount - 2; ++i) {
|
|
invokerFnBody += "var arg" + i + "Wired = argType" + i + ".toWireType(" + dtorStack + ", arg" + i + "); // " + argTypes[i + 2].name + "\n";
|
|
args1.push("argType" + i);
|
|
args2.push(argTypes[i + 2])
|
|
}
|
|
if (isClassMethodFunc) {
|
|
argsListWired = "thisWired" + (argsListWired.length > 0 ? ", " : "") + argsListWired
|
|
}
|
|
var returns = argTypes[0].name !== "void";
|
|
invokerFnBody += (returns ? "var rv = " : "") + "invoker(fn" + (argsListWired.length > 0 ? ", " : "") + argsListWired + ");\n";
|
|
if (needsDestructorStack) {
|
|
invokerFnBody += "runDestructors(destructors);\n"
|
|
} else {
|
|
for (var i = isClassMethodFunc ? 1 : 2; i < argTypes.length; ++i) {
|
|
var paramName = i === 1 ? "thisWired" : "arg" + (i - 2) + "Wired";
|
|
if (argTypes[i].destructorFunction !== null) {
|
|
invokerFnBody += paramName + "_dtor(" + paramName + "); // " + argTypes[i].name + "\n";
|
|
args1.push(paramName + "_dtor");
|
|
args2.push(argTypes[i].destructorFunction)
|
|
}
|
|
}
|
|
}
|
|
if (returns) {
|
|
invokerFnBody += "var ret = retType.fromWireType(rv);\n" + "return ret;\n"
|
|
} else {}
|
|
invokerFnBody += "}\n";
|
|
args1.push(invokerFnBody);
|
|
var invokerFunction = new_(Function, args1).apply(null, args2);
|
|
return invokerFunction
|
|
}
|
|
|
|
function ensureOverloadTable(proto, methodName, humanName) {
|
|
if (undefined === proto[methodName].overloadTable) {
|
|
var prevFunc = proto[methodName];
|
|
proto[methodName] = (function() {
|
|
if (!proto[methodName].overloadTable.hasOwnProperty(arguments.length)) {
|
|
throwBindingError("Function '" + humanName + "' called with an invalid number of arguments (" + arguments.length + ") - expects one of (" + proto[methodName].overloadTable + ")!")
|
|
}
|
|
return proto[methodName].overloadTable[arguments.length].apply(this, arguments)
|
|
});
|
|
proto[methodName].overloadTable = [];
|
|
proto[methodName].overloadTable[prevFunc.argCount] = prevFunc
|
|
}
|
|
}
|
|
|
|
function heap32VectorToArray(count, firstElement) {
|
|
var array = [];
|
|
for (var i = 0; i < count; i++) {
|
|
array.push(HEAP32[(firstElement >> 2) + i])
|
|
}
|
|
return array
|
|
}
|
|
var UnboundTypeError = undefined;
|
|
|
|
function throwUnboundTypeError(message, types) {
|
|
var unboundTypes = [];
|
|
var seen = {};
|
|
|
|
function visit(type) {
|
|
if (seen[type]) {
|
|
return
|
|
}
|
|
if (registeredTypes[type]) {
|
|
return
|
|
}
|
|
if (typeDependencies[type]) {
|
|
typeDependencies[type].forEach(visit);
|
|
return
|
|
}
|
|
unboundTypes.push(type);
|
|
seen[type] = true
|
|
}
|
|
types.forEach(visit);
|
|
throw new UnboundTypeError(message + ": " + unboundTypes.map(getTypeName).join([", "]))
|
|
}
|
|
|
|
function __embind_register_class_class_function(rawClassType, methodName, argCount, rawArgTypesAddr, invokerSignature, rawInvoker, fn) {
|
|
var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
|
|
methodName = readLatin1String(methodName);
|
|
rawInvoker = requireFunction(invokerSignature, rawInvoker);
|
|
whenDependentTypesAreResolved([], [rawClassType], (function(classType) {
|
|
classType = classType[0];
|
|
var humanName = classType.name + "." + methodName;
|
|
|
|
function unboundTypesHandler() {
|
|
throwUnboundTypeError("Cannot call " + humanName + " due to unbound types", rawArgTypes)
|
|
}
|
|
var proto = classType.registeredClass.constructor;
|
|
if (undefined === proto[methodName]) {
|
|
unboundTypesHandler.argCount = argCount - 1;
|
|
proto[methodName] = unboundTypesHandler
|
|
} else {
|
|
ensureOverloadTable(proto, methodName, humanName);
|
|
proto[methodName].overloadTable[argCount - 1] = unboundTypesHandler
|
|
}
|
|
whenDependentTypesAreResolved([], rawArgTypes, (function(argTypes) {
|
|
var invokerArgsArray = [argTypes[0], null].concat(argTypes.slice(1));
|
|
var func = craftInvokerFunction(humanName, invokerArgsArray, null, rawInvoker, fn);
|
|
if (undefined === proto[methodName].overloadTable) {
|
|
func.argCount = argCount - 1;
|
|
proto[methodName] = func
|
|
} else {
|
|
proto[methodName].overloadTable[argCount - 1] = func
|
|
}
|
|
return []
|
|
}));
|
|
return []
|
|
}))
|
|
}
|
|
var _environ = STATICTOP;
|
|
STATICTOP += 16;
|
|
|
|
function ___buildEnvironment(env) {
|
|
var MAX_ENV_VALUES = 64;
|
|
var TOTAL_ENV_SIZE = 1024;
|
|
var poolPtr;
|
|
var envPtr;
|
|
if (!___buildEnvironment.called) {
|
|
___buildEnvironment.called = true;
|
|
ENV["USER"] = ENV["LOGNAME"] = "web_user";
|
|
ENV["PATH"] = "/";
|
|
ENV["PWD"] = "/";
|
|
ENV["HOME"] = "/home/web_user";
|
|
ENV["LANG"] = "C";
|
|
ENV["_"] = Module["thisProgram"];
|
|
poolPtr = allocate(TOTAL_ENV_SIZE, "i8", ALLOC_STATIC);
|
|
envPtr = allocate(MAX_ENV_VALUES * 4, "i8*", ALLOC_STATIC);
|
|
HEAP32[envPtr >> 2] = poolPtr;
|
|
HEAP32[_environ >> 2] = envPtr
|
|
} else {
|
|
envPtr = HEAP32[_environ >> 2];
|
|
poolPtr = HEAP32[envPtr >> 2]
|
|
}
|
|
var strings = [];
|
|
var totalSize = 0;
|
|
for (var key in env) {
|
|
if (typeof env[key] === "string") {
|
|
var line = key + "=" + env[key];
|
|
strings.push(line);
|
|
totalSize += line.length
|
|
}
|
|
}
|
|
if (totalSize > TOTAL_ENV_SIZE) {
|
|
throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")
|
|
}
|
|
var ptrSize = 4;
|
|
for (var i = 0; i < strings.length; i++) {
|
|
var line = strings[i];
|
|
writeAsciiToMemory(line, poolPtr);
|
|
HEAP32[envPtr + i * ptrSize >> 2] = poolPtr;
|
|
poolPtr += line.length + 1
|
|
}
|
|
HEAP32[envPtr + strings.length * ptrSize >> 2] = 0
|
|
}
|
|
var ENV = {};
|
|
|
|
function _getenv(name) {
|
|
if (name === 0) return 0;
|
|
name = Pointer_stringify(name);
|
|
if (!ENV.hasOwnProperty(name)) return 0;
|
|
if (_getenv.ret) _free(_getenv.ret);
|
|
_getenv.ret = allocate(intArrayFromString(ENV[name]), "i8", ALLOC_NORMAL);
|
|
return _getenv.ret
|
|
}
|
|
|
|
function _gettimeofday(ptr) {
|
|
var now = Date.now();
|
|
HEAP32[ptr >> 2] = now / 1e3 | 0;
|
|
HEAP32[ptr + 4 >> 2] = now % 1e3 * 1e3 | 0;
|
|
return 0
|
|
}
|
|
|
|
function ___map_file(pathname, size) {
|
|
___setErrNo(ERRNO_CODES.EPERM);
|
|
return -1
|
|
}
|
|
|
|
function _llvm_trap() {
|
|
abort("trap!")
|
|
}
|
|
|
|
function __emval_run_destructors(handle) {
|
|
var destructors = emval_handle_array[handle].value;
|
|
runDestructors(destructors);
|
|
__emval_decref(handle)
|
|
}
|
|
|
|
function __embind_register_value_object(rawType, name, constructorSignature, rawConstructor, destructorSignature, rawDestructor) {
|
|
structRegistrations[rawType] = {
|
|
name: readLatin1String(name),
|
|
rawConstructor: requireFunction(constructorSignature, rawConstructor),
|
|
rawDestructor: requireFunction(destructorSignature, rawDestructor),
|
|
fields: []
|
|
}
|
|
}
|
|
|
|
function _emscripten_memcpy_big(dest, src, num) {
|
|
HEAPU8.set(HEAPU8.subarray(src, src + num), dest);
|
|
return dest
|
|
}
|
|
Module["_memcpy"] = _memcpy;
|
|
|
|
function __embind_register_enum_value(rawEnumType, name, enumValue) {
|
|
var enumType = requireRegisteredType(rawEnumType, "enum");
|
|
name = readLatin1String(name);
|
|
var Enum = enumType.constructor;
|
|
var Value = Object.create(enumType.constructor.prototype, {
|
|
value: {
|
|
value: enumValue
|
|
},
|
|
constructor: {
|
|
value: createNamedFunction(enumType.name + "_" + name, (function() {}))
|
|
}
|
|
});
|
|
Enum.values[enumValue] = Value;
|
|
Enum[name] = Value
|
|
}
|
|
var tupleRegistrations = {};
|
|
|
|
function __embind_finalize_value_array(rawTupleType) {
|
|
var reg = tupleRegistrations[rawTupleType];
|
|
delete tupleRegistrations[rawTupleType];
|
|
var elements = reg.elements;
|
|
var elementsLength = elements.length;
|
|
var elementTypes = elements.map((function(elt) {
|
|
return elt.getterReturnType
|
|
})).concat(elements.map((function(elt) {
|
|
return elt.setterArgumentType
|
|
})));
|
|
var rawConstructor = reg.rawConstructor;
|
|
var rawDestructor = reg.rawDestructor;
|
|
whenDependentTypesAreResolved([rawTupleType], elementTypes, (function(elementTypes) {
|
|
elements.forEach((function(elt, i) {
|
|
var getterReturnType = elementTypes[i];
|
|
var getter = elt.getter;
|
|
var getterContext = elt.getterContext;
|
|
var setterArgumentType = elementTypes[i + elementsLength];
|
|
var setter = elt.setter;
|
|
var setterContext = elt.setterContext;
|
|
elt.read = (function(ptr) {
|
|
return getterReturnType["fromWireType"](getter(getterContext, ptr))
|
|
});
|
|
elt.write = (function(ptr, o) {
|
|
var destructors = [];
|
|
setter(setterContext, ptr, setterArgumentType["toWireType"](destructors, o));
|
|
runDestructors(destructors)
|
|
})
|
|
}));
|
|
return [{
|
|
name: reg.name,
|
|
"fromWireType": (function(ptr) {
|
|
var rv = new Array(elementsLength);
|
|
for (var i = 0; i < elementsLength; ++i) {
|
|
rv[i] = elements[i].read(ptr)
|
|
}
|
|
rawDestructor(ptr);
|
|
return rv
|
|
}),
|
|
"toWireType": (function(destructors, o) {
|
|
if (elementsLength !== o.length) {
|
|
throw new TypeError("Incorrect number of tuple elements for " + reg.name + ": expected=" + elementsLength + ", actual=" + o.length)
|
|
}
|
|
var ptr = rawConstructor();
|
|
for (var i = 0; i < elementsLength; ++i) {
|
|
elements[i].write(ptr, o[i])
|
|
}
|
|
if (destructors !== null) {
|
|
destructors.push(rawDestructor, ptr)
|
|
}
|
|
return ptr
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": simpleReadValueFromPointer,
|
|
destructorFunction: rawDestructor
|
|
}]
|
|
}))
|
|
}
|
|
Module["_sbrk"] = _sbrk;
|
|
Module["_memmove"] = _memmove;
|
|
|
|
function ___cxa_allocate_exception(size) {
|
|
return _malloc(size)
|
|
}
|
|
|
|
function ___gxx_personality_v0() {}
|
|
|
|
function _pthread_mutex_destroy() {}
|
|
|
|
function _pthread_cond_wait() {
|
|
return 0
|
|
}
|
|
Module["_llvm_bswap_i32"] = _llvm_bswap_i32;
|
|
|
|
function __embind_register_memory_view(rawType, dataTypeIndex, name) {
|
|
var typeMapping = [Int8Array, Uint8Array, Int16Array, Uint16Array, Int32Array, Uint32Array, Float32Array, Float64Array];
|
|
var TA = typeMapping[dataTypeIndex];
|
|
|
|
function decodeMemoryView(handle) {
|
|
handle = handle >> 2;
|
|
var heap = HEAPU32;
|
|
var size = heap[handle];
|
|
var data = heap[handle + 1];
|
|
return new TA(heap["buffer"], data, size)
|
|
}
|
|
name = readLatin1String(name);
|
|
registerType(rawType, {
|
|
name: name,
|
|
"fromWireType": decodeMemoryView,
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": decodeMemoryView
|
|
}, {
|
|
ignoreDuplicateRegistrations: true
|
|
})
|
|
}
|
|
var _llvm_pow_f64 = Math_pow;
|
|
|
|
function validateThis(this_, classType, humanName) {
|
|
if (!(this_ instanceof Object)) {
|
|
throwBindingError(humanName + ' with invalid "this": ' + this_)
|
|
}
|
|
if (!(this_ instanceof classType.registeredClass.constructor)) {
|
|
throwBindingError(humanName + ' incompatible with "this" of type ' + this_.constructor.name)
|
|
}
|
|
if (!this_.$$.ptr) {
|
|
throwBindingError("cannot call emscripten binding method " + humanName + " on deleted object")
|
|
}
|
|
return upcastPointer(this_.$$.ptr, this_.$$.ptrType.registeredClass, classType.registeredClass)
|
|
}
|
|
|
|
function __embind_register_class_property(classType, fieldName, getterReturnType, getterSignature, getter, getterContext, setterArgumentType, setterSignature, setter, setterContext) {
|
|
fieldName = readLatin1String(fieldName);
|
|
getter = requireFunction(getterSignature, getter);
|
|
whenDependentTypesAreResolved([], [classType], (function(classType) {
|
|
classType = classType[0];
|
|
var humanName = classType.name + "." + fieldName;
|
|
var desc = {
|
|
get: (function() {
|
|
throwUnboundTypeError("Cannot access " + humanName + " due to unbound types", [getterReturnType, setterArgumentType])
|
|
}),
|
|
enumerable: true,
|
|
configurable: true
|
|
};
|
|
if (setter) {
|
|
desc.set = (function() {
|
|
throwUnboundTypeError("Cannot access " + humanName + " due to unbound types", [getterReturnType, setterArgumentType])
|
|
})
|
|
} else {
|
|
desc.set = (function(v) {
|
|
throwBindingError(humanName + " is a read-only property")
|
|
})
|
|
}
|
|
Object.defineProperty(classType.registeredClass.instancePrototype, fieldName, desc);
|
|
whenDependentTypesAreResolved([], setter ? [getterReturnType, setterArgumentType] : [getterReturnType], (function(types) {
|
|
var getterReturnType = types[0];
|
|
var desc = {
|
|
get: (function() {
|
|
var ptr = validateThis(this, classType, humanName + " getter");
|
|
return getterReturnType["fromWireType"](getter(getterContext, ptr))
|
|
}),
|
|
enumerable: true
|
|
};
|
|
if (setter) {
|
|
setter = requireFunction(setterSignature, setter);
|
|
var setterArgumentType = types[1];
|
|
desc.set = (function(v) {
|
|
var ptr = validateThis(this, classType, humanName + " setter");
|
|
var destructors = [];
|
|
setter(setterContext, ptr, setterArgumentType["toWireType"](destructors, v));
|
|
runDestructors(destructors)
|
|
})
|
|
}
|
|
Object.defineProperty(classType.registeredClass.instancePrototype, fieldName, desc);
|
|
return []
|
|
}));
|
|
return []
|
|
}))
|
|
}
|
|
|
|
function ___syscall40(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr();
|
|
FS.rmdir(path);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function __emval_incref(handle) {
|
|
if (handle > 4) {
|
|
emval_handle_array[handle].refcount += 1
|
|
}
|
|
}
|
|
|
|
function _pthread_mutexattr_settype() {}
|
|
|
|
function __embind_register_value_array(rawType, name, constructorSignature, rawConstructor, destructorSignature, rawDestructor) {
|
|
tupleRegistrations[rawType] = {
|
|
name: readLatin1String(name),
|
|
rawConstructor: requireFunction(constructorSignature, rawConstructor),
|
|
rawDestructor: requireFunction(destructorSignature, rawDestructor),
|
|
elements: []
|
|
}
|
|
}
|
|
|
|
function getShiftFromSize(size) {
|
|
switch (size) {
|
|
case 1:
|
|
return 0;
|
|
case 2:
|
|
return 1;
|
|
case 4:
|
|
return 2;
|
|
case 8:
|
|
return 3;
|
|
default:
|
|
throw new TypeError("Unknown type size: " + size)
|
|
}
|
|
}
|
|
|
|
function __embind_register_bool(rawType, name, size, trueValue, falseValue) {
|
|
var shift = getShiftFromSize(size);
|
|
name = readLatin1String(name);
|
|
registerType(rawType, {
|
|
name: name,
|
|
"fromWireType": (function(wt) {
|
|
return !!wt
|
|
}),
|
|
"toWireType": (function(destructors, o) {
|
|
return o ? trueValue : falseValue
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": (function(pointer) {
|
|
var heap;
|
|
if (size === 1) {
|
|
heap = HEAP8
|
|
} else if (size === 2) {
|
|
heap = HEAP16
|
|
} else if (size === 4) {
|
|
heap = HEAP32
|
|
} else {
|
|
throw new TypeError("Unknown boolean type size: " + name)
|
|
}
|
|
return this["fromWireType"](heap[pointer >> shift])
|
|
}),
|
|
destructorFunction: null
|
|
})
|
|
}
|
|
|
|
function ___assert_fail(condition, filename, line, func) {
|
|
ABORT = true;
|
|
throw "Assertion failed: " + Pointer_stringify(condition) + ", at: " + [filename ? Pointer_stringify(filename) : "unknown filename", line, func ? Pointer_stringify(func) : "unknown function"] + " at " + stackTrace()
|
|
}
|
|
|
|
function __embind_register_void(rawType, name) {
|
|
name = readLatin1String(name);
|
|
registerType(rawType, {
|
|
isVoid: true,
|
|
name: name,
|
|
"argPackAdvance": 0,
|
|
"fromWireType": (function() {
|
|
return undefined
|
|
}),
|
|
"toWireType": (function(destructors, o) {
|
|
return undefined
|
|
})
|
|
})
|
|
}
|
|
Module["_memset"] = _memset;
|
|
|
|
function __isLeapYear(year) {
|
|
return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0)
|
|
}
|
|
|
|
function __arraySum(array, index) {
|
|
var sum = 0;
|
|
for (var i = 0; i <= index; sum += array[i++]);
|
|
return sum
|
|
}
|
|
var __MONTH_DAYS_LEAP = [31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
|
|
var __MONTH_DAYS_REGULAR = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
|
|
|
|
function __addDays(date, days) {
|
|
var newDate = new Date(date.getTime());
|
|
while (days > 0) {
|
|
var leap = __isLeapYear(newDate.getFullYear());
|
|
var currentMonth = newDate.getMonth();
|
|
var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth];
|
|
if (days > daysInCurrentMonth - newDate.getDate()) {
|
|
days -= daysInCurrentMonth - newDate.getDate() + 1;
|
|
newDate.setDate(1);
|
|
if (currentMonth < 11) {
|
|
newDate.setMonth(currentMonth + 1)
|
|
} else {
|
|
newDate.setMonth(0);
|
|
newDate.setFullYear(newDate.getFullYear() + 1)
|
|
}
|
|
} else {
|
|
newDate.setDate(newDate.getDate() + days);
|
|
return newDate
|
|
}
|
|
}
|
|
return newDate
|
|
}
|
|
|
|
function _strftime(s, maxsize, format, tm) {
|
|
var tm_zone = HEAP32[tm + 40 >> 2];
|
|
var date = {
|
|
tm_sec: HEAP32[tm >> 2],
|
|
tm_min: HEAP32[tm + 4 >> 2],
|
|
tm_hour: HEAP32[tm + 8 >> 2],
|
|
tm_mday: HEAP32[tm + 12 >> 2],
|
|
tm_mon: HEAP32[tm + 16 >> 2],
|
|
tm_year: HEAP32[tm + 20 >> 2],
|
|
tm_wday: HEAP32[tm + 24 >> 2],
|
|
tm_yday: HEAP32[tm + 28 >> 2],
|
|
tm_isdst: HEAP32[tm + 32 >> 2],
|
|
tm_gmtoff: HEAP32[tm + 36 >> 2],
|
|
tm_zone: tm_zone ? Pointer_stringify(tm_zone) : ""
|
|
};
|
|
var pattern = Pointer_stringify(format);
|
|
var EXPANSION_RULES_1 = {
|
|
"%c": "%a %b %d %H:%M:%S %Y",
|
|
"%D": "%m/%d/%y",
|
|
"%F": "%Y-%m-%d",
|
|
"%h": "%b",
|
|
"%r": "%I:%M:%S %p",
|
|
"%R": "%H:%M",
|
|
"%T": "%H:%M:%S",
|
|
"%x": "%m/%d/%y",
|
|
"%X": "%H:%M:%S"
|
|
};
|
|
for (var rule in EXPANSION_RULES_1) {
|
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule])
|
|
}
|
|
var WEEKDAYS = ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"];
|
|
var MONTHS = ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"];
|
|
|
|
function leadingSomething(value, digits, character) {
|
|
var str = typeof value === "number" ? value.toString() : value || "";
|
|
while (str.length < digits) {
|
|
str = character[0] + str
|
|
}
|
|
return str
|
|
}
|
|
|
|
function leadingNulls(value, digits) {
|
|
return leadingSomething(value, digits, "0")
|
|
}
|
|
|
|
function compareByDay(date1, date2) {
|
|
function sgn(value) {
|
|
return value < 0 ? -1 : value > 0 ? 1 : 0
|
|
}
|
|
var compare;
|
|
if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) {
|
|
if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) {
|
|
compare = sgn(date1.getDate() - date2.getDate())
|
|
}
|
|
}
|
|
return compare
|
|
}
|
|
|
|
function getFirstWeekStartDate(janFourth) {
|
|
switch (janFourth.getDay()) {
|
|
case 0:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 29);
|
|
case 1:
|
|
return janFourth;
|
|
case 2:
|
|
return new Date(janFourth.getFullYear(), 0, 3);
|
|
case 3:
|
|
return new Date(janFourth.getFullYear(), 0, 2);
|
|
case 4:
|
|
return new Date(janFourth.getFullYear(), 0, 1);
|
|
case 5:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 31);
|
|
case 6:
|
|
return new Date(janFourth.getFullYear() - 1, 11, 30)
|
|
}
|
|
}
|
|
|
|
function getWeekBasedYear(date) {
|
|
var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
|
|
var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4);
|
|
var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4);
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) {
|
|
if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) {
|
|
return thisDate.getFullYear() + 1
|
|
} else {
|
|
return thisDate.getFullYear()
|
|
}
|
|
} else {
|
|
return thisDate.getFullYear() - 1
|
|
}
|
|
}
|
|
var EXPANSION_RULES_2 = {
|
|
"%a": (function(date) {
|
|
return WEEKDAYS[date.tm_wday].substring(0, 3)
|
|
}),
|
|
"%A": (function(date) {
|
|
return WEEKDAYS[date.tm_wday]
|
|
}),
|
|
"%b": (function(date) {
|
|
return MONTHS[date.tm_mon].substring(0, 3)
|
|
}),
|
|
"%B": (function(date) {
|
|
return MONTHS[date.tm_mon]
|
|
}),
|
|
"%C": (function(date) {
|
|
var year = date.tm_year + 1900;
|
|
return leadingNulls(year / 100 | 0, 2)
|
|
}),
|
|
"%d": (function(date) {
|
|
return leadingNulls(date.tm_mday, 2)
|
|
}),
|
|
"%e": (function(date) {
|
|
return leadingSomething(date.tm_mday, 2, " ")
|
|
}),
|
|
"%g": (function(date) {
|
|
return getWeekBasedYear(date).toString().substring(2)
|
|
}),
|
|
"%G": (function(date) {
|
|
return getWeekBasedYear(date)
|
|
}),
|
|
"%H": (function(date) {
|
|
return leadingNulls(date.tm_hour, 2)
|
|
}),
|
|
"%I": (function(date) {
|
|
var twelveHour = date.tm_hour;
|
|
if (twelveHour == 0) twelveHour = 12;
|
|
else if (twelveHour > 12) twelveHour -= 12;
|
|
return leadingNulls(twelveHour, 2)
|
|
}),
|
|
"%j": (function(date) {
|
|
return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3)
|
|
}),
|
|
"%m": (function(date) {
|
|
return leadingNulls(date.tm_mon + 1, 2)
|
|
}),
|
|
"%M": (function(date) {
|
|
return leadingNulls(date.tm_min, 2)
|
|
}),
|
|
"%n": (function() {
|
|
return "\n"
|
|
}),
|
|
"%p": (function(date) {
|
|
if (date.tm_hour >= 0 && date.tm_hour < 12) {
|
|
return "AM"
|
|
} else {
|
|
return "PM"
|
|
}
|
|
}),
|
|
"%S": (function(date) {
|
|
return leadingNulls(date.tm_sec, 2)
|
|
}),
|
|
"%t": (function() {
|
|
return "\t"
|
|
}),
|
|
"%u": (function(date) {
|
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0);
|
|
return day.getDay() || 7
|
|
}),
|
|
"%U": (function(date) {
|
|
var janFirst = new Date(date.tm_year + 1900, 0, 1);
|
|
var firstSunday = janFirst.getDay() === 0 ? janFirst : __addDays(janFirst, 7 - janFirst.getDay());
|
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
|
|
if (compareByDay(firstSunday, endDate) < 0) {
|
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
|
|
var firstSundayUntilEndJanuary = 31 - firstSunday.getDate();
|
|
var days = firstSundayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
|
|
return leadingNulls(Math.ceil(days / 7), 2)
|
|
}
|
|
return compareByDay(firstSunday, janFirst) === 0 ? "01" : "00"
|
|
}),
|
|
"%V": (function(date) {
|
|
var janFourthThisYear = new Date(date.tm_year + 1900, 0, 4);
|
|
var janFourthNextYear = new Date(date.tm_year + 1901, 0, 4);
|
|
var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear);
|
|
var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear);
|
|
var endDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday);
|
|
if (compareByDay(endDate, firstWeekStartThisYear) < 0) {
|
|
return "53"
|
|
}
|
|
if (compareByDay(firstWeekStartNextYear, endDate) <= 0) {
|
|
return "01"
|
|
}
|
|
var daysDifference;
|
|
if (firstWeekStartThisYear.getFullYear() < date.tm_year + 1900) {
|
|
daysDifference = date.tm_yday + 32 - firstWeekStartThisYear.getDate()
|
|
} else {
|
|
daysDifference = date.tm_yday + 1 - firstWeekStartThisYear.getDate()
|
|
}
|
|
return leadingNulls(Math.ceil(daysDifference / 7), 2)
|
|
}),
|
|
"%w": (function(date) {
|
|
var day = new Date(date.tm_year + 1900, date.tm_mon + 1, date.tm_mday, 0, 0, 0, 0);
|
|
return day.getDay()
|
|
}),
|
|
"%W": (function(date) {
|
|
var janFirst = new Date(date.tm_year, 0, 1);
|
|
var firstMonday = janFirst.getDay() === 1 ? janFirst : __addDays(janFirst, janFirst.getDay() === 0 ? 1 : 7 - janFirst.getDay() + 1);
|
|
var endDate = new Date(date.tm_year + 1900, date.tm_mon, date.tm_mday);
|
|
if (compareByDay(firstMonday, endDate) < 0) {
|
|
var februaryFirstUntilEndMonth = __arraySum(__isLeapYear(endDate.getFullYear()) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, endDate.getMonth() - 1) - 31;
|
|
var firstMondayUntilEndJanuary = 31 - firstMonday.getDate();
|
|
var days = firstMondayUntilEndJanuary + februaryFirstUntilEndMonth + endDate.getDate();
|
|
return leadingNulls(Math.ceil(days / 7), 2)
|
|
}
|
|
return compareByDay(firstMonday, janFirst) === 0 ? "01" : "00"
|
|
}),
|
|
"%y": (function(date) {
|
|
return (date.tm_year + 1900).toString().substring(2)
|
|
}),
|
|
"%Y": (function(date) {
|
|
return date.tm_year + 1900
|
|
}),
|
|
"%z": (function(date) {
|
|
var off = date.tm_gmtoff;
|
|
var ahead = off >= 0;
|
|
off = Math.abs(off) / 60;
|
|
off = off / 60 * 100 + off % 60;
|
|
return (ahead ? "+" : "-") + String("0000" + off).slice(-4)
|
|
}),
|
|
"%Z": (function(date) {
|
|
return date.tm_zone
|
|
}),
|
|
"%%": (function() {
|
|
return "%"
|
|
})
|
|
};
|
|
for (var rule in EXPANSION_RULES_2) {
|
|
if (pattern.indexOf(rule) >= 0) {
|
|
pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date))
|
|
}
|
|
}
|
|
var bytes = intArrayFromString(pattern, false);
|
|
if (bytes.length > maxsize) {
|
|
return 0
|
|
}
|
|
writeArrayToMemory(bytes, s);
|
|
return bytes.length - 1
|
|
}
|
|
|
|
function _strftime_l(s, maxsize, format, tm) {
|
|
return _strftime(s, maxsize, format, tm)
|
|
}
|
|
|
|
function _abort() {
|
|
Module["abort"]()
|
|
}
|
|
|
|
function requireHandle(handle) {
|
|
if (!handle) {
|
|
throwBindingError("Cannot use deleted val. handle = " + handle)
|
|
}
|
|
return emval_handle_array[handle].value
|
|
}
|
|
|
|
function __emval_as(handle, returnType, destructorsRef) {
|
|
handle = requireHandle(handle);
|
|
returnType = requireRegisteredType(returnType, "emval::as");
|
|
var destructors = [];
|
|
var rd = __emval_register(destructors);
|
|
HEAP32[destructorsRef >> 2] = rd;
|
|
return returnType["toWireType"](destructors, handle)
|
|
}
|
|
|
|
function _pthread_once(ptr, func) {
|
|
if (!_pthread_once.seen) _pthread_once.seen = {};
|
|
if (ptr in _pthread_once.seen) return;
|
|
Module["dynCall_v"](func);
|
|
_pthread_once.seen[ptr] = 1
|
|
}
|
|
|
|
function __embind_register_value_object_field(structType, fieldName, getterReturnType, getterSignature, getter, getterContext, setterArgumentType, setterSignature, setter, setterContext) {
|
|
structRegistrations[structType].fields.push({
|
|
fieldName: readLatin1String(fieldName),
|
|
getterReturnType: getterReturnType,
|
|
getter: requireFunction(getterSignature, getter),
|
|
getterContext: getterContext,
|
|
setterArgumentType: setterArgumentType,
|
|
setter: requireFunction(setterSignature, setter),
|
|
setterContext: setterContext
|
|
})
|
|
}
|
|
|
|
function ClassHandle_isAliasOf(other) {
|
|
if (!(this instanceof ClassHandle)) {
|
|
return false
|
|
}
|
|
if (!(other instanceof ClassHandle)) {
|
|
return false
|
|
}
|
|
var leftClass = this.$$.ptrType.registeredClass;
|
|
var left = this.$$.ptr;
|
|
var rightClass = other.$$.ptrType.registeredClass;
|
|
var right = other.$$.ptr;
|
|
while (leftClass.baseClass) {
|
|
left = leftClass.upcast(left);
|
|
leftClass = leftClass.baseClass
|
|
}
|
|
while (rightClass.baseClass) {
|
|
right = rightClass.upcast(right);
|
|
rightClass = rightClass.baseClass
|
|
}
|
|
return leftClass === rightClass && left === right
|
|
}
|
|
|
|
function shallowCopyInternalPointer(o) {
|
|
return {
|
|
count: o.count,
|
|
deleteScheduled: o.deleteScheduled,
|
|
preservePointerOnDelete: o.preservePointerOnDelete,
|
|
ptr: o.ptr,
|
|
ptrType: o.ptrType,
|
|
smartPtr: o.smartPtr,
|
|
smartPtrType: o.smartPtrType
|
|
}
|
|
}
|
|
|
|
function throwInstanceAlreadyDeleted(obj) {
|
|
function getInstanceTypeName(handle) {
|
|
return handle.$$.ptrType.registeredClass.name
|
|
}
|
|
throwBindingError(getInstanceTypeName(obj) + " instance already deleted")
|
|
}
|
|
|
|
function ClassHandle_clone() {
|
|
if (!this.$$.ptr) {
|
|
throwInstanceAlreadyDeleted(this)
|
|
}
|
|
if (this.$$.preservePointerOnDelete) {
|
|
this.$$.count.value += 1;
|
|
return this
|
|
} else {
|
|
var clone = Object.create(Object.getPrototypeOf(this), {
|
|
$$: {
|
|
value: shallowCopyInternalPointer(this.$$)
|
|
}
|
|
});
|
|
clone.$$.count.value += 1;
|
|
clone.$$.deleteScheduled = false;
|
|
return clone
|
|
}
|
|
}
|
|
|
|
function runDestructor(handle) {
|
|
var $$ = handle.$$;
|
|
if ($$.smartPtr) {
|
|
$$.smartPtrType.rawDestructor($$.smartPtr)
|
|
} else {
|
|
$$.ptrType.registeredClass.rawDestructor($$.ptr)
|
|
}
|
|
}
|
|
|
|
function ClassHandle_delete() {
|
|
if (!this.$$.ptr) {
|
|
throwInstanceAlreadyDeleted(this)
|
|
}
|
|
if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) {
|
|
throwBindingError("Object already scheduled for deletion")
|
|
}
|
|
this.$$.count.value -= 1;
|
|
var toDelete = 0 === this.$$.count.value;
|
|
if (toDelete) {
|
|
runDestructor(this)
|
|
}
|
|
if (!this.$$.preservePointerOnDelete) {
|
|
this.$$.smartPtr = undefined;
|
|
this.$$.ptr = undefined
|
|
}
|
|
}
|
|
|
|
function ClassHandle_isDeleted() {
|
|
return !this.$$.ptr
|
|
}
|
|
|
|
function ClassHandle_deleteLater() {
|
|
if (!this.$$.ptr) {
|
|
throwInstanceAlreadyDeleted(this)
|
|
}
|
|
if (this.$$.deleteScheduled && !this.$$.preservePointerOnDelete) {
|
|
throwBindingError("Object already scheduled for deletion")
|
|
}
|
|
deletionQueue.push(this);
|
|
if (deletionQueue.length === 1 && delayFunction) {
|
|
delayFunction(flushPendingDeletes)
|
|
}
|
|
this.$$.deleteScheduled = true;
|
|
return this
|
|
}
|
|
|
|
function init_ClassHandle() {
|
|
ClassHandle.prototype["isAliasOf"] = ClassHandle_isAliasOf;
|
|
ClassHandle.prototype["clone"] = ClassHandle_clone;
|
|
ClassHandle.prototype["delete"] = ClassHandle_delete;
|
|
ClassHandle.prototype["isDeleted"] = ClassHandle_isDeleted;
|
|
ClassHandle.prototype["deleteLater"] = ClassHandle_deleteLater
|
|
}
|
|
|
|
function ClassHandle() {}
|
|
|
|
function exposePublicSymbol(name, value, numArguments) {
|
|
if (Module.hasOwnProperty(name)) {
|
|
if (undefined === numArguments || undefined !== Module[name].overloadTable && undefined !== Module[name].overloadTable[numArguments]) {
|
|
throwBindingError("Cannot register public name '" + name + "' twice")
|
|
}
|
|
ensureOverloadTable(Module, name, name);
|
|
if (Module.hasOwnProperty(numArguments)) {
|
|
throwBindingError("Cannot register multiple overloads of a function with the same number of arguments (" + numArguments + ")!")
|
|
}
|
|
Module[name].overloadTable[numArguments] = value
|
|
} else {
|
|
Module[name] = value;
|
|
if (undefined !== numArguments) {
|
|
Module[name].numArguments = numArguments
|
|
}
|
|
}
|
|
}
|
|
|
|
function RegisteredClass(name, constructor, instancePrototype, rawDestructor, baseClass, getActualType, upcast, downcast) {
|
|
this.name = name;
|
|
this.constructor = constructor;
|
|
this.instancePrototype = instancePrototype;
|
|
this.rawDestructor = rawDestructor;
|
|
this.baseClass = baseClass;
|
|
this.getActualType = getActualType;
|
|
this.upcast = upcast;
|
|
this.downcast = downcast;
|
|
this.pureVirtualFunctions = []
|
|
}
|
|
|
|
function replacePublicSymbol(name, value, numArguments) {
|
|
if (!Module.hasOwnProperty(name)) {
|
|
throwInternalError("Replacing nonexistant public symbol")
|
|
}
|
|
if (undefined !== Module[name].overloadTable && undefined !== numArguments) {
|
|
Module[name].overloadTable[numArguments] = value
|
|
} else {
|
|
Module[name] = value;
|
|
Module[name].argCount = numArguments
|
|
}
|
|
}
|
|
|
|
function __embind_register_class(rawType, rawPointerType, rawConstPointerType, baseClassRawType, getActualTypeSignature, getActualType, upcastSignature, upcast, downcastSignature, downcast, name, destructorSignature, rawDestructor) {
|
|
name = readLatin1String(name);
|
|
getActualType = requireFunction(getActualTypeSignature, getActualType);
|
|
if (upcast) {
|
|
upcast = requireFunction(upcastSignature, upcast)
|
|
}
|
|
if (downcast) {
|
|
downcast = requireFunction(downcastSignature, downcast)
|
|
}
|
|
rawDestructor = requireFunction(destructorSignature, rawDestructor);
|
|
var legalFunctionName = makeLegalFunctionName(name);
|
|
exposePublicSymbol(legalFunctionName, (function() {
|
|
throwUnboundTypeError("Cannot construct " + name + " due to unbound types", [baseClassRawType])
|
|
}));
|
|
whenDependentTypesAreResolved([rawType, rawPointerType, rawConstPointerType], baseClassRawType ? [baseClassRawType] : [], (function(base) {
|
|
base = base[0];
|
|
var baseClass;
|
|
var basePrototype;
|
|
if (baseClassRawType) {
|
|
baseClass = base.registeredClass;
|
|
basePrototype = baseClass.instancePrototype
|
|
} else {
|
|
basePrototype = ClassHandle.prototype
|
|
}
|
|
var constructor = createNamedFunction(legalFunctionName, (function() {
|
|
if (Object.getPrototypeOf(this) !== instancePrototype) {
|
|
throw new BindingError("Use 'new' to construct " + name)
|
|
}
|
|
if (undefined === registeredClass.constructor_body) {
|
|
throw new BindingError(name + " has no accessible constructor")
|
|
}
|
|
var body = registeredClass.constructor_body[arguments.length];
|
|
if (undefined === body) {
|
|
throw new BindingError("Tried to invoke ctor of " + name + " with invalid number of parameters (" + arguments.length + ") - expected (" + Object.keys(registeredClass.constructor_body).toString() + ") parameters instead!")
|
|
}
|
|
return body.apply(this, arguments)
|
|
}));
|
|
var instancePrototype = Object.create(basePrototype, {
|
|
constructor: {
|
|
value: constructor
|
|
}
|
|
});
|
|
constructor.prototype = instancePrototype;
|
|
var registeredClass = new RegisteredClass(name, constructor, instancePrototype, rawDestructor, baseClass, getActualType, upcast, downcast);
|
|
var referenceConverter = new RegisteredPointer(name, registeredClass, true, false, false);
|
|
var pointerConverter = new RegisteredPointer(name + "*", registeredClass, false, false, false);
|
|
var constPointerConverter = new RegisteredPointer(name + " const*", registeredClass, false, true, false);
|
|
registeredPointers[rawType] = {
|
|
pointerType: pointerConverter,
|
|
constPointerType: constPointerConverter
|
|
};
|
|
replacePublicSymbol(legalFunctionName, constructor);
|
|
return [referenceConverter, pointerConverter, constPointerConverter]
|
|
}))
|
|
}
|
|
|
|
function ___lock() {}
|
|
|
|
function ___unlock() {}
|
|
|
|
function _pthread_mutexattr_init() {}
|
|
|
|
function _pthread_getspecific(key) {
|
|
return PTHREAD_SPECIFIC[key] || 0
|
|
}
|
|
|
|
function _embind_repr(v) {
|
|
if (v === null) {
|
|
return "null"
|
|
}
|
|
var t = typeof v;
|
|
if (t === "object" || t === "array" || t === "function") {
|
|
return v.toString()
|
|
} else {
|
|
return "" + v
|
|
}
|
|
}
|
|
|
|
function integerReadValueFromPointer(name, shift, signed) {
|
|
switch (shift) {
|
|
case 0:
|
|
return signed ? function readS8FromPointer(pointer) {
|
|
return HEAP8[pointer]
|
|
} : function readU8FromPointer(pointer) {
|
|
return HEAPU8[pointer]
|
|
};
|
|
case 1:
|
|
return signed ? function readS16FromPointer(pointer) {
|
|
return HEAP16[pointer >> 1]
|
|
} : function readU16FromPointer(pointer) {
|
|
return HEAPU16[pointer >> 1]
|
|
};
|
|
case 2:
|
|
return signed ? function readS32FromPointer(pointer) {
|
|
return HEAP32[pointer >> 2]
|
|
} : function readU32FromPointer(pointer) {
|
|
return HEAPU32[pointer >> 2]
|
|
};
|
|
default:
|
|
throw new TypeError("Unknown integer type: " + name)
|
|
}
|
|
}
|
|
|
|
function __embind_register_integer(primitiveType, name, size, minRange, maxRange) {
|
|
name = readLatin1String(name);
|
|
if (maxRange === -1) {
|
|
maxRange = 4294967295
|
|
}
|
|
var shift = getShiftFromSize(size);
|
|
var fromWireType = (function(value) {
|
|
return value
|
|
});
|
|
if (minRange === 0) {
|
|
var bitshift = 32 - 8 * size;
|
|
fromWireType = (function(value) {
|
|
return value << bitshift >>> bitshift
|
|
})
|
|
}
|
|
var isUnsignedType = name.indexOf("unsigned") != -1;
|
|
registerType(primitiveType, {
|
|
name: name,
|
|
"fromWireType": fromWireType,
|
|
"toWireType": (function(destructors, value) {
|
|
if (typeof value !== "number" && typeof value !== "boolean") {
|
|
throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name)
|
|
}
|
|
if (value < minRange || value > maxRange) {
|
|
throw new TypeError('Passing a number "' + _embind_repr(value) + '" from JS side to C/C++ side to an argument of type "' + name + '", which is outside the valid range [' + minRange + ", " + maxRange + "]!")
|
|
}
|
|
return isUnsignedType ? value >>> 0 : value | 0
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": integerReadValueFromPointer(name, shift, minRange !== 0),
|
|
destructorFunction: null
|
|
})
|
|
}
|
|
|
|
function __emval_get_property(handle, key) {
|
|
handle = requireHandle(handle);
|
|
key = requireHandle(key);
|
|
return __emval_register(handle[key])
|
|
}
|
|
|
|
function __embind_register_emval(rawType, name) {
|
|
name = readLatin1String(name);
|
|
registerType(rawType, {
|
|
name: name,
|
|
"fromWireType": (function(handle) {
|
|
var rv = emval_handle_array[handle].value;
|
|
__emval_decref(handle);
|
|
return rv
|
|
}),
|
|
"toWireType": (function(destructors, value) {
|
|
return __emval_register(value)
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": simpleReadValueFromPointer,
|
|
destructorFunction: null
|
|
})
|
|
}
|
|
|
|
function _pthread_setspecific(key, value) {
|
|
if (!(key in PTHREAD_SPECIFIC)) {
|
|
return ERRNO_CODES.EINVAL
|
|
}
|
|
PTHREAD_SPECIFIC[key] = value;
|
|
return 0
|
|
}
|
|
|
|
function __embind_register_value_array_element(rawTupleType, getterReturnType, getterSignature, getter, getterContext, setterArgumentType, setterSignature, setter, setterContext) {
|
|
tupleRegistrations[rawTupleType].elements.push({
|
|
getterReturnType: getterReturnType,
|
|
getter: requireFunction(getterSignature, getter),
|
|
getterContext: getterContext,
|
|
setterArgumentType: setterArgumentType,
|
|
setter: requireFunction(setterSignature, setter),
|
|
setterContext: setterContext
|
|
})
|
|
}
|
|
|
|
function ___cxa_pure_virtual() {
|
|
ABORT = true;
|
|
throw "Pure virtual function called!"
|
|
}
|
|
|
|
function floatReadValueFromPointer(name, shift) {
|
|
switch (shift) {
|
|
case 2:
|
|
return (function(pointer) {
|
|
return this["fromWireType"](HEAPF32[pointer >> 2])
|
|
});
|
|
case 3:
|
|
return (function(pointer) {
|
|
return this["fromWireType"](HEAPF64[pointer >> 3])
|
|
});
|
|
default:
|
|
throw new TypeError("Unknown float type: " + name)
|
|
}
|
|
}
|
|
|
|
function __embind_register_float(rawType, name, size) {
|
|
var shift = getShiftFromSize(size);
|
|
name = readLatin1String(name);
|
|
registerType(rawType, {
|
|
name: name,
|
|
"fromWireType": (function(value) {
|
|
return value
|
|
}),
|
|
"toWireType": (function(destructors, value) {
|
|
if (typeof value !== "number" && typeof value !== "boolean") {
|
|
throw new TypeError('Cannot convert "' + _embind_repr(value) + '" to ' + this.name)
|
|
}
|
|
return value
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": floatReadValueFromPointer(name, shift),
|
|
destructorFunction: null
|
|
})
|
|
}
|
|
|
|
function ___syscall10(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var path = SYSCALLS.getStr();
|
|
FS.unlink(path);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function _emscripten_get_now() {
|
|
abort()
|
|
}
|
|
|
|
function _emscripten_get_now_is_monotonic() {
|
|
return ENVIRONMENT_IS_NODE || typeof dateNow !== "undefined" || (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self["performance"] && self["performance"]["now"]
|
|
}
|
|
|
|
function _clock_gettime(clk_id, tp) {
|
|
var now;
|
|
if (clk_id === 0) {
|
|
now = Date.now()
|
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
|
|
now = _emscripten_get_now()
|
|
} else {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1
|
|
}
|
|
HEAP32[tp >> 2] = now / 1e3 | 0;
|
|
HEAP32[tp + 4 >> 2] = now % 1e3 * 1e3 * 1e3 | 0;
|
|
return 0
|
|
}
|
|
|
|
function ___clock_gettime() {
|
|
return _clock_gettime.apply(null, arguments)
|
|
}
|
|
|
|
function __embind_register_function(name, argCount, rawArgTypesAddr, signature, rawInvoker, fn) {
|
|
var argTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
|
|
name = readLatin1String(name);
|
|
rawInvoker = requireFunction(signature, rawInvoker);
|
|
exposePublicSymbol(name, (function() {
|
|
throwUnboundTypeError("Cannot call " + name + " due to unbound types", argTypes)
|
|
}), argCount - 1);
|
|
whenDependentTypesAreResolved([], argTypes, (function(argTypes) {
|
|
var invokerArgsArray = [argTypes[0], null].concat(argTypes.slice(1));
|
|
replacePublicSymbol(name, craftInvokerFunction(name, invokerArgsArray, null, rawInvoker, fn), argCount - 1);
|
|
return []
|
|
}))
|
|
}
|
|
|
|
function __embind_register_constant(name, type, value) {
|
|
name = readLatin1String(name);
|
|
whenDependentTypesAreResolved([], [type], (function(type) {
|
|
type = type[0];
|
|
Module[name] = type["fromWireType"](value);
|
|
return []
|
|
}))
|
|
}
|
|
|
|
function ___cxa_begin_catch(ptr) {
|
|
var info = EXCEPTIONS.infos[ptr];
|
|
if (info && !info.caught) {
|
|
info.caught = true;
|
|
__ZSt18uncaught_exceptionv.uncaught_exception--
|
|
}
|
|
if (info) info.rethrown = false;
|
|
EXCEPTIONS.caught.push(ptr);
|
|
EXCEPTIONS.addRef(EXCEPTIONS.deAdjust(ptr));
|
|
return ptr
|
|
}
|
|
|
|
function ___syscall3(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
return FS.read(stream, HEAP8, buf, count)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall5(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var pathname = SYSCALLS.getStr(),
|
|
flags = SYSCALLS.get(),
|
|
mode = SYSCALLS.get();
|
|
var stream = FS.open(pathname, flags, mode);
|
|
return stream.fd
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall4(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
buf = SYSCALLS.get(),
|
|
count = SYSCALLS.get();
|
|
return FS.write(stream, HEAP8, buf, count)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall6(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD();
|
|
FS.close(stream);
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function enumReadValueFromPointer(name, shift, signed) {
|
|
switch (shift) {
|
|
case 0:
|
|
return (function(pointer) {
|
|
var heap = signed ? HEAP8 : HEAPU8;
|
|
return this["fromWireType"](heap[pointer])
|
|
});
|
|
case 1:
|
|
return (function(pointer) {
|
|
var heap = signed ? HEAP16 : HEAPU16;
|
|
return this["fromWireType"](heap[pointer >> 1])
|
|
});
|
|
case 2:
|
|
return (function(pointer) {
|
|
var heap = signed ? HEAP32 : HEAPU32;
|
|
return this["fromWireType"](heap[pointer >> 2])
|
|
});
|
|
default:
|
|
throw new TypeError("Unknown integer type: " + name)
|
|
}
|
|
}
|
|
|
|
function __embind_register_enum(rawType, name, size, isSigned) {
|
|
var shift = getShiftFromSize(size);
|
|
name = readLatin1String(name);
|
|
|
|
function ctor() {}
|
|
ctor.values = {};
|
|
registerType(rawType, {
|
|
name: name,
|
|
constructor: ctor,
|
|
"fromWireType": (function(c) {
|
|
return this.constructor.values[c]
|
|
}),
|
|
"toWireType": (function(destructors, c) {
|
|
return c.value
|
|
}),
|
|
"argPackAdvance": 8,
|
|
"readValueFromPointer": enumReadValueFromPointer(name, shift, isSigned),
|
|
destructorFunction: null
|
|
});
|
|
exposePublicSymbol(name, ctor)
|
|
}
|
|
|
|
function __embind_register_class_constructor(rawClassType, argCount, rawArgTypesAddr, invokerSignature, invoker, rawConstructor) {
|
|
var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
|
|
invoker = requireFunction(invokerSignature, invoker);
|
|
whenDependentTypesAreResolved([], [rawClassType], (function(classType) {
|
|
classType = classType[0];
|
|
var humanName = "constructor " + classType.name;
|
|
if (undefined === classType.registeredClass.constructor_body) {
|
|
classType.registeredClass.constructor_body = []
|
|
}
|
|
if (undefined !== classType.registeredClass.constructor_body[argCount - 1]) {
|
|
throw new BindingError("Cannot register multiple constructors with identical number of parameters (" + (argCount - 1) + ") for class '" + classType.name + "'! Overload resolution is currently only performed using the parameter count, not actual type info!")
|
|
}
|
|
classType.registeredClass.constructor_body[argCount - 1] = function unboundTypeHandler() {
|
|
throwUnboundTypeError("Cannot construct " + classType.name + " due to unbound types", rawArgTypes)
|
|
};
|
|
whenDependentTypesAreResolved([], rawArgTypes, (function(argTypes) {
|
|
classType.registeredClass.constructor_body[argCount - 1] = function constructor_body() {
|
|
if (arguments.length !== argCount - 1) {
|
|
throwBindingError(humanName + " called with " + arguments.length + " arguments, expected " + (argCount - 1))
|
|
}
|
|
var destructors = [];
|
|
var args = new Array(argCount);
|
|
args[0] = rawConstructor;
|
|
for (var i = 1; i < argCount; ++i) {
|
|
args[i] = argTypes[i]["toWireType"](destructors, arguments[i - 1])
|
|
}
|
|
var ptr = invoker.apply(null, args);
|
|
runDestructors(destructors);
|
|
return argTypes[0]["fromWireType"](ptr)
|
|
};
|
|
return []
|
|
}));
|
|
return []
|
|
}))
|
|
}
|
|
|
|
function ___syscall140(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
offset_high = SYSCALLS.get(),
|
|
offset_low = SYSCALLS.get(),
|
|
result = SYSCALLS.get(),
|
|
whence = SYSCALLS.get();
|
|
var offset = offset_low;
|
|
FS.llseek(stream, offset, whence);
|
|
HEAP32[result >> 2] = stream.position;
|
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null;
|
|
return 0
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function __embind_register_class_function(rawClassType, methodName, argCount, rawArgTypesAddr, invokerSignature, rawInvoker, context, isPureVirtual) {
|
|
var rawArgTypes = heap32VectorToArray(argCount, rawArgTypesAddr);
|
|
methodName = readLatin1String(methodName);
|
|
rawInvoker = requireFunction(invokerSignature, rawInvoker);
|
|
whenDependentTypesAreResolved([], [rawClassType], (function(classType) {
|
|
classType = classType[0];
|
|
var humanName = classType.name + "." + methodName;
|
|
if (isPureVirtual) {
|
|
classType.registeredClass.pureVirtualFunctions.push(methodName)
|
|
}
|
|
|
|
function unboundTypesHandler() {
|
|
throwUnboundTypeError("Cannot call " + humanName + " due to unbound types", rawArgTypes)
|
|
}
|
|
var proto = classType.registeredClass.instancePrototype;
|
|
var method = proto[methodName];
|
|
if (undefined === method || undefined === method.overloadTable && method.className !== classType.name && method.argCount === argCount - 2) {
|
|
unboundTypesHandler.argCount = argCount - 2;
|
|
unboundTypesHandler.className = classType.name;
|
|
proto[methodName] = unboundTypesHandler
|
|
} else {
|
|
ensureOverloadTable(proto, methodName, humanName);
|
|
proto[methodName].overloadTable[argCount - 2] = unboundTypesHandler
|
|
}
|
|
whenDependentTypesAreResolved([], rawArgTypes, (function(argTypes) {
|
|
var memberFunction = craftInvokerFunction(humanName, argTypes, classType, rawInvoker, context);
|
|
if (undefined === proto[methodName].overloadTable) {
|
|
memberFunction.argCount = argCount - 2;
|
|
proto[methodName] = memberFunction
|
|
} else {
|
|
proto[methodName].overloadTable[argCount - 2] = memberFunction
|
|
}
|
|
return []
|
|
}));
|
|
return []
|
|
}))
|
|
}
|
|
|
|
function ___syscall146(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
iov = SYSCALLS.get(),
|
|
iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doWritev(stream, iov, iovcnt)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall221(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
cmd = SYSCALLS.get();
|
|
switch (cmd) {
|
|
case 0:
|
|
{
|
|
var arg = SYSCALLS.get();
|
|
if (arg < 0) {
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
var newStream;
|
|
newStream = FS.open(stream.path, stream.flags, 0, arg);
|
|
return newStream.fd
|
|
};
|
|
case 1:
|
|
case 2:
|
|
return 0;
|
|
case 3:
|
|
return stream.flags;
|
|
case 4:
|
|
{
|
|
var arg = SYSCALLS.get();
|
|
stream.flags |= arg;
|
|
return 0
|
|
};
|
|
case 12:
|
|
case 12:
|
|
{
|
|
var arg = SYSCALLS.get();
|
|
var offset = 0;
|
|
HEAP16[arg + offset >> 1] = 2;
|
|
return 0
|
|
};
|
|
case 13:
|
|
case 14:
|
|
case 13:
|
|
case 14:
|
|
return 0;
|
|
case 16:
|
|
case 8:
|
|
return -ERRNO_CODES.EINVAL;
|
|
case 9:
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
default:
|
|
{
|
|
return -ERRNO_CODES.EINVAL
|
|
}
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
|
|
function ___syscall145(which, varargs) {
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
var stream = SYSCALLS.getStreamFromFD(),
|
|
iov = SYSCALLS.get(),
|
|
iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doReadv(stream, iov, iovcnt)
|
|
} catch (e) {
|
|
if (typeof FS === "undefined" || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno
|
|
}
|
|
}
|
|
var ___dso_handle = STATICTOP;
|
|
STATICTOP += 16;
|
|
embind_init_charCodes();
|
|
init_emval();
|
|
BindingError = Module["BindingError"] = extendError(Error, "BindingError");
|
|
InternalError = Module["InternalError"] = extendError(Error, "InternalError");
|
|
FS.staticInit();
|
|
__ATINIT__.unshift((function() {
|
|
if (!Module["noFSInit"] && !FS.init.initialized) FS.init()
|
|
}));
|
|
__ATMAIN__.push((function() {
|
|
FS.ignorePermissions = false
|
|
}));
|
|
__ATEXIT__.push((function() {
|
|
FS.quit()
|
|
}));
|
|
Module["FS_createFolder"] = FS.createFolder;
|
|
Module["FS_createPath"] = FS.createPath;
|
|
Module["FS_createDataFile"] = FS.createDataFile;
|
|
Module["FS_createPreloadedFile"] = FS.createPreloadedFile;
|
|
Module["FS_createLazyFile"] = FS.createLazyFile;
|
|
Module["FS_createLink"] = FS.createLink;
|
|
Module["FS_createDevice"] = FS.createDevice;
|
|
Module["FS_unlink"] = FS.unlink;
|
|
__ATINIT__.unshift((function() {
|
|
TTY.init()
|
|
}));
|
|
__ATEXIT__.push((function() {
|
|
TTY.shutdown()
|
|
}));
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
var fs = require("fs");
|
|
var NODEJS_PATH = require("path");
|
|
NODEFS.staticInit()
|
|
}
|
|
init_RegisteredPointer();
|
|
init_embind();
|
|
UnboundTypeError = Module["UnboundTypeError"] = extendError(Error, "UnboundTypeError");
|
|
___buildEnvironment(ENV);
|
|
init_ClassHandle();
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
_emscripten_get_now = function _emscripten_get_now_actual() {
|
|
var t = process["hrtime"]();
|
|
return t[0] * 1e3 + t[1] / 1e6
|
|
}
|
|
} else if (typeof dateNow !== "undefined") {
|
|
_emscripten_get_now = dateNow
|
|
} else if (typeof self === "object" && self["performance"] && typeof self["performance"]["now"] === "function") {
|
|
_emscripten_get_now = (function() {
|
|
return self["performance"]["now"]()
|
|
})
|
|
} else if (typeof performance === "object" && typeof performance["now"] === "function") {
|
|
_emscripten_get_now = (function() {
|
|
return performance["now"]()
|
|
})
|
|
} else {
|
|
_emscripten_get_now = Date.now
|
|
}
|
|
DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);
|
|
STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
|
|
STACK_MAX = STACK_BASE + TOTAL_STACK;
|
|
DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);
|
|
HEAP32[DYNAMICTOP_PTR >> 2] = DYNAMIC_BASE;
|
|
staticSealed = true;
|
|
Module["wasmTableSize"] = 8300;
|
|
Module["wasmMaxTableSize"] = 8300;
|
|
|
|
function invoke_viiifiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiifiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiid(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iiiiiid"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiddd(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiiddd"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiidiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiidiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iiiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidddiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
try {
|
|
Module["dynCall_viiiidddiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiffiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
try {
|
|
Module["dynCall_viiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iidd(index, a1, a2, a3) {
|
|
try {
|
|
return Module["dynCall_iidd"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
try {
|
|
Module["dynCall_viiiiiiiiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiffii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiffii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iidi(index, a1, a2, a3) {
|
|
try {
|
|
return Module["dynCall_iidi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_dii(index, a1, a2) {
|
|
try {
|
|
return Module["dynCall_dii"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifff(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiifff"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifff(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iifff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vidi(index, a1, a2, a3) {
|
|
try {
|
|
Module["dynCall_vidi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiiiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
return Module["dynCall_fiiiiiiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiddii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiddii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiddiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiiddiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_iiiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiidi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiiidi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiddidddd(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiddidddd"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiddi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiiddi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiidi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiiiiidi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fii(index, a1, a2) {
|
|
try {
|
|
return Module["dynCall_fii"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiidii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiifii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiifii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
return Module["dynCall_iiifiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_di(index, a1) {
|
|
try {
|
|
return Module["dynCall_di"](index, a1)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiid(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viiiid"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viifiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiidiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiididii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiididii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
return Module["dynCall_diiiiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiddiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
return Module["dynCall_iiiiiddiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidddddi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viidddddi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
return Module["dynCall_fiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiddiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiidddddi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_iiidddddi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diidi(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_diidi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
return Module["dynCall_iiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiid(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiiid"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiif(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiiif"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
return Module["dynCall_iiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiddiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiddiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiddiid(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiddiid"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiididiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13) {
|
|
try {
|
|
return Module["dynCall_iiiiiiiididiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12, a13)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiffiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_iiiiffiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iidddd(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_iidddd"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidiiid(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viidiiid"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiidiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidiiid(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiidiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiif(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viiif"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiiddi(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_diiiddi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiii(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifffffii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_iifffffii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_diiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidd(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viiidd"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddddii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiddddii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiid(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiiid"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiddddii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiiddddii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifi(index, a1, a2, a3) {
|
|
try {
|
|
Module["dynCall_vifi"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifff(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_vifff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiidiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiii(index, a1, a2, a3) {
|
|
try {
|
|
return Module["dynCall_fiii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiddidd(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiddidd"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidi(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viiidi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiidii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_iiiiiidii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiddd(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiddd"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiddi(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_diiddi"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diii(index, a1, a2, a3) {
|
|
try {
|
|
return Module["dynCall_diii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddd(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiddd"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddidddd(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiddidddd"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiiiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
try {
|
|
Module["dynCall_viiiiiiiiiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddidd(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiddidd"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidiiiidi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiidiiiidi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddi(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiddi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiii(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_fiiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_iiiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiid(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viiid"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiij(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iiiiij"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiffi(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iiiiffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viidii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiff(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viiiff"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiid(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_iiiiid"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiif(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_iiiiif"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vif(index, a1, a2) {
|
|
try {
|
|
Module["dynCall_vif"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vid(index, a1, a2) {
|
|
try {
|
|
Module["dynCall_vid"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiidi(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiidi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiidd(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiidd"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vii(index, a1, a2) {
|
|
try {
|
|
Module["dynCall_vii"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiffff(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_iiffff"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiifiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidd(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viidd"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viifii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viidi(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viidi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiffii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiffii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiidiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiidii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iiiidii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiid(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_diiid"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiidddiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiidddiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiid(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiiiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiii(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_diiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiidiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
try {
|
|
Module["dynCall_viiiiidiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiddddddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiddddddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiifi(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iiiiifi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiiiiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
return Module["dynCall_fiiiiiiiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiifii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiifii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiidii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiidii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_fiiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iif(index, a1, a2) {
|
|
try {
|
|
return Module["dynCall_iif"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiiiiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiiiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidi(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiidi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiddiiid(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiiddiiid"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiid(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiiiid"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iii(index, a1, a2) {
|
|
try {
|
|
return Module["dynCall_iii"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiddii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiidi(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiiiidi"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vdiii(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_vdiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiddddddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
return Module["dynCall_iiiddddddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiidiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
try {
|
|
Module["dynCall_viiiiidiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viii(index, a1, a2, a3) {
|
|
try {
|
|
Module["dynCall_viii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_v(index) {
|
|
try {
|
|
Module["dynCall_v"](index)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viid(index, a1, a2, a3) {
|
|
try {
|
|
Module["dynCall_viid"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiff(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiiff"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viif(index, a1, a2, a3) {
|
|
try {
|
|
Module["dynCall_viif"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiddiid(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
return Module["dynCall_iiiddiid"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiidiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiiidiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vi(index, a1) {
|
|
try {
|
|
Module["dynCall_vi"](index, a1)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidiiiidi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11) {
|
|
try {
|
|
Module["dynCall_viiiidiiiidi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_ii(index, a1) {
|
|
try {
|
|
return Module["dynCall_ii"](index, a1)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viijii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viijii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifff(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiifff"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiddi(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10) {
|
|
try {
|
|
Module["dynCall_viiiiiiiddi"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viifi(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viifi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiff(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viiff"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiffi(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiiffi"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiifi(index, a1, a2, a3, a4) {
|
|
try {
|
|
return Module["dynCall_iiifi"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vidii(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_vidii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vididdii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_vididdii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiddiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viiiddiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiffii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiffii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiidiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
try {
|
|
Module["dynCall_viiiiiidiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fiiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_fiiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiifii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viiiifii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viffff(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_viffff"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiii(index, a1, a2, a3) {
|
|
try {
|
|
return Module["dynCall_iiii"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viididii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
Module["dynCall_viididii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiif(index, a1, a2, a3) {
|
|
try {
|
|
return Module["dynCall_iiif"](index, a1, a2, a3)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiffi(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiffi"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiiii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_diiiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiiid(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_diiiid"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12) {
|
|
try {
|
|
return Module["dynCall_iiiiiiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9, a10, a11, a12)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiifiii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
return Module["dynCall_iiiifiii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_fi(index, a1) {
|
|
try {
|
|
return Module["dynCall_fi"](index, a1)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiffii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiiiffii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiidid(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
return Module["dynCall_iiidid"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iid(index, a1, a2) {
|
|
try {
|
|
return Module["dynCall_iid"](index, a1, a2)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_i(index) {
|
|
try {
|
|
return Module["dynCall_i"](index)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiidii(index, a1, a2, a3, a4, a5, a6, a7) {
|
|
try {
|
|
return Module["dynCall_iiiiidii"](index, a1, a2, a3, a4, a5, a6, a7)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_diiiiii(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_diiiiii"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vifffff(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_vifffff"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiidiii(index, a1, a2, a3, a4, a5, a6, a7, a8, a9) {
|
|
try {
|
|
Module["dynCall_viiiiidiii"](index, a1, a2, a3, a4, a5, a6, a7, a8, a9)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iiiiiiiii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
return Module["dynCall_iiiiiiiii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viididdii(index, a1, a2, a3, a4, a5, a6, a7, a8) {
|
|
try {
|
|
Module["dynCall_viididdii"](index, a1, a2, a3, a4, a5, a6, a7, a8)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiii(index, a1, a2, a3, a4) {
|
|
try {
|
|
Module["dynCall_viiii"](index, a1, a2, a3, a4)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_viiiidd(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
Module["dynCall_viiiidd"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_vidiii(index, a1, a2, a3, a4, a5) {
|
|
try {
|
|
Module["dynCall_vidiii"](index, a1, a2, a3, a4, a5)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
|
|
function invoke_iifffff(index, a1, a2, a3, a4, a5, a6) {
|
|
try {
|
|
return Module["dynCall_iifffff"](index, a1, a2, a3, a4, a5, a6)
|
|
} catch (e) {
|
|
if (typeof e !== "number" && e !== "longjmp") throw e;
|
|
Module["setThrew"](1, 0)
|
|
}
|
|
}
|
|
Module.asmGlobalArg = {
|
|
"Math": Math,
|
|
"Int8Array": Int8Array,
|
|
"Int16Array": Int16Array,
|
|
"Int32Array": Int32Array,
|
|
"Uint8Array": Uint8Array,
|
|
"Uint16Array": Uint16Array,
|
|
"Uint32Array": Uint32Array,
|
|
"Float32Array": Float32Array,
|
|
"Float64Array": Float64Array,
|
|
"NaN": NaN,
|
|
"Infinity": Infinity,
|
|
"byteLength": byteLength
|
|
};
|
|
Module.asmLibraryArg = {
|
|
"abort": abort,
|
|
"assert": assert,
|
|
"enlargeMemory": enlargeMemory,
|
|
"getTotalMemory": getTotalMemory,
|
|
"abortOnCannotGrowMemory": abortOnCannotGrowMemory,
|
|
"invoke_viiifiii": invoke_viiifiii,
|
|
"invoke_iiiiiid": invoke_iiiiiid,
|
|
"invoke_viiiiddd": invoke_viiiiddd,
|
|
"invoke_viiiidiii": invoke_viiiidiii,
|
|
"invoke_viiiiiddi": invoke_viiiiiddi,
|
|
"invoke_viiidiii": invoke_viiidiii,
|
|
"invoke_iiiiiii": invoke_iiiiiii,
|
|
"invoke_viiiidddiiii": invoke_viiiidddiiii,
|
|
"invoke_viiiffiii": invoke_viiiffiii,
|
|
"invoke_viiiiiiiiiii": invoke_viiiiiiiiiii,
|
|
"invoke_iidd": invoke_iidd,
|
|
"invoke_viiiiiiiiiid": invoke_viiiiiiiiiid,
|
|
"invoke_viiffii": invoke_viiffii,
|
|
"invoke_iidi": invoke_iidi,
|
|
"invoke_dii": invoke_dii,
|
|
"invoke_viiifff": invoke_viiifff,
|
|
"invoke_iifff": invoke_iifff,
|
|
"invoke_vidi": invoke_vidi,
|
|
"invoke_fiiiiiiiid": invoke_fiiiiiiiid,
|
|
"invoke_viiddii": invoke_viiddii,
|
|
"invoke_viiiiddiddi": invoke_viiiiddiddi,
|
|
"invoke_iiiiifiii": invoke_iiiiifiii,
|
|
"invoke_viiiiidi": invoke_viiiiidi,
|
|
"invoke_viiddidddd": invoke_viiddidddd,
|
|
"invoke_viiiiddi": invoke_viiiiddi,
|
|
"invoke_viiiiiiidi": invoke_viiiiiiidi,
|
|
"invoke_fii": invoke_fii,
|
|
"invoke_viiidii": invoke_viiidii,
|
|
"invoke_viiiiifii": invoke_viiiiifii,
|
|
"invoke_iiifiiiiiii": invoke_iiifiiiiiii,
|
|
"invoke_di": invoke_di,
|
|
"invoke_viiiid": invoke_viiiid,
|
|
"invoke_viifiiiiiii": invoke_viifiiiiiii,
|
|
"invoke_viiiidiiddi": invoke_viiiidiiddi,
|
|
"invoke_viiididii": invoke_viiididii,
|
|
"invoke_diiiiiii": invoke_diiiiiii,
|
|
"invoke_iiiiiddiddi": invoke_iiiiiddiddi,
|
|
"invoke_viidddddi": invoke_viidddddi,
|
|
"invoke_fiiiiiii": invoke_fiiiiiii,
|
|
"invoke_viiiddiiid": invoke_viiiddiiid,
|
|
"invoke_iiidddddi": invoke_iiidddddi,
|
|
"invoke_diidi": invoke_diidi,
|
|
"invoke_viiiiiiiiiiddi": invoke_viiiiiiiiiiddi,
|
|
"invoke_iiiiiiiiii": invoke_iiiiiiiiii,
|
|
"invoke_iiiid": invoke_iiiid,
|
|
"invoke_iiiif": invoke_iiiif,
|
|
"invoke_iiiiiiii": invoke_iiiiiiii,
|
|
"invoke_viiddiii": invoke_viiddiii,
|
|
"invoke_viiddiid": invoke_viiddiid,
|
|
"invoke_iiiiiiiididiii": invoke_iiiiiiiididiii,
|
|
"invoke_iiiiffiii": invoke_iiiiffiii,
|
|
"invoke_iidddd": invoke_iidddd,
|
|
"invoke_viidiiid": invoke_viidiiid,
|
|
"invoke_viiiidiiii": invoke_viiiidiiii,
|
|
"invoke_viiidiiid": invoke_viiidiiid,
|
|
"invoke_viiif": invoke_viiif,
|
|
"invoke_diiiddi": invoke_diiiddi,
|
|
"invoke_iiiii": invoke_iiiii,
|
|
"invoke_iifffffii": invoke_iifffffii,
|
|
"invoke_diiiiiiii": invoke_diiiiiiii,
|
|
"invoke_viiidd": invoke_viiidd,
|
|
"invoke_viiiddddii": invoke_viiiddddii,
|
|
"invoke_viiiiid": invoke_viiiiid,
|
|
"invoke_viiiiddddii": invoke_viiiiddddii,
|
|
"invoke_vifi": invoke_vifi,
|
|
"invoke_vifff": invoke_vifff,
|
|
"invoke_viiiiii": invoke_viiiiii,
|
|
"invoke_viiidiiii": invoke_viiidiiii,
|
|
"invoke_fiii": invoke_fiii,
|
|
"invoke_viiddidd": invoke_viiddidd,
|
|
"invoke_viiidi": invoke_viiidi,
|
|
"invoke_iiiiiidii": invoke_iiiiiidii,
|
|
"invoke_iiddd": invoke_iiddd,
|
|
"invoke_viiiiiiiiii": invoke_viiiiiiiiii,
|
|
"invoke_diiddi": invoke_diiddi,
|
|
"invoke_diii": invoke_diii,
|
|
"invoke_viiiddd": invoke_viiiddd,
|
|
"invoke_viiiddidddd": invoke_viiiddidddd,
|
|
"invoke_viiiiiiiiiiid": invoke_viiiiiiiiiiid,
|
|
"invoke_viiiddidd": invoke_viiiddidd,
|
|
"invoke_viiidiiiidi": invoke_viiidiiiidi,
|
|
"invoke_viiiddi": invoke_viiiddi,
|
|
"invoke_fiiii": invoke_fiiii,
|
|
"invoke_iiiiii": invoke_iiiiii,
|
|
"invoke_viiid": invoke_viiid,
|
|
"invoke_iiiiij": invoke_iiiiij,
|
|
"invoke_iiiiffi": invoke_iiiiffi,
|
|
"invoke_viidii": invoke_viidii,
|
|
"invoke_viiiff": invoke_viiiff,
|
|
"invoke_iiiiid": invoke_iiiiid,
|
|
"invoke_iiiiif": invoke_iiiiif,
|
|
"invoke_viiiii": invoke_viiiii,
|
|
"invoke_vif": invoke_vif,
|
|
"invoke_vid": invoke_vid,
|
|
"invoke_iiidi": invoke_iiidi,
|
|
"invoke_iiidd": invoke_iiidd,
|
|
"invoke_vii": invoke_vii,
|
|
"invoke_iiffff": invoke_iiffff,
|
|
"invoke_viiiifiii": invoke_viiiifiii,
|
|
"invoke_viidd": invoke_viidd,
|
|
"invoke_viifii": invoke_viifii,
|
|
"invoke_viidi": invoke_viidi,
|
|
"invoke_viiiiffii": invoke_viiiiffii,
|
|
"invoke_viiidiiddi": invoke_viiidiiddi,
|
|
"invoke_iiiidii": invoke_iiiidii,
|
|
"invoke_diiid": invoke_diiid,
|
|
"invoke_viiiiiiii": invoke_viiiiiiii,
|
|
"invoke_viiidddiiii": invoke_viiidddiiii,
|
|
"invoke_viiiiiiid": invoke_viiiiiiid,
|
|
"invoke_viiiiiiddi": invoke_viiiiiiddi,
|
|
"invoke_diiii": invoke_diiii,
|
|
"invoke_viiiiidiiddi": invoke_viiiiidiiddi,
|
|
"invoke_viiddddddi": invoke_viiddddddi,
|
|
"invoke_iiiiifi": invoke_iiiiifi,
|
|
"invoke_fiiiiiiiiid": invoke_fiiiiiiiiid,
|
|
"invoke_viiifii": invoke_viiifii,
|
|
"invoke_viiiiidii": invoke_viiiiidii,
|
|
"invoke_fiiiii": invoke_fiiiii,
|
|
"invoke_iif": invoke_iif,
|
|
"invoke_viiiiiiiid": invoke_viiiiiiiid,
|
|
"invoke_viiiiiii": invoke_viiiiiii,
|
|
"invoke_viiiidi": invoke_viiiidi,
|
|
"invoke_viiiiddiiid": invoke_viiiiddiiid,
|
|
"invoke_viiiiiid": invoke_viiiiiid,
|
|
"invoke_viiiiiiiii": invoke_viiiiiiiii,
|
|
"invoke_iii": invoke_iii,
|
|
"invoke_viiiddii": invoke_viiiddii,
|
|
"invoke_viiiiiidi": invoke_viiiiiidi,
|
|
"invoke_vdiii": invoke_vdiii,
|
|
"invoke_iiiddddddi": invoke_iiiddddddi,
|
|
"invoke_viiiiidiiiii": invoke_viiiiidiiiii,
|
|
"invoke_viii": invoke_viii,
|
|
"invoke_v": invoke_v,
|
|
"invoke_viid": invoke_viid,
|
|
"invoke_viiiiff": invoke_viiiiff,
|
|
"invoke_viif": invoke_viif,
|
|
"invoke_iiiddiid": invoke_iiiddiid,
|
|
"invoke_viiiiidiiii": invoke_viiiiidiiii,
|
|
"invoke_vi": invoke_vi,
|
|
"invoke_iiiiiiiiiii": invoke_iiiiiiiiiii,
|
|
"invoke_viiiidiiiidi": invoke_viiiidiiiidi,
|
|
"invoke_ii": invoke_ii,
|
|
"invoke_viijii": invoke_viijii,
|
|
"invoke_viiiifff": invoke_viiiifff,
|
|
"invoke_viiiiiiiddi": invoke_viiiiiiiddi,
|
|
"invoke_viifi": invoke_viifi,
|
|
"invoke_viiff": invoke_viiff,
|
|
"invoke_viiiiffi": invoke_viiiiffi,
|
|
"invoke_iiifi": invoke_iiifi,
|
|
"invoke_vidii": invoke_vidii,
|
|
"invoke_vididdii": invoke_vididdii,
|
|
"invoke_viiiddiii": invoke_viiiddiii,
|
|
"invoke_viiiffii": invoke_viiiffii,
|
|
"invoke_viiiiiidiiiii": invoke_viiiiiidiiiii,
|
|
"invoke_fiiiiii": invoke_fiiiiii,
|
|
"invoke_viiiifii": invoke_viiiifii,
|
|
"invoke_viffff": invoke_viffff,
|
|
"invoke_iiii": invoke_iiii,
|
|
"invoke_viididii": invoke_viididii,
|
|
"invoke_iiif": invoke_iiif,
|
|
"invoke_viiiffi": invoke_viiiffi,
|
|
"invoke_diiiii": invoke_diiiii,
|
|
"invoke_diiiid": invoke_diiiid,
|
|
"invoke_iiiiiiiiiiiii": invoke_iiiiiiiiiiiii,
|
|
"invoke_iiiifiii": invoke_iiiifiii,
|
|
"invoke_fi": invoke_fi,
|
|
"invoke_viiiiiffii": invoke_viiiiiffii,
|
|
"invoke_iiidid": invoke_iiidid,
|
|
"invoke_iid": invoke_iid,
|
|
"invoke_i": invoke_i,
|
|
"invoke_iiiiidii": invoke_iiiiidii,
|
|
"invoke_diiiiii": invoke_diiiiii,
|
|
"invoke_vifffff": invoke_vifffff,
|
|
"invoke_viiiiidiii": invoke_viiiiidiii,
|
|
"invoke_iiiiiiiii": invoke_iiiiiiiii,
|
|
"invoke_viididdii": invoke_viididdii,
|
|
"invoke_viiii": invoke_viiii,
|
|
"invoke_viiiidd": invoke_viiiidd,
|
|
"invoke_vidiii": invoke_vidiii,
|
|
"invoke_iifffff": invoke_iifffff,
|
|
"___syscall221": ___syscall221,
|
|
"floatReadValueFromPointer": floatReadValueFromPointer,
|
|
"simpleReadValueFromPointer": simpleReadValueFromPointer,
|
|
"throwInternalError": throwInternalError,
|
|
"get_first_emval": get_first_emval,
|
|
"whenDependentTypesAreResolved": whenDependentTypesAreResolved,
|
|
"constNoSmartPtrRawPointerToWireType": constNoSmartPtrRawPointerToWireType,
|
|
"getLiveInheritedInstances": getLiveInheritedInstances,
|
|
"___assert_fail": ___assert_fail,
|
|
"__ZSt18uncaught_exceptionv": __ZSt18uncaught_exceptionv,
|
|
"ClassHandle": ClassHandle,
|
|
"getShiftFromSize": getShiftFromSize,
|
|
"__emval_get_property": __emval_get_property,
|
|
"_llvm_exp2_f64": _llvm_exp2_f64,
|
|
"_clock_gettime": _clock_gettime,
|
|
"___cxa_begin_catch": ___cxa_begin_catch,
|
|
"_emscripten_memcpy_big": _emscripten_memcpy_big,
|
|
"runDestructor": runDestructor,
|
|
"throwInstanceAlreadyDeleted": throwInstanceAlreadyDeleted,
|
|
"__embind_register_std_string": __embind_register_std_string,
|
|
"init_RegisteredPointer": init_RegisteredPointer,
|
|
"___lock": ___lock,
|
|
"getStringOrSymbol": getStringOrSymbol,
|
|
"flushPendingDeletes": flushPendingDeletes,
|
|
"__embind_register_enum_value": __embind_register_enum_value,
|
|
"makeClassHandle": makeClassHandle,
|
|
"__isLeapYear": __isLeapYear,
|
|
"__embind_register_class_constructor": __embind_register_class_constructor,
|
|
"___cxa_atexit": ___cxa_atexit,
|
|
"__embind_finalize_value_array": __embind_finalize_value_array,
|
|
"init_ClassHandle": init_ClassHandle,
|
|
"__embind_register_constant": __embind_register_constant,
|
|
"___syscall140": ___syscall140,
|
|
"ClassHandle_clone": ClassHandle_clone,
|
|
"___syscall145": ___syscall145,
|
|
"___syscall146": ___syscall146,
|
|
"_emscripten_get_now_is_monotonic": _emscripten_get_now_is_monotonic,
|
|
"throwBindingError": throwBindingError,
|
|
"RegisteredClass": RegisteredClass,
|
|
"___cxa_find_matching_catch": ___cxa_find_matching_catch,
|
|
"__embind_register_value_object_field": __embind_register_value_object_field,
|
|
"embind_init_charCodes": embind_init_charCodes,
|
|
"__emval_as": __emval_as,
|
|
"___setErrNo": ___setErrNo,
|
|
"__embind_register_class_class_function": __embind_register_class_class_function,
|
|
"_llvm_pow_f32": _llvm_pow_f32,
|
|
"__embind_register_bool": __embind_register_bool,
|
|
"___resumeException": ___resumeException,
|
|
"createNamedFunction": createNamedFunction,
|
|
"__embind_register_class_property": __embind_register_class_property,
|
|
"__embind_register_emval": __embind_register_emval,
|
|
"___buildEnvironment": ___buildEnvironment,
|
|
"__embind_finalize_value_object": __embind_finalize_value_object,
|
|
"__emval_decref": __emval_decref,
|
|
"_pthread_once": _pthread_once,
|
|
"_llvm_trap": _llvm_trap,
|
|
"__embind_register_class": __embind_register_class,
|
|
"___syscall91": ___syscall91,
|
|
"heap32VectorToArray": heap32VectorToArray,
|
|
"_emscripten_get_now": _emscripten_get_now,
|
|
"___syscall10": ___syscall10,
|
|
"__emval_run_destructors": __emval_run_destructors,
|
|
"ClassHandle_delete": ClassHandle_delete,
|
|
"__ZN2cv3EMDERKNS_11_InputArrayES2_iS2_PfRKNS_12_OutputArrayE": __ZN2cv3EMDERKNS_11_InputArrayES2_iS2_PfRKNS_12_OutputArrayE,
|
|
"___syscall3": ___syscall3,
|
|
"__addDays": __addDays,
|
|
"_llvm_exp2_f32": _llvm_exp2_f32,
|
|
"___syscall6": ___syscall6,
|
|
"___syscall5": ___syscall5,
|
|
"ensureOverloadTable": ensureOverloadTable,
|
|
"_gettimeofday": _gettimeofday,
|
|
"new_": new_,
|
|
"downcastPointer": downcastPointer,
|
|
"replacePublicSymbol": replacePublicSymbol,
|
|
"init_embind": init_embind,
|
|
"_llvm_pow_f64": _llvm_pow_f64,
|
|
"ClassHandle_deleteLater": ClassHandle_deleteLater,
|
|
"___syscall54": ___syscall54,
|
|
"RegisteredPointer_deleteObject": RegisteredPointer_deleteObject,
|
|
"ClassHandle_isDeleted": ClassHandle_isDeleted,
|
|
"__embind_register_integer": __embind_register_integer,
|
|
"___cxa_allocate_exception": ___cxa_allocate_exception,
|
|
"__emval_take_value": __emval_take_value,
|
|
"__embind_register_value_object": __embind_register_value_object,
|
|
"enumReadValueFromPointer": enumReadValueFromPointer,
|
|
"getTypeName": getTypeName,
|
|
"___clock_gettime": ___clock_gettime,
|
|
"_strftime": _strftime,
|
|
"__embind_register_class_function": __embind_register_class_function,
|
|
"throwUnboundTypeError": throwUnboundTypeError,
|
|
"craftInvokerFunction": craftInvokerFunction,
|
|
"_getenv": _getenv,
|
|
"runDestructors": runDestructors,
|
|
"requireRegisteredType": requireRegisteredType,
|
|
"makeLegalFunctionName": makeLegalFunctionName,
|
|
"_pthread_key_create": _pthread_key_create,
|
|
"upcastPointer": upcastPointer,
|
|
"init_emval": init_emval,
|
|
"shallowCopyInternalPointer": shallowCopyInternalPointer,
|
|
"nonConstNoSmartPtrRawPointerToWireType": nonConstNoSmartPtrRawPointerToWireType,
|
|
"__embind_register_value_array": __embind_register_value_array,
|
|
"_abort": _abort,
|
|
"requireHandle": requireHandle,
|
|
"_embind_repr": _embind_repr,
|
|
"validateThis": validateThis,
|
|
"exposePublicSymbol": exposePublicSymbol,
|
|
"RegisteredPointer_fromWireType": RegisteredPointer_fromWireType,
|
|
"___cxa_pure_virtual": ___cxa_pure_virtual,
|
|
"_pthread_getspecific": _pthread_getspecific,
|
|
"_pthread_cond_wait": _pthread_cond_wait,
|
|
"RegisteredPointer_destructor": RegisteredPointer_destructor,
|
|
"__embind_register_value_array_element": __embind_register_value_array_element,
|
|
"__embind_register_memory_view": __embind_register_memory_view,
|
|
"getInheritedInstance": getInheritedInstance,
|
|
"___syscall40": ___syscall40,
|
|
"setDelayFunction": setDelayFunction,
|
|
"___gxx_personality_v0": ___gxx_personality_v0,
|
|
"extendError": extendError,
|
|
"___syscall4": ___syscall4,
|
|
"__embind_register_void": __embind_register_void,
|
|
"__embind_register_smart_ptr": __embind_register_smart_ptr,
|
|
"__embind_register_function": __embind_register_function,
|
|
"_pthread_mutexattr_destroy": _pthread_mutexattr_destroy,
|
|
"_strftime_l": _strftime_l,
|
|
"RegisteredPointer_getPointee": RegisteredPointer_getPointee,
|
|
"__emval_register": __emval_register,
|
|
"__embind_register_std_wstring": __embind_register_std_wstring,
|
|
"ClassHandle_isAliasOf": ClassHandle_isAliasOf,
|
|
"__emval_incref": __emval_incref,
|
|
"RegisteredPointer": RegisteredPointer,
|
|
"__arraySum": __arraySum,
|
|
"readLatin1String": readLatin1String,
|
|
"_pthread_mutex_destroy": _pthread_mutex_destroy,
|
|
"getBasestPointer": getBasestPointer,
|
|
"getInheritedInstanceCount": getInheritedInstanceCount,
|
|
"__embind_register_float": __embind_register_float,
|
|
"integerReadValueFromPointer": integerReadValueFromPointer,
|
|
"___unlock": ___unlock,
|
|
"_pthread_mutexattr_settype": _pthread_mutexattr_settype,
|
|
"_pthread_mutexattr_init": _pthread_mutexattr_init,
|
|
"_pthread_setspecific": _pthread_setspecific,
|
|
"genericPointerToWireType": genericPointerToWireType,
|
|
"registerType": registerType,
|
|
"___cxa_throw": ___cxa_throw,
|
|
"__embind_register_enum": __embind_register_enum,
|
|
"__emval_new_cstring": __emval_new_cstring,
|
|
"count_emval_handles": count_emval_handles,
|
|
"requireFunction": requireFunction,
|
|
"_atexit": _atexit,
|
|
"_pthread_mutex_init": _pthread_mutex_init,
|
|
"___map_file": ___map_file,
|
|
"DYNAMICTOP_PTR": DYNAMICTOP_PTR,
|
|
"tempDoublePtr": tempDoublePtr,
|
|
"ABORT": ABORT,
|
|
"STACKTOP": STACKTOP,
|
|
"STACK_MAX": STACK_MAX,
|
|
"___dso_handle": ___dso_handle
|
|
};
|
|
var asm = Module["asm"](Module.asmGlobalArg, Module.asmLibraryArg, buffer);
|
|
Module["asm"] = asm;
|
|
var __GLOBAL__sub_I_system_cpp = Module["__GLOBAL__sub_I_system_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_system_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_umatrix_cpp = Module["__GLOBAL__sub_I_umatrix_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_umatrix_cpp"].apply(null, arguments)
|
|
});
|
|
var stackSave = Module["stackSave"] = (function() {
|
|
return Module["asm"]["stackSave"].apply(null, arguments)
|
|
});
|
|
var setThrew = Module["setThrew"] = (function() {
|
|
return Module["asm"]["setThrew"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_persistence_cpp = Module["__GLOBAL__sub_I_persistence_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_persistence_cpp"].apply(null, arguments)
|
|
});
|
|
var _fflush = Module["_fflush"] = (function() {
|
|
return Module["asm"]["_fflush"].apply(null, arguments)
|
|
});
|
|
var ___cxa_is_pointer_type = Module["___cxa_is_pointer_type"] = (function() {
|
|
return Module["asm"]["___cxa_is_pointer_type"].apply(null, arguments)
|
|
});
|
|
var _memset = Module["_memset"] = (function() {
|
|
return Module["asm"]["_memset"].apply(null, arguments)
|
|
});
|
|
var _sbrk = Module["_sbrk"] = (function() {
|
|
return Module["asm"]["_sbrk"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_imgwarp_cpp = Module["__GLOBAL__sub_I_imgwarp_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_imgwarp_cpp"].apply(null, arguments)
|
|
});
|
|
var _memcpy = Module["_memcpy"] = (function() {
|
|
return Module["asm"]["_memcpy"].apply(null, arguments)
|
|
});
|
|
var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = (function() {
|
|
return Module["asm"]["_llvm_bswap_i32"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1435 = Module["___cxx_global_var_init_1435"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1435"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1434 = Module["___cxx_global_var_init_1434"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1434"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1436 = Module["___cxx_global_var_init_1436"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1436"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1431 = Module["___cxx_global_var_init_1431"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1431"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1430 = Module["___cxx_global_var_init_1430"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1430"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1433 = Module["___cxx_global_var_init_1433"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1433"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1432 = Module["___cxx_global_var_init_1432"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1432"].apply(null, arguments)
|
|
});
|
|
var stackAlloc = Module["stackAlloc"] = (function() {
|
|
return Module["asm"]["stackAlloc"].apply(null, arguments)
|
|
});
|
|
var getTempRet0 = Module["getTempRet0"] = (function() {
|
|
return Module["asm"]["getTempRet0"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_bind_cpp = Module["__GLOBAL__sub_I_bind_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_bind_cpp"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_38 = Module["___cxx_global_var_init_38"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_38"].apply(null, arguments)
|
|
});
|
|
var setTempRet0 = Module["setTempRet0"] = (function() {
|
|
return Module["asm"]["setTempRet0"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_36 = Module["___cxx_global_var_init_36"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_36"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_37 = Module["___cxx_global_var_init_37"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_37"].apply(null, arguments)
|
|
});
|
|
var _pthread_mutex_unlock = Module["_pthread_mutex_unlock"] = (function() {
|
|
return Module["asm"]["_pthread_mutex_unlock"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__I_000101 = Module["__GLOBAL__I_000101"] = (function() {
|
|
return Module["asm"]["__GLOBAL__I_000101"].apply(null, arguments)
|
|
});
|
|
var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = (function() {
|
|
return Module["asm"]["_emscripten_get_global_libc"].apply(null, arguments)
|
|
});
|
|
var ___getTypeName = Module["___getTypeName"] = (function() {
|
|
return Module["asm"]["___getTypeName"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_iostream_cpp = Module["__GLOBAL__sub_I_iostream_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_iostream_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_knearest_cpp = Module["__GLOBAL__sub_I_knearest_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_knearest_cpp"].apply(null, arguments)
|
|
});
|
|
var _pthread_cond_broadcast = Module["_pthread_cond_broadcast"] = (function() {
|
|
return Module["asm"]["_pthread_cond_broadcast"].apply(null, arguments)
|
|
});
|
|
var _pthread_mutex_lock = Module["_pthread_mutex_lock"] = (function() {
|
|
return Module["asm"]["_pthread_mutex_lock"].apply(null, arguments)
|
|
});
|
|
var ___errno_location = Module["___errno_location"] = (function() {
|
|
return Module["asm"]["___errno_location"].apply(null, arguments)
|
|
});
|
|
var ___cxa_can_catch = Module["___cxa_can_catch"] = (function() {
|
|
return Module["asm"]["___cxa_can_catch"].apply(null, arguments)
|
|
});
|
|
var _free = Module["_free"] = (function() {
|
|
return Module["asm"]["_free"].apply(null, arguments)
|
|
});
|
|
var runPostSets = Module["runPostSets"] = (function() {
|
|
return Module["asm"]["runPostSets"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_hog_cpp = Module["__GLOBAL__sub_I_hog_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_hog_cpp"].apply(null, arguments)
|
|
});
|
|
var establishStackSpace = Module["establishStackSpace"] = (function() {
|
|
return Module["asm"]["establishStackSpace"].apply(null, arguments)
|
|
});
|
|
var _memmove = Module["_memmove"] = (function() {
|
|
return Module["asm"]["_memmove"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_bindings_cpp = Module["__GLOBAL__sub_I_bindings_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_bindings_cpp"].apply(null, arguments)
|
|
});
|
|
var stackRestore = Module["stackRestore"] = (function() {
|
|
return Module["asm"]["stackRestore"].apply(null, arguments)
|
|
});
|
|
var _malloc = Module["_malloc"] = (function() {
|
|
return Module["asm"]["_malloc"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_histogram_cpp = Module["__GLOBAL__sub_I_histogram_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_histogram_cpp"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_haar_cpp = Module["__GLOBAL__sub_I_haar_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_haar_cpp"].apply(null, arguments)
|
|
});
|
|
var _emscripten_replace_memory = Module["_emscripten_replace_memory"] = (function() {
|
|
return Module["asm"]["_emscripten_replace_memory"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1428 = Module["___cxx_global_var_init_1428"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1428"].apply(null, arguments)
|
|
});
|
|
var ___cxx_global_var_init_1429 = Module["___cxx_global_var_init_1429"] = (function() {
|
|
return Module["asm"]["___cxx_global_var_init_1429"].apply(null, arguments)
|
|
});
|
|
var __GLOBAL__sub_I_loadsave_cpp = Module["__GLOBAL__sub_I_loadsave_cpp"] = (function() {
|
|
return Module["asm"]["__GLOBAL__sub_I_loadsave_cpp"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifiii = Module["dynCall_viiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiid = Module["dynCall_iiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiddd = Module["dynCall_viiiiddd"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiddd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidiii = Module["dynCall_viiiidiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiddi = Module["dynCall_viiiiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidiii = Module["dynCall_viiidiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiii = Module["dynCall_iiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidddiiii = Module["dynCall_viiiidddiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidddiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiffiii = Module["dynCall_viiiffiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiii = Module["dynCall_viiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iidd = Module["dynCall_iidd"] = (function() {
|
|
return Module["asm"]["dynCall_iidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiid = Module["dynCall_viiiiiiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiffii = Module["dynCall_viiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iidi = Module["dynCall_iidi"] = (function() {
|
|
return Module["asm"]["dynCall_iidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_dii = Module["dynCall_dii"] = (function() {
|
|
return Module["asm"]["dynCall_dii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifff = Module["dynCall_viiifff"] = (function() {
|
|
return Module["asm"]["dynCall_viiifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifff = Module["dynCall_iifff"] = (function() {
|
|
return Module["asm"]["dynCall_iifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_vidi = Module["dynCall_vidi"] = (function() {
|
|
return Module["asm"]["dynCall_vidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiiiiid = Module["dynCall_fiiiiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiddii = Module["dynCall_viiddii"] = (function() {
|
|
return Module["asm"]["dynCall_viiddii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiddiddi = Module["dynCall_viiiiddiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiddiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiifiii = Module["dynCall_iiiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiidi = Module["dynCall_viiiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiddidddd = Module["dynCall_viiddidddd"] = (function() {
|
|
return Module["asm"]["dynCall_viiddidddd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiddi = Module["dynCall_viiiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiidi = Module["dynCall_viiiiiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fii = Module["dynCall_fii"] = (function() {
|
|
return Module["asm"]["dynCall_fii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidii = Module["dynCall_viiidii"] = (function() {
|
|
return Module["asm"]["dynCall_viiidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiifii = Module["dynCall_viiiiifii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifiiiiiii = Module["dynCall_iiifiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiifiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_di = Module["dynCall_di"] = (function() {
|
|
return Module["asm"]["dynCall_di"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiid = Module["dynCall_viiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifiiiiiii = Module["dynCall_viifiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viifiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidiiddi = Module["dynCall_viiiidiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiididii = Module["dynCall_viiididii"] = (function() {
|
|
return Module["asm"]["dynCall_viiididii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiiiiii = Module["dynCall_diiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_diiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiddiddi = Module["dynCall_iiiiiddiddi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiddiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidddddi = Module["dynCall_viidddddi"] = (function() {
|
|
return Module["asm"]["dynCall_viidddddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiiii = Module["dynCall_fiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddiiid = Module["dynCall_viiiddiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiidddddi = Module["dynCall_iiidddddi"] = (function() {
|
|
return Module["asm"]["dynCall_iiidddddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_diidi = Module["dynCall_diidi"] = (function() {
|
|
return Module["asm"]["dynCall_diidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiddi = Module["dynCall_viiiiiiiiiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiii = Module["dynCall_iiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiid = Module["dynCall_iiiid"] = (function() {
|
|
return Module["asm"]["dynCall_iiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiif = Module["dynCall_iiiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiii = Module["dynCall_iiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiddiii = Module["dynCall_viiddiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiddiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiddiid = Module["dynCall_viiddiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiddiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiididiii = Module["dynCall_iiiiiiiididiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiididiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiffiii = Module["dynCall_iiiiffiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiffiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iidddd = Module["dynCall_iidddd"] = (function() {
|
|
return Module["asm"]["dynCall_iidddd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidiiid = Module["dynCall_viidiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viidiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidiiii = Module["dynCall_viiiidiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidiiid = Module["dynCall_viiidiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiidiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiif = Module["dynCall_viiif"] = (function() {
|
|
return Module["asm"]["dynCall_viiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiiddi = Module["dynCall_diiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_diiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiii = Module["dynCall_iiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifffffii = Module["dynCall_iifffffii"] = (function() {
|
|
return Module["asm"]["dynCall_iifffffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiiiiiii = Module["dynCall_diiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_diiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidd = Module["dynCall_viiidd"] = (function() {
|
|
return Module["asm"]["dynCall_viiidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddddii = Module["dynCall_viiiddddii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddddii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiid = Module["dynCall_viiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiddddii = Module["dynCall_viiiiddddii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiddddii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifi = Module["dynCall_vifi"] = (function() {
|
|
return Module["asm"]["dynCall_vifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifff = Module["dynCall_vifff"] = (function() {
|
|
return Module["asm"]["dynCall_vifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiii = Module["dynCall_viiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidiiii = Module["dynCall_viiidiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiidiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiii = Module["dynCall_fiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiddidd = Module["dynCall_viiddidd"] = (function() {
|
|
return Module["asm"]["dynCall_viiddidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidi = Module["dynCall_viiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiidii = Module["dynCall_iiiiiidii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiddd = Module["dynCall_iiddd"] = (function() {
|
|
return Module["asm"]["dynCall_iiddd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiii = Module["dynCall_viiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiddi = Module["dynCall_diiddi"] = (function() {
|
|
return Module["asm"]["dynCall_diiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_diii = Module["dynCall_diii"] = (function() {
|
|
return Module["asm"]["dynCall_diii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddd = Module["dynCall_viiiddd"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddidddd = Module["dynCall_viiiddidddd"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddidddd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiiiiid = Module["dynCall_viiiiiiiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddidd = Module["dynCall_viiiddidd"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidiiiidi = Module["dynCall_viiidiiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiidiiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddi = Module["dynCall_viiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiii = Module["dynCall_fiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiii = Module["dynCall_iiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiid = Module["dynCall_viiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiij = Module["dynCall_iiiiij"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiij"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiffi = Module["dynCall_iiiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidii = Module["dynCall_viidii"] = (function() {
|
|
return Module["asm"]["dynCall_viidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiff = Module["dynCall_viiiff"] = (function() {
|
|
return Module["asm"]["dynCall_viiiff"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiid = Module["dynCall_iiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiif = Module["dynCall_iiiiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiii = Module["dynCall_viiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vif = Module["dynCall_vif"] = (function() {
|
|
return Module["asm"]["dynCall_vif"].apply(null, arguments)
|
|
});
|
|
var dynCall_vid = Module["dynCall_vid"] = (function() {
|
|
return Module["asm"]["dynCall_vid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiidi = Module["dynCall_iiidi"] = (function() {
|
|
return Module["asm"]["dynCall_iiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiidd = Module["dynCall_iiidd"] = (function() {
|
|
return Module["asm"]["dynCall_iiidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_vii = Module["dynCall_vii"] = (function() {
|
|
return Module["asm"]["dynCall_vii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiffff = Module["dynCall_iiffff"] = (function() {
|
|
return Module["asm"]["dynCall_iiffff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifiii = Module["dynCall_viiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidd = Module["dynCall_viidd"] = (function() {
|
|
return Module["asm"]["dynCall_viidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifii = Module["dynCall_viifii"] = (function() {
|
|
return Module["asm"]["dynCall_viifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viidi = Module["dynCall_viidi"] = (function() {
|
|
return Module["asm"]["dynCall_viidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiffii = Module["dynCall_viiiiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidiiddi = Module["dynCall_viiidiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiidiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiidii = Module["dynCall_iiiidii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiid = Module["dynCall_diiid"] = (function() {
|
|
return Module["asm"]["dynCall_diiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiidddiiii = Module["dynCall_viiidddiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiidddiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiid = Module["dynCall_viiiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiddi = Module["dynCall_viiiiiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiii = Module["dynCall_diiii"] = (function() {
|
|
return Module["asm"]["dynCall_diiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiidiiddi = Module["dynCall_viiiiidiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiidiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiddddddi = Module["dynCall_viiddddddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiddddddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiifi = Module["dynCall_iiiiifi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiiiiiid = Module["dynCall_fiiiiiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiifii = Module["dynCall_viiifii"] = (function() {
|
|
return Module["asm"]["dynCall_viiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiidii = Module["dynCall_viiiiidii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiii = Module["dynCall_fiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iif = Module["dynCall_iif"] = (function() {
|
|
return Module["asm"]["dynCall_iif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiid = Module["dynCall_viiiiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidi = Module["dynCall_viiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiddiiid = Module["dynCall_viiiiddiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiddiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiid = Module["dynCall_viiiiiid"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iii = Module["dynCall_iii"] = (function() {
|
|
return Module["asm"]["dynCall_iii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddii = Module["dynCall_viiiddii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiidi = Module["dynCall_viiiiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vdiii = Module["dynCall_vdiii"] = (function() {
|
|
return Module["asm"]["dynCall_vdiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiddddddi = Module["dynCall_iiiddddddi"] = (function() {
|
|
return Module["asm"]["dynCall_iiiddddddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiidiiiii = Module["dynCall_viiiiidiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiidiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viii = Module["dynCall_viii"] = (function() {
|
|
return Module["asm"]["dynCall_viii"].apply(null, arguments)
|
|
});
|
|
var dynCall_v = Module["dynCall_v"] = (function() {
|
|
return Module["asm"]["dynCall_v"].apply(null, arguments)
|
|
});
|
|
var dynCall_viid = Module["dynCall_viid"] = (function() {
|
|
return Module["asm"]["dynCall_viid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiff = Module["dynCall_viiiiff"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viif = Module["dynCall_viif"] = (function() {
|
|
return Module["asm"]["dynCall_viif"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiddiid = Module["dynCall_iiiddiid"] = (function() {
|
|
return Module["asm"]["dynCall_iiiddiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiidiiii = Module["dynCall_viiiiidiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiidiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vi = Module["dynCall_vi"] = (function() {
|
|
return Module["asm"]["dynCall_vi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiiii = Module["dynCall_iiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidiiiidi = Module["dynCall_viiiidiiiidi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidiiiidi"].apply(null, arguments)
|
|
});
|
|
var dynCall_ii = Module["dynCall_ii"] = (function() {
|
|
return Module["asm"]["dynCall_ii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viijii = Module["dynCall_viijii"] = (function() {
|
|
return Module["asm"]["dynCall_viijii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifff = Module["dynCall_viiiifff"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiiiddi = Module["dynCall_viiiiiiiddi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiiiddi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viifi = Module["dynCall_viifi"] = (function() {
|
|
return Module["asm"]["dynCall_viifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiff = Module["dynCall_viiff"] = (function() {
|
|
return Module["asm"]["dynCall_viiff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiffi = Module["dynCall_viiiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiifi = Module["dynCall_iiifi"] = (function() {
|
|
return Module["asm"]["dynCall_iiifi"].apply(null, arguments)
|
|
});
|
|
var dynCall_vidii = Module["dynCall_vidii"] = (function() {
|
|
return Module["asm"]["dynCall_vidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vididdii = Module["dynCall_vididdii"] = (function() {
|
|
return Module["asm"]["dynCall_vididdii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiddiii = Module["dynCall_viiiddiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiddiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiffii = Module["dynCall_viiiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiidiiiii = Module["dynCall_viiiiiidiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiidiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fiiiiii = Module["dynCall_fiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_fiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiifii = Module["dynCall_viiiifii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiifii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viffff = Module["dynCall_viffff"] = (function() {
|
|
return Module["asm"]["dynCall_viffff"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiii = Module["dynCall_iiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viididii = Module["dynCall_viididii"] = (function() {
|
|
return Module["asm"]["dynCall_viididii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiif = Module["dynCall_iiif"] = (function() {
|
|
return Module["asm"]["dynCall_iiif"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiffi = Module["dynCall_viiiffi"] = (function() {
|
|
return Module["asm"]["dynCall_viiiffi"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiiii = Module["dynCall_diiiii"] = (function() {
|
|
return Module["asm"]["dynCall_diiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiiid = Module["dynCall_diiiid"] = (function() {
|
|
return Module["asm"]["dynCall_diiiid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiiiiiii = Module["dynCall_iiiiiiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiifiii = Module["dynCall_iiiifiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiifiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_fi = Module["dynCall_fi"] = (function() {
|
|
return Module["asm"]["dynCall_fi"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiiffii = Module["dynCall_viiiiiffii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiiffii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiidid = Module["dynCall_iiidid"] = (function() {
|
|
return Module["asm"]["dynCall_iiidid"].apply(null, arguments)
|
|
});
|
|
var dynCall_iid = Module["dynCall_iid"] = (function() {
|
|
return Module["asm"]["dynCall_iid"].apply(null, arguments)
|
|
});
|
|
var dynCall_i = Module["dynCall_i"] = (function() {
|
|
return Module["asm"]["dynCall_i"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiidii = Module["dynCall_iiiiidii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiidii"].apply(null, arguments)
|
|
});
|
|
var dynCall_diiiiii = Module["dynCall_diiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_diiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_vifffff = Module["dynCall_vifffff"] = (function() {
|
|
return Module["asm"]["dynCall_vifffff"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiiidiii = Module["dynCall_viiiiidiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiiiidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iiiiiiiii = Module["dynCall_iiiiiiiii"] = (function() {
|
|
return Module["asm"]["dynCall_iiiiiiiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viididdii = Module["dynCall_viididdii"] = (function() {
|
|
return Module["asm"]["dynCall_viididdii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiii = Module["dynCall_viiii"] = (function() {
|
|
return Module["asm"]["dynCall_viiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_viiiidd = Module["dynCall_viiiidd"] = (function() {
|
|
return Module["asm"]["dynCall_viiiidd"].apply(null, arguments)
|
|
});
|
|
var dynCall_vidiii = Module["dynCall_vidiii"] = (function() {
|
|
return Module["asm"]["dynCall_vidiii"].apply(null, arguments)
|
|
});
|
|
var dynCall_iifffff = Module["dynCall_iifffff"] = (function() {
|
|
return Module["asm"]["dynCall_iifffff"].apply(null, arguments)
|
|
});
|
|
Runtime.stackAlloc = Module["stackAlloc"];
|
|
Runtime.stackSave = Module["stackSave"];
|
|
Runtime.stackRestore = Module["stackRestore"];
|
|
Runtime.establishStackSpace = Module["establishStackSpace"];
|
|
Runtime.setTempRet0 = Module["setTempRet0"];
|
|
Runtime.getTempRet0 = Module["getTempRet0"];
|
|
Module["asm"] = asm;
|
|
if (memoryInitializer) {
|
|
if (typeof Module["locateFile"] === "function") {
|
|
memoryInitializer = Module["locateFile"](memoryInitializer)
|
|
} else if (Module["memoryInitializerPrefixURL"]) {
|
|
memoryInitializer = Module["memoryInitializerPrefixURL"] + memoryInitializer
|
|
}
|
|
if (ENVIRONMENT_IS_NODE || ENVIRONMENT_IS_SHELL) {
|
|
var data = Module["readBinary"](memoryInitializer);
|
|
HEAPU8.set(data, Runtime.GLOBAL_BASE)
|
|
} else {
|
|
addRunDependency("memory initializer");
|
|
var applyMemoryInitializer = (function(data) {
|
|
if (data.byteLength) data = new Uint8Array(data);
|
|
HEAPU8.set(data, Runtime.GLOBAL_BASE);
|
|
if (Module["memoryInitializerRequest"]) delete Module["memoryInitializerRequest"].response;
|
|
removeRunDependency("memory initializer")
|
|
});
|
|
|
|
function doBrowserLoad() {
|
|
Module["readAsync"](memoryInitializer, applyMemoryInitializer, (function() {
|
|
throw "could not load memory initializer " + memoryInitializer
|
|
}))
|
|
}
|
|
if (Module["memoryInitializerRequest"]) {
|
|
function useRequest() {
|
|
var request = Module["memoryInitializerRequest"];
|
|
if (request.status !== 200 && request.status !== 0) {
|
|
console.warn("a problem seems to have happened with Module.memoryInitializerRequest, status: " + request.status + ", retrying " + memoryInitializer);
|
|
doBrowserLoad();
|
|
return
|
|
}
|
|
applyMemoryInitializer(request.response)
|
|
}
|
|
if (Module["memoryInitializerRequest"].response) {
|
|
setTimeout(useRequest, 0)
|
|
} else {
|
|
Module["memoryInitializerRequest"].addEventListener("load", useRequest)
|
|
}
|
|
} else {
|
|
doBrowserLoad()
|
|
}
|
|
}
|
|
}
|
|
Module["then"] = (function(func) {
|
|
if (Module["calledRun"]) {
|
|
func(Module)
|
|
} else {
|
|
var old = Module["onRuntimeInitialized"];
|
|
Module["onRuntimeInitialized"] = (function() {
|
|
if (old) old();
|
|
func(Module)
|
|
})
|
|
}
|
|
return Module
|
|
});
|
|
|
|
function ExitStatus(status) {
|
|
this.name = "ExitStatus";
|
|
this.message = "Program terminated with exit(" + status + ")";
|
|
this.status = status
|
|
}
|
|
ExitStatus.prototype = new Error;
|
|
ExitStatus.prototype.constructor = ExitStatus;
|
|
var initialStackTop;
|
|
var preloadStartTime = null;
|
|
var calledMain = false;
|
|
dependenciesFulfilled = function runCaller() {
|
|
if (!Module["calledRun"]) run();
|
|
if (!Module["calledRun"]) dependenciesFulfilled = runCaller
|
|
};
|
|
Module["callMain"] = Module.callMain = function callMain(args) {
|
|
args = args || [];
|
|
ensureInitRuntime();
|
|
var argc = args.length + 1;
|
|
|
|
function pad() {
|
|
for (var i = 0; i < 4 - 1; i++) {
|
|
argv.push(0)
|
|
}
|
|
}
|
|
var argv = [allocate(intArrayFromString(Module["thisProgram"]), "i8", ALLOC_NORMAL)];
|
|
pad();
|
|
for (var i = 0; i < argc - 1; i = i + 1) {
|
|
argv.push(allocate(intArrayFromString(args[i]), "i8", ALLOC_NORMAL));
|
|
pad()
|
|
}
|
|
argv.push(0);
|
|
argv = allocate(argv, "i32", ALLOC_NORMAL);
|
|
try {
|
|
var ret = Module["_main"](argc, argv, 0);
|
|
exit(ret, true)
|
|
} catch (e) {
|
|
if (e instanceof ExitStatus) {
|
|
return
|
|
} else if (e == "SimulateInfiniteLoop") {
|
|
Module["noExitRuntime"] = true;
|
|
return
|
|
} else {
|
|
var toLog = e;
|
|
if (e && typeof e === "object" && e.stack) {
|
|
toLog = [e, e.stack]
|
|
}
|
|
Module.printErr("exception thrown: " + toLog);
|
|
Module["quit"](1, e)
|
|
}
|
|
} finally {
|
|
calledMain = true
|
|
}
|
|
};
|
|
|
|
function run(args) {
|
|
args = args || Module["arguments"];
|
|
if (preloadStartTime === null) preloadStartTime = Date.now();
|
|
if (runDependencies > 0) {
|
|
return
|
|
}
|
|
preRun();
|
|
if (runDependencies > 0) return;
|
|
if (Module["calledRun"]) return;
|
|
|
|
function doRun() {
|
|
if (Module["calledRun"]) return;
|
|
Module["calledRun"] = true;
|
|
if (ABORT) return;
|
|
ensureInitRuntime();
|
|
preMain();
|
|
if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"]();
|
|
if (Module["_main"] && shouldRunNow) Module["callMain"](args);
|
|
postRun()
|
|
}
|
|
if (Module["setStatus"]) {
|
|
Module["setStatus"]("Running...");
|
|
setTimeout((function() {
|
|
setTimeout((function() {
|
|
Module["setStatus"]("")
|
|
}), 1);
|
|
doRun()
|
|
}), 1)
|
|
} else {
|
|
doRun()
|
|
}
|
|
}
|
|
Module["run"] = Module.run = run;
|
|
|
|
function exit(status, implicit) {
|
|
if (implicit && Module["noExitRuntime"]) {
|
|
return
|
|
}
|
|
if (Module["noExitRuntime"]) {} else {
|
|
ABORT = true;
|
|
EXITSTATUS = status;
|
|
STACKTOP = initialStackTop;
|
|
exitRuntime();
|
|
if (Module["onExit"]) Module["onExit"](status)
|
|
}
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
process["exit"](status)
|
|
}
|
|
Module["quit"](status, new ExitStatus(status))
|
|
}
|
|
Module["exit"] = Module.exit = exit;
|
|
var abortDecorators = [];
|
|
|
|
function abort(what) {
|
|
if (what !== undefined) {
|
|
Module.print(what);
|
|
Module.printErr(what);
|
|
what = JSON.stringify(what)
|
|
} else {
|
|
what = ""
|
|
}
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
var extra = "\nIf this abort() is unexpected, build with -s ASSERTIONS=1 which can give more information.";
|
|
var output = "abort(" + what + ") at " + stackTrace() + extra;
|
|
if (abortDecorators) {
|
|
abortDecorators.forEach((function(decorator) {
|
|
output = decorator(output, what)
|
|
}))
|
|
}
|
|
throw output
|
|
}
|
|
Module["abort"] = Module.abort = abort;
|
|
if (Module["preInit"]) {
|
|
if (typeof Module["preInit"] == "function") Module["preInit"] = [Module["preInit"]];
|
|
while (Module["preInit"].length > 0) {
|
|
Module["preInit"].pop()()
|
|
}
|
|
}
|
|
var shouldRunNow = true;
|
|
if (Module["noInitialRun"]) {
|
|
shouldRunNow = false
|
|
}
|
|
run()
|
|
return cv;
|
|
};
|
|
if (typeof module === "object" && module.exports) {
|
|
module['exports'] = cv;
|
|
};
|
|
|
|
return cv(Module);
|
|
}));
|
|
|